1.0 2010-04-08 22:04:30 UTC 2019-11-26 02:54:37 UTC FDB000271 8-4'-Dehydrodiferulic acid 8-4'-dehydrodiferulic acid belongs to phenylpyruvic acid derivatives class of compounds. Those are compounds containing a phenylpyruvic acid moiety, which consists of a phenyl group substituted at the second position by an pyruvic acid. 8-4'-dehydrodiferulic acid is practically insoluble (in water) and a moderately acidic compound (based on its pKa). 8-4'-dehydrodiferulic acid can be found in a number of food items such as corn, semolina, common wheat, and hard wheat, which makes 8-4'-dehydrodiferulic acid a potential biomarker for the consumption of these food products. 8-4'-Dehydrodiferulic acid 8-O-4'-Dehydrodiferulic acid C20H18O8 386.3521 386.100167552 (2E)-2-{4-[(1Z)-2-carboxyeth-1-en-1-yl]-2-methoxyphenoxy}-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid (2E)-2-{4-[(1Z)-2-carboxyeth-1-en-1-yl]-2-methoxyphenoxy}-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid COC1=C(O)C=CC(\C=C(\OC2=C(OC)C=C(\C=C/C(O)=O)C=C2)C(O)=O)=C1 InChI=1S/C20H18O8/c1-26-16-10-13(3-6-14(16)21)11-18(20(24)25)28-15-7-4-12(5-8-19(22)23)9-17(15)27-2/h3-11,21H,1-2H3,(H,22,23)(H,24,25)/b8-5-,18-11+ GGCXWTMEZZGUFT-WBZVOSOQSA-N belongs to the class of organic compounds known as phenylpyruvic acid derivatives. Phenylpyruvic acid derivatives are compounds containing a phenylpyruvic acid moiety, which consists of a phenyl group substituted at the second position by an pyruvic acid. Phenylpyruvic acid derivatives Organic compounds Benzenoids Benzene and substituted derivatives Phenylpyruvic acid derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Alkyl aryl ethers Anisoles Carbonyl compounds Carboxylic acids Cinnamic acids Coumaric acids and derivatives Dicarboxylic acids and derivatives Hydrocarbon derivatives Hydroxycinnamic acids Methoxybenzenes Methoxyphenols Organic oxides Phenoxy compounds Phenoxyacetic acid derivatives Styrenes 1-hydroxy-2-unsubstituted benzenoid Alkyl aryl ether Anisole Aromatic homomonocyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Cinnamic acid Cinnamic acid or derivatives Coumaric acid or derivatives Dicarboxylic acid or derivatives Enol-phenylpyruvate Ether Hydrocarbon derivative Hydroxycinnamic acid Hydroxycinnamic acid or derivatives Methoxybenzene Methoxyphenol Organic oxide Organic oxygen compound Organooxygen compound Phenol Phenol ether Phenoxy compound Phenoxyacetate Styrene logp 3.44 ALOGPS logs -4.58 ALOGPS solubility 1.03e-02 g/l ALOGPS logp 2.97 ChemAxon pka_strongest_acidic 2.55 ChemAxon pka_strongest_basic -4.5 ChemAxon iupac (2E)-2-{4-[(1Z)-2-carboxyeth-1-en-1-yl]-2-methoxyphenoxy}-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid ChemAxon average_mass 386.3521 ChemAxon mono_mass 386.100167552 ChemAxon smiles COC1=C(O)C=CC(\C=C(\OC2=C(OC)C=C(\C=C/C(O)=O)C=C2)C(O)=O)=C1 ChemAxon formula C20H18O8 ChemAxon inchi InChI=1S/C20H18O8/c1-26-16-10-13(3-6-14(16)21)11-18(20(24)25)28-15-7-4-12(5-8-19(22)23)9-17(15)27-2/h3-11,21H,1-2H3,(H,22,23)(H,24,25)/b8-5-,18-11+ ChemAxon inchikey GGCXWTMEZZGUFT-WBZVOSOQSA-N ChemAxon polar_surface_area 122.52 ChemAxon refractivity 101.2 ChemAxon polarizability 38.13 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 8 ChemAxon donor_count 3 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 75333 Specdb::MsMs 75334 Specdb::MsMs 75335 Specdb::MsMs 134961 Specdb::MsMs 134962 Specdb::MsMs 134963 Specdb::MsMs 3596950 Specdb::MsMs 3596951 Specdb::MsMs 3596952 Specdb::MsMs 3598247 Specdb::MsMs 3598248 Specdb::MsMs 3598249 Carrot Type 1 specific Daucus carota ssp. sativus 79200 Common wheat Type 1 specific Triticum aestivum 4565 4.698 4.697999954 4.697999954 mg/100 g Corn Type 1 specific Zea mays 4577 5.43004 5.430039883 5.430039883 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 0.260413 0.260412507 0.260412507 mg/100 g Rye Type 1 specific Secale cereale 4550 8.757632 14.575263174 2.939999938 mg/100 g Semolina Type 2 specific 11.030212 11.030212178 11.030212178 mg/100 g