1.0 2010-04-08 22:04:36 UTC 2025-11-18 22:19:08 UTC FDB000514 Syringic acid Present in various plants free and combined, e.g. principal phenolic constituent of soyabean meal (Glycine max) Syringic acid is a phenol present in some distilled alcohol beverages. It is also a product of microbial (gut) metabolism of anthocyanins and other polyphenols that have been consumed (in fruits and alcoholic beverages - PMID: 18767860). Research suggests that phenolics from wine may play a positive role against oxidation of low-density lipoprotein (LDL), which is a key step in the development of atherosclerosis. Syringic acid is correlated with high antioxidant activity and inhibition of LDL oxidation. (PMID 15545043). Syringic acid is found in many foods, some of which are common pea, mung bean, rosemary, and dill. 3,5-Dimethoxy-4-hydroxybenzoate 3,5-Dimethoxy-4-hydroxybenzoic acid 3,5-Dimethoxy-4-hydroxybenzyl acid 3,5-Dimethoxybenzoic acid 3,5-dimethoxybenzoyl hydrazine 3,5-Dimethyl-4-hydroxybenzoate 3,5-Dimethyl-4-hydroxybenzoic acid 4-Hydroxy-3,5-dimethoxy-benzoic acid 4-Hydroxy-3,5-dimethoxybenzoate 4-Hydroxy-3,5-dimethoxybenzoic acid 4-Hydroxy-3,5-dimethylbenzoate 4-Hydroxy-3,5-dimethylbenzoic acid Benzoic acid, 4-hydroxy-3,5-dimethoxy- Cedar acid Gallate 3,5-dimethyl ether Gallic acid 3,5-dimethyl ether Syringate Syringic acid Syringlicacid C9H10O5 198.174 198.052823422 4-hydroxy-3,5-dimethoxybenzoic acid syringic acid 530-57-4 COC1=CC(=CC(OC)=C1O)C(O)=O InChI=1S/C9H10O5/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4,10H,1-2H3,(H,11,12) JMSVCTWVEWCHDZ-UHFFFAOYSA-N belongs to the class of organic compounds known as gallic acid and derivatives. Gallic acid and derivatives are compounds containing a 3,4,5-trihydroxybenzoic acid moiety. Gallic acid and derivatives Organic compounds Benzenoids Benzene and substituted derivatives Benzoic acids and derivatives Aromatic homomonocyclic compounds Alkyl aryl ethers Anisoles Benzoic acids Benzoyl derivatives Carboxylic acids Dimethoxybenzenes Hydrocarbon derivatives M-methoxybenzoic acids and derivatives Methoxyphenols Monocarboxylic acids and derivatives Organic oxides Phenoxy compounds Alkyl aryl ether Anisole Aromatic homomonocyclic compound Benzoic acid Benzoyl Carboxylic acid Carboxylic acid derivative Dimethoxybenzene Ether Gallic acid or derivatives Hydrocarbon derivative M-dimethoxybenzene M-methoxybenzoic acid or derivatives Methoxybenzene Methoxyphenol Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Phenol Phenol ether Phenoxy compound benzoic acids dimethoxybenzene phenols Solid logp 1.55 ALOGPS logs -1.73 ALOGPS solubility 3.71e+00 g/l ALOGPS melting_point Mp 210° logp 1.01 ChemAxon pka_strongest_acidic 3.93 ChemAxon pka_strongest_basic -4.6 ChemAxon iupac 4-hydroxy-3,5-dimethoxybenzoic acid ChemAxon average_mass 198.174 ChemAxon mono_mass 198.052823422 ChemAxon smiles COC1=CC(=CC(OC)=C1O)C(O)=O ChemAxon formula C9H10O5 ChemAxon inchi InChI=1S/C9H10O5/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4,10H,1-2H3,(H,11,12) ChemAxon inchikey JMSVCTWVEWCHDZ-UHFFFAOYSA-N ChemAxon polar_surface_area 75.99 ChemAxon refractivity 48.22 ChemAxon polarizability 18.77 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 5 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 1921 Specdb::CMs 3343 Specdb::CMs 38258 Specdb::CMs 174980 Specdb::NmrTwoD 1788 Specdb::MsIr 1595 Specdb::MsIr 1596 Specdb::MsIr 1597 Specdb::NmrOneD 1848 Specdb::NmrOneD 3895 Specdb::NmrOneD 4170 Specdb::NmrOneD 5083 Specdb::NmrOneD 5084 Specdb::NmrOneD 109238 Specdb::NmrOneD 109239 Specdb::NmrOneD 109240 Specdb::NmrOneD 109241 Specdb::NmrOneD 109242 Specdb::NmrOneD 109243 Specdb::NmrOneD 109244 Specdb::NmrOneD 109245 Specdb::NmrOneD 109246 Specdb::NmrOneD 109247 Specdb::NmrOneD 109248 Specdb::NmrOneD 109249 Specdb::NmrOneD 109250 Specdb::NmrOneD 109251 Specdb::NmrOneD 109252 Specdb::NmrOneD 109253 Specdb::NmrOneD 109254 Specdb::NmrOneD 109255 Specdb::NmrOneD 109256 Specdb::NmrOneD 109257 Specdb::MsMs 1990 Specdb::MsMs 1991 Specdb::MsMs 1992 Specdb::MsMs 5703 Specdb::MsMs 5704 Specdb::MsMs 5705 Specdb::MsMs 5706 Specdb::MsMs 5707 Specdb::MsMs 179961 Specdb::MsMs 179962 Specdb::MsMs 179963 Specdb::MsMs 182295 Specdb::MsMs 182296 Specdb::MsMs 182297 Specdb::MsMs 438441 Specdb::MsMs 438442 Specdb::MsMs 438443 Specdb::MsMs 438444 Specdb::MsMs 438445 Specdb::MsMs 439763 Specdb::MsMs 449893 Specdb::MsMs 2236616 Specdb::MsMs 2236777 Specdb::MsMs 2244383 Specdb::MsMs 2245011 HMDB02085 #<Reference:0x000055ce323b7968> #<Reference:0x000055ce323b77b0> Amaranth Type 1 specific Amaranthus 3564 Anise Type 1 specific Pimpinella anisum 271192 0.0 0.0 0.0 mg/100 g Annual wild rice Type 1 specific Zizania aquatica 75727 Apple Type 1 specific Malus pumila 283210 0.299583 0.898749977 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 0.0 0.0 0.0 mg/100 g Arrowroot Type 1 specific Maranta arundinacea 210060 Barley Type 1 specific Hordeum vulgare 4513 Beer Type 2 specific 0.102128 0.272 0.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 Black walnut Type 1 specific Juglans nigra 16719 Blackcurrant Type 1 specific Ribes nigrum 78511 Breakfast cereal Type 2 specific Broad bean Type 1 specific Vicia faba 3906 0.0 0.0 0.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.42445 0.4643 0.3846 mg/100 g Bulgur Type 2 specific Cardamom Type 1 specific Elettaria cardamomum 105181 0.0 0.0 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.009 0.018000001 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 1.135 1.13499999 1.13499999 mg/100 g Cereals and cereal products Unknown generic Ceylon cinnamon Type 1 specific Cinnamomum verum 128608 0.78 0.780000031 0.780000031 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 5.2 5.199999809 5.199999809 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 Cloves Type 1 specific Syzygium aromaticum 219868 0.79 0.790000021 0.790000021 mg/100 g Cocoa bean Type 1 specific Theobroma cacao 3641 Cocoa powder Type 2 specific 4.1 4.099999905 4.099999905 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 Coffee Type 1 generic Coffea 13442 0.0 0.0 0.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 0.07875 0.157499999 0.0 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 0.051 0.050999999 0.050999999 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 3.75 3.75 3.75 mg/100 g Common pea Type 1 specific Pisum sativum 3888 1.2 1.200000048 1.200000048 mg/100 g Common sage Type 1 specific Salvia officinalis 38868 1.675 3.349999905 0.0 mg/100 g Common thyme Type 1 specific Thymus vulgaris 49992 8.35 11.699999809 5.0 mg/100 g Common walnut Type 1 specific Juglans regia 51240 451.943 1285.5 33.829000092 mg/100 g Common wheat Type 1 specific Triticum aestivum 4565 0.20575 0.4 0.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 0.0 0.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 0.873139 1.53581662 0.094599999 mg/100 g Cowpea Type 1 specific Vigna unguiculata 3917 0.0 0.0 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.5849 0.7062 0.4636 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 2.139333 2.226000011 2.052666684 mg/100 g Cumin Type 1 specific Cuminum cyminum 52462 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 2.765833 6.056666652 0.62333335 mg/100 g Dill Type 1 specific Anethum graveolens 40922 0.0091 0.014 0.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 0.0224 0.0245 0.0203 mg/100 g Evening primrose Type 1 specific Oenothera biennis 3942 Fennel Type 1 specific Foeniculum vulgare 48038 0.0 0.0 0.0 mg/100 g Fig Type 1 specific Ficus carica 3494 Flour Type 2 specific Garden tomato Type 1 specific Solanum lycopersicum 4081 0.0109 0.0112 0.0106 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 0.0 0.0 0.0 mg/100 g German camomile Type 1 specific Matricaria recutita 127986 0.0 0.0 0.0 mg/100 g Grape wine Type 2 specific 0.250734 0.579999983 0.005428571 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 0.23625 0.2658 0.2067 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.03725 0.0379 0.0366 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 1.328833 1.328833342 1.328833342 mg/100 g Hyssop Type 1 specific Hyssopus officinalis 39324 3.0 3.0 3.0 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 0.19715 0.215 0.1793 mg/100 g Lemon balm Type 1 specific Melissa officinalis 39338 0.0 0.0 0.0 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 0.0 0.0 0.0 mg/100 g Liquor Type 2 specific 3.12 3.119999945 3.119999945 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 Mung bean Type 1 specific Vigna radiata 157791 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.084 0.159999996 0.007999999 mg/100 g Oat Type 1 specific Avena sativa 4498 0.228 0.476999998 0.0 mg/100 g Olive Type 1 specific Olea europaea 4146 11.784972 33.1 0.028222221 mg/100 g Oriental wheat Type 1 specific Triticum turanicum 376534 Parsley Type 1 specific Petroselinum crispum 4043 0.0 0.0 0.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 1.09815 1.1873 1.009 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 5.1 5.1 5.1 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0 0.0 0.0 mg/100 g Pigeon pea Type 1 specific Cajanus cajan 3821 1.8 1.799999952 1.799999952 mg/100 g Pulses Unknown generic Quinoa Type 1 specific Chenopodium quinoa 63459 Rape Type 1 specific Brassica napus var. napus 138011 0.68 0.680000007 0.680000007 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra Red raspberry Type 1 specific Rubus idaeus 32247 0.0 0.0 0.0 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 Rice Type 1 specific Oryza sativa 4530 0.015625 0.0265 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 0.0 0.0 0.0 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 0.1213 0.1381 0.1045 mg/100 g Rosemary Type 1 specific Rosmarinus officinalis 39367 1.516667 2.0 1.033333302 mg/100 g Rum Type 2 specific 0.035 0.035000001 0.035000001 mg/100 g Rye Type 1 specific Secale cereale 4550 1.17 2.339999914 0.0 mg/100 g Rye bread Type 2 specific 0.95 1.899999976 0.0 mg/100 g Sherry Type 2 specific 0.155111 0.15511111 0.15511111 mg/100 g Silver linden Type 1 specific Tilia argentea 0.0 0.0 0.0 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 Soy bean Type 1 specific Glycine max 3847 9.746666 28.799999237 0.0 mg/100 g Spearmint Type 1 specific Mentha spicata 29719 0.0 0.0 0.0 mg/100 g Spelt Type 1 specific Triticum spelta 58933 Spirit Type 2 specific 0.097389 0.09738889 0.09738889 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.0 0.0 0.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 Sweet basil Type 1 specific Ocimum basilicum 39350 0.0 0.0 0.0 mg/100 g Sweet marjoram Type 1 specific Origanum majorana 268884 0.0 0.0 0.0 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 24.75 45.099998474 1.5 mg/100 g Tarragon Type 1 specific Artemisia dracunculus 72341 0.8 0.8 0.8 mg/100 g Tartary buckwheat Type 1 specific Fagopyrum tataricum 62330 Teff Type 1 specific Eragrostis tef 110835 Triticale Type 1 specific X Triticosecale rimpaui Turmeric Type 1 specific Curcuma longa 136217 Turnip Type 1 specific Brassica rapa var. rapa 51350 0.04695 0.0569 0.037 mg/100 g Vinegar Type 2 specific 0.304316 0.304315792 0.304315792 mg/100 g Wheat Type 1 specific Triticum 4564 Whisky Type 2 specific 0.105106 0.105106063 0.105106063 mg/100 g White wine Type 2 2.48 2.48 2.48 mg/100 g Wild carrot Type 1 specific Daucus carota 4039 Wild rice Type 1 specific Zizania 15949 Yellow bell pepper Type 1 specific Capsicum annuum 4072 0.15225 0.1724 0.1321 mg/100 g Yellow wax bean Type 1 specific Phaseolus vulgaris 3885 0.711 0.7219 0.7001 mg/100 g Allelopathic 42 Anti peroxidant 519 Anti radicular 572 Anti-oxidant 502 A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. In European countries, E-numbers for permitted antioxidant food additives are from E 300 to E 324. Ubiquiot 1391