1.0 2010-04-08 22:04:35 UTC 2025-11-18 22:18:38 UTC FDB000475 L-Lysine hydrochloride Dietary supplement, nutrient (S)-2,6-Diaminohexanoic acid monohydrochloride L-Lysine hydrochloride L-Lysine monohydrochloride Lysine hydrochloride, USAN Lysine monohydrochloride C6H15ClN2O2 182.649 182.082205441 (2S)-2,6-diaminohexanoic acid hydrochloride L-lysine hydrochloride 10098-89-2 Cl.NCCCC[C@H](N)C(O)=O InChI=1S/C6H14N2O2.ClH/c7-4-2-1-3-5(8)6(9)10;/h5H,1-4,7-8H2,(H,9,10);1H/t5-;/m0./s1 BVHLGVCQOALMSV-JEDNCBNOSA-N belongs to the class of organic compounds known as l-alpha-amino acids. These are alpha amino acids which have the L-configuration of the alpha-carbon atom. L-alpha-amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Amino acids Amino fatty acids Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Hydrochlorides Medium-chain fatty acids Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Aliphatic acyclic compound Amine Amino acid Amino fatty acid Carbonyl group Carboxylic acid Fatty acid Fatty acyl Hydrocarbon derivative Hydrochloride L-alpha-amino acid Medium-chain fatty acid Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine hydrochloride melting_point Mp 235-236° logp -3.2 ChemAxon pka_strongest_acidic 2.74 ChemAxon pka_strongest_basic 10.29 ChemAxon iupac (2S)-2,6-diaminohexanoic acid hydrochloride ChemAxon average_mass 182.649 ChemAxon mono_mass 182.082205441 ChemAxon smiles Cl.NCCCC[C@H](N)C(O)=O ChemAxon formula C6H15ClN2O2 ChemAxon inchi InChI=1S/C6H14N2O2.ClH/c7-4-2-1-3-5(8)6(9)10;/h5H,1-4,7-8H2,(H,9,10);1H/t5-;/m0./s1 ChemAxon inchikey BVHLGVCQOALMSV-JEDNCBNOSA-N ChemAxon polar_surface_area 89.34 ChemAxon refractivity 37.81 ChemAxon polarizability 15.87 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 103410 Specdb::MsMs 103411 Specdb::MsMs 103412 Specdb::MsMs 169440 Specdb::MsMs 169441 Specdb::MsMs 169442