1.0 2010-04-08 22:04:51 UTC 2025-11-18 22:28:33 UTC FDB001160 Galacturonic acid Galacturonic acid, also known as D-galacturonate or sodium pectate, belongs to the class of organic compounds known as glucuronic acid derivatives. Glucuronic acid derivatives are compounds containing a glucuronic acid moiety (or a derivative), which consists of a glucose moiety with the C6 position oxidized to a carboxylic acid. Galacturonic acid exists in all living species, ranging from bacteria to humans. Galacturonic acid has been found in higher concentrations in flaxseeds. It has also been detected but not quantified in several different foods, such as common grapes, cocoa beans, roselles, milk (cow), and figs. C6H10O7 194.1394 194.042652674 (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid aldehydo-D-galacturonic acid 14982-50-4 O[C@@H](C=O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/t2-,3+,4+,5-/m0/s1 IAJILQKETJEXLJ-RSJOWCBRSA-N belongs to the class of organic compounds known as glucuronic acid derivatives. Glucuronic acid derivatives are compounds containing a glucuronic acid moiety (or a derivative), which consists of a glucose moiety with the C6 carbon oxidized to a carboxylic acid. Glucuronic acid derivatives Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic acyclic compounds Alpha hydroxy acids and derivatives Alpha-hydroxyaldehydes Beta hydroxy acids and derivatives Beta-hydroxy aldehydes Carboxylic acids Hexoses Hydrocarbon derivatives Hydroxy fatty acids Medium-chain fatty acids Medium-chain hydroxy acids and derivatives Monocarboxylic acids and derivatives Organic oxides Polyols Secondary alcohols Alcohol Aldehyde Aliphatic acyclic compound Alpha-hydroxy acid Alpha-hydroxyaldehyde Beta-hydroxy acid Beta-hydroxy aldehyde Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acid Fatty acyl Glucuronic acid or derivatives Hexose monosaccharide Hydrocarbon derivative Hydroxy acid Hydroxy fatty acid Medium-chain fatty acid Medium-chain hydroxy acid Monocarboxylic acid or derivatives Monosaccharide Organic oxide Polyol Secondary alcohol D-galacturonic acid logp -2.32 ALOGPS logs -0.29 ALOGPS solubility 1.00e+02 g/l ALOGPS logp -3.2 ChemAxon pka_strongest_acidic 3.24 ChemAxon pka_strongest_basic -3.7 ChemAxon iupac (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid ChemAxon average_mass 194.1394 ChemAxon mono_mass 194.042652674 ChemAxon smiles O[C@@H](C=O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O ChemAxon formula C6H10O7 ChemAxon inchi InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/t2-,3+,4+,5-/m0/s1 ChemAxon inchikey IAJILQKETJEXLJ-RSJOWCBRSA-N ChemAxon polar_surface_area 135.29 ChemAxon refractivity 37.21 ChemAxon polarizability 16.23 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 7 ChemAxon donor_count 5 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 1800 Specdb::MsIr 1801 Specdb::MsIr 1802 Specdb::CMs 2603 Specdb::CMs 38440 Specdb::CMs 137371 Specdb::CMs 145105 Specdb::NmrTwoD 1831 Specdb::NmrOneD 1895 Specdb::NmrOneD 122678 Specdb::NmrOneD 122679 Specdb::NmrOneD 122680 Specdb::NmrOneD 122681 Specdb::NmrOneD 122682 Specdb::NmrOneD 122683 Specdb::NmrOneD 122684 Specdb::NmrOneD 122685 Specdb::NmrOneD 122686 Specdb::NmrOneD 122687 Specdb::NmrOneD 122688 Specdb::NmrOneD 122689 Specdb::NmrOneD 122690 Specdb::NmrOneD 122691 Specdb::NmrOneD 122692 Specdb::NmrOneD 122693 Specdb::NmrOneD 122694 Specdb::NmrOneD 122695 Specdb::NmrOneD 122696 Specdb::NmrOneD 122697 Specdb::MsMs 2116 Specdb::MsMs 2117 Specdb::MsMs 2118 Specdb::MsMs 178512 Specdb::MsMs 178513 Specdb::MsMs 178514 Specdb::MsMs 180831 Specdb::MsMs 180832 Specdb::MsMs 180833 Specdb::MsMs 440116 Specdb::MsMs 2463831 Specdb::MsMs 2463832 Specdb::MsMs 2463833 Specdb::MsMs 2501960 Specdb::MsMs 2501961 Specdb::MsMs 2501962 HMDB0002545 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Bitter gourd Type 1 specific Momordica charantia 3673 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Cocoa bean Type 1 specific Theobroma cacao 3641 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Common grape Type 1 specific Vitis vinifera 29760 Date Type 1 specific Phoenix dactylifera 42345 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Fig Type 1 specific Ficus carica 3494 Flaxseed Type 1 specific Linum usitatissimum 4006 4377.8 4377.8 4377.8 mg/100 g German camomile Type 1 specific Matricaria recutita 127986 Grape wine Type 2 specific 850.0 850.0 850.0 mg/100 g Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Milk (Cow) Type 2 specific Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Okra Type 1 specific Abelmoschus esculentus 455045 Olive Type 1 specific Olea europaea 4146 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Roselle Type 1 specific Hibiscus sabdariffa 183260 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Sour cherry Type 1 specific Prunus cerasus 140311 Squab Type 1 specific Columba 8931 Sunflower Type 1 specific Helianthus annuus 4232 Sweet orange Type 1 specific Citrus sinensis 2711 Tamarind Type 1 specific Tamarindus indica 58860 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 White mustard Type 1 specific Sinapis alba 3728 Wild boar Type 1 specific Sus scrofa 9823 Wild celery Type 1 specific Apium graveolens 4045