1.0 2010-04-08 22:04:44 UTC 2019-11-26 02:55:31 UTC FDB000848 3,5-Dihydroxybenzoic acid Constituent of Arachis hypogaea (peanuts) and Cicer arietinum (chickpea). 3,5-Dihydroxybenzoic acid is found in many foods, some of which are peanut, pulses, nuts, and beer. &alpha;-Resorcylic acid 3,5-Dihydroxy-benzoic acid 3,5-Dihydroxybenzoate 3,5-Dihydroxybenzoic acid 3,5-Dihydroxybenzoic acid (acd/name 4.0) 5-Carboxyresorcinol a-Resorcylate a-Resorcylic acid a-Resorcylic acid, 8CI alpha-Resorcylate alpha-Resorcylic acid Benzoate Benzoic acid Resorcinol-5-carboxylic acid α-resorcylate α-resorcylic acid C7H6O4 154.121 154.026608673 3,5-dihydroxybenzoic acid 3,5-dihydroxybenzoic acid 99-10-5 OC(=O)C1=CC(O)=CC(O)=C1 InChI=1S/C7H6O4/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,8-9H,(H,10,11) UYEMGAFJOZZIFP-UHFFFAOYSA-N belongs to the class of organic compounds known as hydroxybenzoic acid derivatives. Hydroxybenzoic acid derivatives are compounds containing a hydroxybenzoic acid (or a derivative), which is a benzene ring bearing a carboxyl and a hydroxyl groups. Hydroxybenzoic acid derivatives Organic compounds Benzenoids Benzene and substituted derivatives Benzoic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Benzoic acids Benzoyl derivatives Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organooxygen compounds Resorcinols 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Aromatic homomonocyclic compound Benzoic acid Benzoyl Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Hydroxybenzoic acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Phenol Resorcinol dihydroxybenzoic acid resorcinols Solid logp 1.29 ALOGPS logs -1.11 ALOGPS solubility 1.20e+01 g/l ALOGPS melting_point Mp 232-233° (anhyd.) logp 1.02 ChemAxon pka_strongest_acidic 3.61 ChemAxon pka_strongest_basic -5.7 ChemAxon iupac 3,5-dihydroxybenzoic acid ChemAxon average_mass 154.121 ChemAxon mono_mass 154.026608673 ChemAxon smiles OC(=O)C1=CC(O)=CC(O)=C1 ChemAxon formula C7H6O4 ChemAxon inchi InChI=1S/C7H6O4/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,8-9H,(H,10,11) ChemAxon inchikey UYEMGAFJOZZIFP-UHFFFAOYSA-N ChemAxon polar_surface_area 77.76 ChemAxon refractivity 37.28 ChemAxon polarizability 13.88 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 2922 Specdb::MsIr 2923 Specdb::MsIr 2924 Specdb::CMs 5714 Specdb::CMs 40163 Specdb::CMs 164997 Specdb::NmrOneD 12002 Specdb::NmrOneD 12003 Specdb::NmrOneD 12004 Specdb::NmrOneD 12005 Specdb::NmrOneD 12006 Specdb::NmrOneD 12007 Specdb::NmrOneD 12008 Specdb::NmrOneD 12009 Specdb::NmrOneD 12010 Specdb::NmrOneD 12011 Specdb::NmrOneD 12012 Specdb::NmrOneD 12013 Specdb::NmrOneD 12014 Specdb::NmrOneD 12015 Specdb::NmrOneD 12016 Specdb::NmrOneD 12017 Specdb::NmrOneD 12018 Specdb::NmrOneD 12019 Specdb::NmrOneD 12020 Specdb::NmrOneD 12021 Specdb::MsMs 57897 Specdb::MsMs 57898 Specdb::MsMs 57899 Specdb::MsMs 113706 Specdb::MsMs 113707 Specdb::MsMs 113708 Specdb::MsMs 1448479 Specdb::MsMs 2252720 Specdb::MsMs 2254830 Specdb::MsMs 2255759 Specdb::MsMs 2315690 Specdb::MsMs 2315691 Specdb::MsMs 2315692 Specdb::MsMs 2622533 Specdb::MsMs 2622534 Specdb::MsMs 2622535 HMDB13677 34D #<Reference:0x00005577f74c2498> Beer Type 2 specific 0.243649 0.35 0.030946155 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Nuts Unknown generic Peanut Type 1 specific Arachis hypogaea 3818 Pulses Unknown generic