1.0 2010-04-08 22:04:30 UTC 2025-11-18 22:16:42 UTC FDB000263 5-5'-Dehydrodiferulic acid 5-5'-dehydrodiferulic acid, also known as 8-O-4'-diferulic acid, belongs to biphenyls and derivatives class of compounds. Those are organic compounds containing to benzene rings linked together by a C-C bond. 5-5'-dehydrodiferulic acid is practically insoluble (in water) and a weakly acidic compound (based on its pKa). 5-5'-dehydrodiferulic acid can be found in a number of food items such as corn, common wheat, semolina, and hard wheat, which makes 5-5'-dehydrodiferulic acid a potential biomarker for the consumption of these food products. C20H18O8 386.3521 386.100167552 (2E)-3-(3-{5-[(1E)-2-carboxyeth-1-en-1-yl]-2-hydroxy-3-methoxyphenyl}-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid diferulic acid COC1=C(O)C(=CC(\C=C\C(O)=O)=C1)C1=CC(\C=C\C(O)=O)=CC(OC)=C1O InChI=1S/C20H18O8/c1-27-15-9-11(3-5-17(21)22)7-13(19(15)25)14-8-12(4-6-18(23)24)10-16(28-2)20(14)26/h3-10,25-26H,1-2H3,(H,21,22)(H,23,24)/b5-3+,6-4+ LBQZVWQOPFFQJI-GGWOSOGESA-N belongs to the class of organic compounds known as biphenyls and derivatives. These are organic compounds containing to benzene rings linked together by a C-C bond. Biphenyls and derivatives Organic compounds Benzenoids Benzene and substituted derivatives Biphenyls and derivatives Aromatic homomonocyclic compounds Alkyl aryl ethers Anisoles Carbonyl compounds Carboxylic acids Cinnamic acids Coumaric acids and derivatives Dicarboxylic acids and derivatives Hydrocarbon derivatives Hydroxycinnamic acids Methoxybenzenes Methoxyphenols Organic oxides Phenoxy compounds Styrenes Alkyl aryl ether Anisole Aromatic homomonocyclic compound Biphenyl Carbonyl group Carboxylic acid Carboxylic acid derivative Cinnamic acid Cinnamic acid or derivatives Coumaric acid or derivatives Dicarboxylic acid or derivatives Ether Hydrocarbon derivative Hydroxycinnamic acid Hydroxycinnamic acid or derivatives Methoxybenzene Methoxyphenol Organic oxide Organic oxygen compound Organooxygen compound Phenol Phenol ether Phenoxy compound Styrene Neolignans ferulic acid logp 2.99 ALOGPS logs -4.54 ALOGPS solubility 1.12e-02 g/l ALOGPS logp 3.02 ChemAxon pka_strongest_acidic 3.31 ChemAxon pka_strongest_basic -4.6 ChemAxon iupac (2E)-3-(3-{5-[(1E)-2-carboxyeth-1-en-1-yl]-2-hydroxy-3-methoxyphenyl}-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid ChemAxon average_mass 386.3521 ChemAxon mono_mass 386.100167552 ChemAxon smiles COC1=C(O)C(=CC(\C=C\C(O)=O)=C1)C1=CC(\C=C\C(O)=O)=CC(OC)=C1O ChemAxon formula C20H18O8 ChemAxon inchi InChI=1S/C20H18O8/c1-27-15-9-11(3-5-17(21)22)7-13(19(15)25)14-8-12(4-6-18(23)24)10-16(28-2)20(14)26/h3-10,25-26H,1-2H3,(H,21,22)(H,23,24)/b5-3+,6-4+ ChemAxon inchikey LBQZVWQOPFFQJI-GGWOSOGESA-N ChemAxon polar_surface_area 133.52 ChemAxon refractivity 102.09 ChemAxon polarizability 39.09 ChemAxon rotatable_bond_count 7 ChemAxon acceptor_count 8 ChemAxon donor_count 4 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 88674 Specdb::MsMs 88675 Specdb::MsMs 88676 Specdb::MsMs 151452 Specdb::MsMs 151453 Specdb::MsMs 151454 Specdb::MsMs 3596920 Specdb::MsMs 3596921 Specdb::MsMs 3596922 Specdb::MsMs 3596923 Specdb::MsMs 3596924 Specdb::MsMs 3596925 Barley Type 1 specific Hordeum vulgare 4513 Common wheat Type 1 specific Triticum aestivum 4565 1.044 1.04400003 1.04400003 mg/100 g Corn Type 1 specific Zea mays 4577 6.24188 6.24187994 6.24187994 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 0.109975 0.109974997 0.109974997 mg/100 g Oat Type 1 specific Avena sativa 4498 Rye Type 1 specific Secale cereale 4550 3.196539 5.371578919 1.021499991 mg/100 g Semolina Type 2 specific 4.496648 4.496647558 4.496647558 mg/100 g