1.0 2010-04-08 22:04:52 UTC 2019-11-26 02:56:05 UTC FDB001193 Maltose Sweetening agent, dietary supplement. Occurs in some plants as hydrolytic dec. production of starch. Production in high yield (80%) by the action of diastase (a- and b-amylase) on starch, a process used in brewing Maltose is a disaccharide formed from two units of glucose joined with an alpha(1->4)bond. Maltose is the disaccharide produced when amylase breaks down starch. It is found in germinating seeds such as barley as they break down their starch stores to use for food. It is also produced when glucose is caramelized. &alpha;-Malt sugar 1-alpha-D-Glucopyranosyl-4-alpha-D-glucopyranose 1-alpha-delta-Glucopyranosyl-4-alpha-delta-glucopyranose 4-(alpha-D-Glucopyranosido)-alpha-glucopyranose 4-(alpha-D-glucosido)-D-Glucose 4-(alpha-delta-Glucopyranosido)-alpha-glucopyranose 4-(alpha-delta-glucosido)-delta-Glucose 4-O-a-D-Glucopyranosyl-a-D-mannopyranose 4-O-a-D-Glucopyranosyl-D-glucose 4-O-a-D-Glucopyranosyl-D-glucose, 9CI 4-O-alpha-D-Glucopyranosyl-alpha-D-mannopyranose 4-O-alpha-D-Glucopyranosyl-D-glucopyranose 4-O-alpha-D-Glucopyranosyl-D-glucose 4-O-alpha-delta-Glucopyranosyl-delta-glucopyranose 4-O-alpha-delta-Glucopyranosyl-delta-glucose 4-O-α-D-glucopyranosyl-α-D-mannopyranose Advantose 100 alpha-D-Glcp-(1->4)-D-glcp alpha-D-Glucopyranosyl-(1->4)-D-glucopyranose alpha-D-Glucopyranosyl-(1->4)-D-glucose alpha-delta-Glcp-(1->4)-delta-glcp alpha-delta-Glucopyranosyl-(1->4)-delta-glucopyranose alpha-delta-Glucopyranosyl-(1->4)-delta-glucose alpha-Malt sugar Cextromaltose D-(+)-Maltose D-Maltose delta-(+)-Maltose delta-Maltose Finetose Finetose F Madoros Malt sugar Maltobiose Maltodiose Maltos Maltose HH Maltose HHH Maltose solution Malzzucker Martos-10 Sunmalt Sunmalt S C12H22O11 342.2965 342.116211546 (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-{[(2R,3S,4R,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxane-3,4,5-triol maltose 69-79-4 OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11?,12-/m1/s1 GUBGYTABKSRVRQ-PICCSMPSSA-N belongs to the class of organic compounds known as o-glycosyl compounds. These are glycoside in which a sugar group is bonded through one carbon to another group via a O-glycosidic bond. O-glycosyl compounds Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic heteromonocyclic compounds Acetals Disaccharides Hemiacetals Hydrocarbon derivatives Oxacyclic compounds Oxanes Polyols Primary alcohols Secondary alcohols Acetal Alcohol Aliphatic heteromonocyclic compound Disaccharide Hemiacetal Hydrocarbon derivative O-glycosyl compound Organoheterocyclic compound Oxacycle Oxane Polyol Primary alcohol Secondary alcohol Disaccharides glycosylglucose maltooligosaccharide Solid logp -3.01 ALOGPS logs 0.23 ALOGPS solubility 5.86e+02 g/l ALOGPS melting_point Mp 102-103° logp -4.7 ChemAxon pka_strongest_acidic 11.25 ChemAxon pka_strongest_basic -3 ChemAxon iupac (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-{[(2R,3S,4R,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxane-3,4,5-triol ChemAxon average_mass 342.2965 ChemAxon mono_mass 342.116211546 ChemAxon smiles OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O ChemAxon formula C12H22O11 ChemAxon inchi InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11?,12-/m1/s1 ChemAxon inchikey GUBGYTABKSRVRQ-PICCSMPSSA-N ChemAxon polar_surface_area 189.53 ChemAxon refractivity 68.34 ChemAxon polarizability 31.57 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 11 ChemAxon donor_count 8 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Starch and Sucrose Metabolism SMP00058 map00500 Specdb::MsMs 179904 Specdb::MsMs 179905 Specdb::MsMs 179906 Specdb::MsMs 182238 Specdb::MsMs 182239 Specdb::MsMs 182240 HMDB00163 17306 1A7L #<Reference:0x000055ce31e97ed8> #<Reference:0x000055ce31e97cd0> #<Reference:0x000055ce31e97b18> #<Reference:0x000055ce31e97910> #<Reference:0x000055ce31e976e0> #<Reference:0x000055ce31e97528> #<Reference:0x000055ce31e97370> #<Reference:0x000055ce31e97168> #<Reference:0x000055ce31e96f60> #<Reference:0x000055ce31e96d30> #<Reference:0x000055ce31e96b78> #<Reference:0x000055ce31e96998> #<Reference:0x000055ce31e96790> #<Reference:0x000055ce31e96588> #<Reference:0x000055ce31e96358> #<Reference:0x000055ce31e961a0> #<Reference:0x000055ce31e95f70> #<Reference:0x000055ce31e95d68> #<Reference:0x000055ce31e95b60> #<Reference:0x000055ce31e95958> #<Reference:0x000055ce31e95778> Abiyuch Type 1 specific Crateva religiosa 202634 100.1 200.0 0.2 mg/100 g Adzuki bean Type 1 specific Vigna angularis 3914 0.0 0.0 0.0 mg/100 g Agave Type 1 specific Agave 39509 0.0 0.0 0.0 mg/100 g Alaska blueberry Type 1 specific Vaccinium alaskaense 190544 0.0 0.0 0.0 mg/100 g Alaska pollock Type 1 specific Theragra chalcogramma 1042646 0.0 0.0 0.0 mg/100 g Alcoholic beverages Unknown generic Alfalfa Type 1 specific Medicago sativa 3879 0.0 0.0 0.0 mg/100 g Allium Type 1 specific Allium 4678 0.0 0.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 80.006364 140.0 0.0 mg/100 g Almond milk Type 1 0.0 0.0 0.0 mg/100 g Amaranth Type 1 specific Amaranthus 3564 5.0 10.0 0.0 mg/100 g American cranberry Type 1 specific Vaccinium macrocarpon 13750 0.0 0.0 0.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 0.0 0.0 0.0 mg/100 g Anatidae Type 1 specific Anatidae 8830 0.0 0.0 0.0 mg/100 g Anchovy Type 1 specific Engraulidae 43062 0.0 0.0 0.0 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 0.0 0.0 0.0 mg/100 g Apple Type 1 specific Malus pumila 283210 183.75 1910.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 10.01 60.0 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 0.0 0.0 0.0 mg/100 g Arepa Type 2 specific 410.0 410.0 410.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 0.0 0.0 0.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.0 0.0 0.0 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 0.0 0.0 0.0 mg/100 g Avocado Type 1 specific Persea americana 3435 0.0 0.0 0.0 mg/100 g Baby food Type 2 specific 151.636364 2860.0 0.0 mg/100 g Baked beans Type 2 specific 63.333333 100.0 0.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.0 0.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 3.351667 10.0 0.0 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 0.0 0.0 0.0 mg/100 g Bean Type 1 specific 63.333333 100.0 0.0 mg/100 g Bearded seal Type 1 specific Erignathus barbatus 39304 0.0 0.0 0.0 mg/100 g Beer Type 2 specific 1.489048 7.615 0.0 mg/100 g Beluga whale Type 1 specific Delphinapterus leucas 9749 0.0 0.0 0.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 0.0 0.0 0.0 mg/100 g Biscuit Type 2 specific 300.0 3200.0 0.0 mg/100 g Bivalvia (Clam, Mussel, Oyster) Type 1 specific Bivalvia 6544 0.0 0.0 0.0 mg/100 g Black raisin Type 1 0.0 0.0 0.0 mg/100 g Black salsify Type 1 specific Scorzonera hispanica 114289 0.0 0.0 0.0 mg/100 g Black tea Type 1 0.0 0.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 0.0 0.0 0.0 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 0.0 0.0 0.0 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 0.0 0.0 0.0 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 0.0 0.0 0.0 mg/100 g Breakfast cereal Type 2 specific 655.128205 10430.0 0.0 mg/100 g Breakfast sandwich Type 2 specific 573.333333 960.0 180.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 30.0 210.0 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 0.0 0.0 0.0 mg/100 g Burbot Type 1 specific Lota lota 69944 0.0 0.0 0.0 mg/100 g Burrito Type 2 specific 665.0 2730.0 150.0 mg/100 g Butter Type 2 specific 0.0 0.0 0.0 mg/100 g Buttermilk Type 2 specific 0.0 0.0 0.0 mg/100 g Butternut squash Type 1 specific Cucurbita moschata 3662 0.0 0.0 0.0 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 0.04 0.04 0.04 mg/100 g Cake Type 2 specific 126.0 230.0 0.0 mg/100 g Cantaloupe melon Type 1 Cucumis melo var. cantalupensis 0.095 0.095 0.095 mg/100 g Carob Type 1 specific Ceratonia siliqua 20340 Carp bream Type 1 specific Abramis brama 38527 0.0 0.0 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.0 0.0 0.0 mg/100 g Casein Type 2 specific 0.0 0.0 0.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 0.0 0.0 0.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 0.0 0.0 0.0 mg/100 g Catfish Type 1 specific Siluriformes 7995 0.0 0.0 0.0 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 7.058824 180.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.0 0.0 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 0.0 0.0 0.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 0.0 0.0 0.0 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 0.0 0.0 0.0 mg/100 g Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.0 0.0 0.0 mg/100 g Channel catfish Type 1 specific Ictalurus punctatus 7998 0.0 0.0 0.0 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 0.0 0.0 0.0 mg/100 g Charr Type 1 specific Salvelinus 8033 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.0 0.0 0.0 mg/100 g Cheddar Cheese Type 2 Cheddar Cheese 0.0 0.0 0.0 mg/100 g Cheese Type 2 specific 15.0 620.0 0.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.0 0.0 0.0 mg/100 g Chervil Type 1 specific Anthriscus cerefolium 40888 0.0 0.0 0.0 mg/100 g Chestnut Type 1 specific Castanea 21019 0.0 0.0 0.0 mg/100 g Chewing gum Type 2 specific 1650.0 2400.0 900.0 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 0.0 0.0 0.0 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 0.0 0.0 0.0 mg/100 g Chili Type 2 specific 0.0 0.0 0.0 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 0.0 0.0 0.0 mg/100 g Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260 0.0 0.0 0.0 mg/100 g Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 0.0 0.0 0.0 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 0.0 0.0 0.0 mg/100 g Chocolate Type 2 specific 225.0 1800.0 0.0 mg/100 g Chocolate spread Type 2 specific 0.0 0.0 0.0 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 0.0 0.0 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.0 0.0 0.0 mg/100 g Clam Type 1 0.0 0.0 0.0 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 0.0 0.0 0.0 mg/100 g Clementine Type 1 Citrus × clementina 0.0 0.0 0.0 mg/100 g Cloves Type 1 specific Syzygium aromaticum 219868 0.0 0.0 0.0 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 0.0 0.0 0.0 mg/100 g Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 0.0 0.0 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.0 0.0 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 0.0 0.0 0.0 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 0.0 0.0 0.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 6.428571 90.0 0.0 mg/100 g Common beet Type 1 specific Beta vulgaris 161934 0.0 0.0 0.0 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 0.0 0.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.909091 10.0 0.0 mg/100 g Common chokecherry Type 1 specific Prunus virginiana 133204 0.0 0.0 0.0 mg/100 g Common dab Type 1 specific Limanda limanda 27771 0.0 0.0 0.0 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 0.0 0.0 0.0 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 0.0 0.0 0.0 mg/100 g Common ling Type 1 specific Molva molva 163112 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 0.0 0.0 0.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.0 0.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 0.0 0.0 0.0 mg/100 g Common pea Type 1 specific Pisum sativum 3888 77.142857 180.0 0.0 mg/100 g Common walnut Type 1 specific Juglans regia 51240 0.0 0.0 0.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 0.0 0.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 71.555556 220.0 0.0 mg/100 g Corn chip Type 2 specific 65.0 70.0 60.0 mg/100 g Corn grits Type 2 specific 0.0 0.0 0.0 mg/100 g Cottage cheese Type 2 0.0 0.0 0.0 mg/100 g Cottonseed Type 1 specific Gossypium 3633 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 0% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 1% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 2% fat Type 2 specific 10.0 10.0 10.0 mg/100 g Cow milk, pasteurized, vitamin D added, 3.25% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Crab Type 1 specific Brachyura 6752 0.0 0.0 0.0 mg/100 g Cracker Type 2 specific 1374.666667 3840.0 0.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 0.0 0.0 0.0 mg/100 g Cream Type 2 specific 0.0 0.0 0.0 mg/100 g Crisp bread Type 2 specific 0.0 0.0 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 27.273636 290.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 0.0 0.0 0.0 mg/100 g Curry powder Type 2 specific 0.0 0.0 0.0 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.0 0.0 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 105.00875 300.0 0.0 mg/100 g Dill Type 1 specific Anethum graveolens 40922 0.0 0.0 0.0 mg/100 g Domestic pig Type 1 specific Sus scrofa domestica 9825 5.822785 170.0 0.0 mg/100 g Dragée Type 2 specific 0.0 0.0 0.0 mg/100 g Dried milk Type 2 specific 0.0 0.0 0.0 mg/100 g Dulce de leche Type 2 specific 0.0 0.0 0.0 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 0.0 0.0 0.0 mg/100 g Egg roll Type 2 specific 1582.5 2150.0 1140.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 0.0 0.0 0.0 mg/100 g Eggs Unknown generic 81.25 1810.0 0.0 mg/100 g Elderberry Type 1 specific Sambucus 4201 0.0 0.0 0.0 mg/100 g Empanada Type 2 specific 1060.0 1060.0 1060.0 mg/100 g Endive Type 1 specific Cichorium endivia 114280 0.0 0.0 0.0 mg/100 g Enokitake Type 1 specific Flammulina velutipes 38945 0.0 0.0 0.0 mg/100 g European plum Type 1 specific Prunus domestica 3758 28.0 80.0 0.0 mg/100 g Feijoa Type 1 specific Feijoa sellowiana 260130 0.0 0.0 0.0 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 0.0 0.0 0.0 mg/100 g Fig Type 1 specific Ficus carica 3494 0.0 0.0 0.0 mg/100 g Fish oil Type 1 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 0.0 0.0 0.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.0 0.0 0.0 mg/100 g Flour Type 2 specific 0.0 0.0 0.0 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 0.0 0.0 0.0 mg/100 g French toast Type 2 specific 820.0 820.0 820.0 mg/100 g Fruit gum Type 2 specific 8900.0 8900.0 8900.0 mg/100 g Fruit juice Type 2 specific 22.0 110.0 0.0 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit-flavor drink Type 2 specific 150.0 460.0 0.0 mg/100 g Frybread Type 2 specific 1490.0 1760.0 1220.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.0 0.0 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 0.0 0.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 0.0 0.0 0.0 mg/100 g Garden onion Type 1 specific Allium cepa 4679 0.0 0.0 0.0 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.0 0.0 0.0 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 0.0 0.0 0.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 28.0 280.0 0.0 mg/100 g Garfish Type 1 specific Belone belone 129037 0.0 0.0 0.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 0.0 0.0 0.0 mg/100 g Gelatin Type 2 specific 0.0 0.0 0.0 mg/100 g Gelatin dessert Type 2 specific 0.0 0.0 0.0 mg/100 g Gin Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 0.0 0.0 0.0 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.0 0.0 0.0 mg/100 g Gram bean Type 1 specific Vigna mungo 3915 Grape Type 1 specific Vitis 3603 0.0 0.0 0.0 mg/100 g Grape wine Type 2 specific 9.090909 100.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.0 0.0 0.0 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 0.0 0.0 0.0 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 18.0 90.0 0.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Green lentil Type 1 Lens culinaris 0.15 0.15 0.15 mg/100 g Green plum Type 1 0.13 0.13 0.13 mg/100 g Green tea Type 1 0.0 0.0 0.0 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.0 0.0 0.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 0.0 0.0 0.0 mg/100 g Groundcherry Type 1 specific Physalis 24663 0.0 0.0 0.0 mg/100 g Guava Type 1 specific Psidium guajava 120290 370.0 740.0 0.0 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 0.0 0.0 0.0 mg/100 g Hamburger Type 2 specific 522.5 950.0 150.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 0.0 0.0 0.0 mg/100 g Herbal tea Type 1 0.0 0.0 0.0 mg/100 g Hibiscus tea Type 1 specific Hibiscus sabbariffa 183260 0.0 0.0 0.0 mg/100 g Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 0.0 0.0 0.0 mg/100 g Honey Type 2 specific 1030.375 2680.0 0.0 mg/100 g Horchata Type 2 specific 0.0 0.0 0.0 mg/100 g Horseradish Type 1 specific Armoracia rusticana 3704 0.0 0.0 0.0 mg/100 g Hot chocolate Type 2 specific 1.428571 10.0 0.0 mg/100 g Hushpuppy Type 2 specific 230.0 230.0 230.0 mg/100 g Ice cream Type 2 specific 282.142857 1640.0 0.0 mg/100 g Iceberg lettuce Type 1 0.01 0.01 0.01 mg/100 g Italian oregano Type 1 specific Origanum X majoricum 1384207 0.0 0.0 0.0 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 0.0 0.0 0.0 mg/100 g Jalapeno pepper Type 1 Capsicum annuum 'Jalapeño' 0.0 0.0 0.0 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 0.0 0.0 0.0 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 0.0 0.0 0.0 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 0.0 0.0 0.0 mg/100 g Kefir Type 2 specific 0.0 0.0 0.0 mg/100 g Ketchup Type 2 specific 865.0 1730.0 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 60.01875 190.0 0.0 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.0 0.0 0.0 mg/100 g Kombu Type 1 specific Saccharina japonica 88149 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 0.0 0.0 0.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.0 0.0 0.0 mg/100 g Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Leavening agent Type 2 specific 0.0 0.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 0.0 0.0 0.0 mg/100 g Lemon Type 1 specific Citrus limon 2708 0.0 0.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 0.0 0.0 0.0 mg/100 g Lentils Type 1 generic Lens culinaris 3864 75.0375 300.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 0.0 0.0 0.0 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 0.0 0.0 0.0 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 0.0 0.0 0.0 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 0.0 0.0 0.0 mg/100 g Liquor Type 2 specific 0.0 0.0 0.0 mg/100 g Liquorice Type 2 specific 1950.0 3100.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 0.0 0.0 0.0 mg/100 g Lumpsucker Type 1 specific Cyclopteridae 8101 0.0 0.0 0.0 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 0.0 0.0 0.0 mg/100 g Macadamia nut (M. tetraphylla) Type 1 specific Macadamia tetraphylla 512563 0.0 0.0 0.0 mg/100 g Macaroni and cheese Type 2 specific 646.25 2390.0 0.0 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.0 0.0 0.0 mg/100 g Malus (Crab apple) Type 1 specific Malus 3749 0.0 0.0 0.0 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 190.2275 380.0 0.455 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.0 0.0 0.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 140.0 560.0 0.0 mg/100 g Margarine Type 2 specific 0.0 0.0 0.0 mg/100 g Margarine-like spread Type 2 specific 0.0 0.0 0.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 0.0 0.0 0.0 mg/100 g Marshmallow Type 2 specific 6700.0 6700.0 6700.0 mg/100 g Marzipan Type 2 specific 0.0 0.0 0.0 mg/100 g Meat bouillon Type 2 specific 0.0 0.0 0.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meatloaf Type 2 specific 103.333333 310.0 0.0 mg/100 g Meringue Type 2 specific 0.0 0.0 0.0 mg/100 g Mexican oregano Type 1 specific Lippia graveolens 0.0 0.0 0.0 mg/100 g Milk (Cow) Type 2 specific 1.25 10.0 0.0 mg/100 g Milk (Human) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Other mammals) Type 2 specific 0.0 0.0 0.0 mg/100 g Milkshake Type 2 specific 740.0 1280.0 0.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 36.666667 110.0 0.0 mg/100 g Miso Type 2 specific 100.0 200.0 0.0 mg/100 g Mixed nuts Type 2 specific 0.0 0.0 0.0 mg/100 g Morchella (Morel) Type 1 specific Morchellaceae 5192 0.0 0.0 0.0 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 0.0 0.0 0.0 mg/100 g Mozzarella cheese Type 2 0.0 0.0 0.0 mg/100 g Multigrain bread Type 2 specific 1745.0 1820.0 1670.0 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 0.0 0.0 0.0 mg/100 g Muscadine grape Type 1 specific Vitis rotundifolia 103349 0.0 0.0 0.0 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 6.666667 40.0 0.0 mg/100 g Mustard Type 2 specific 0.0 0.0 0.0 mg/100 g Nachos Type 2 specific 150.0 150.0 150.0 mg/100 g Nance Type 1 specific Byrsonima crassifolia 4270 0.0 0.0 0.0 mg/100 g Naranjilla Type 1 specific Solanum quitoense 227725 0.0 0.0 0.0 mg/100 g Narrowleaf cattail Type 1 specific Typha angustifolia 59011 0.0 0.0 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.0 0.0 0.0 mg/100 g Northern pike Type 1 specific Esox lucius 8010 0.0 0.0 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 0.0 0.0 0.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.0 0.0 0.0 mg/100 g Nougat Type 2 specific 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.0 0.0 0.0 mg/100 g Nutritional drink Type 2 specific 133.333333 200.0 0.0 mg/100 g Oat Type 1 specific Avena sativa 4498 0.0 0.0 0.0 mg/100 g Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 0.0 0.0 0.0 mg/100 g Olive Type 1 specific Olea europaea 4146 0.0 0.0 0.0 mg/100 g Opium poppy Type 1 specific Papaver somniferum 3469 0.0 0.0 0.0 mg/100 g Oriental wheat Type 1 specific Triticum turanicum 376534 3316.8 6630.0 3.6 mg/100 g Other animal fat Type 2 specific 0.0 0.0 0.0 mg/100 g Other beverage Type 2 specific 40.0 40.0 40.0 mg/100 g Other bread Type 2 specific 605.0 2640.0 0.0 mg/100 g Other bread product Type 2 specific 1222.5 2040.0 0.0 mg/100 g Other candy Type 2 specific 3372.857143 9700.0 0.0 mg/100 g Other dish Type 2 specific 317.727273 4740.0 0.0 mg/100 g Other fermented milk Type 2 specific 0.0 0.0 0.0 mg/100 g Other fish product Type 2 specific 410.0 1230.0 0.0 mg/100 g Other frozen dessert Type 2 specific 458.0 910.0 0.0 mg/100 g Other fruit product Type 2 specific 546.666667 880.0 0.0 mg/100 g Other pasta dish Type 2 specific 115.0 230.0 0.0 mg/100 g Other sandwich Type 2 specific 1110.833333 4810.0 150.0 mg/100 g Other snack food Type 2 specific 1206.25 4810.0 0.0 mg/100 g Other soy product Type 2 specific 1045.0 1140.0 950.0 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.0 0.0 0.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 0.0 0.0 0.0 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 0.0 0.0 0.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.0 0.0 0.0 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 0.0 0.0 0.0 mg/100 g Pacific sardine Type 1 specific Sardinops sagax 28381 0.0 0.0 0.0 mg/100 g Painted comber Type 1 specific Serranus scriba 349661 0.0 0.0 0.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 0.0 0.0 0.0 mg/100 g Pan dulce Type 2 specific 1010.0 1010.0 1010.0 mg/100 g Pancake Type 2 specific 2095.0 5200.0 30.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 0.0 0.0 0.0 mg/100 g Parmesan cheese Type 2 0.0 0.0 0.0 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 0.0 0.0 0.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 0.0 0.0 0.0 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 0.0 0.0 0.0 mg/100 g Pasta Type 2 specific 739.0 1960.0 0.0 mg/100 g Pastry Type 2 specific 508.333333 4330.0 0.0 mg/100 g Pate Type 2 specific 0.0 0.0 0.0 mg/100 g Pea shoots Type 1 0.17 0.17 0.17 mg/100 g Peach Type 1 specific Prunus persica 3760 345.724286 1440.0 0.0 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 0.07 0.07 0.07 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 416.0 1900.0 0.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 0.0 0.0 0.0 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 0.0 0.0 0.0 mg/100 g Perciformes Type 1 specific Perciformes 8111 0.0 0.0 0.0 mg/100 g Persian lime Type 1 specific Citrus latifolia 200541 0.0 0.0 0.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 0.0 0.0 0.0 mg/100 g Pie Type 2 specific 2486.666667 4980.0 950.0 mg/100 g Pie crust Type 2 specific 0.0 0.0 0.0 mg/100 g Pikeperch Type 1 specific Sander lucioperca 283035 0.0 0.0 0.0 mg/100 g Piki bread Type 2 specific 0.0 0.0 0.0 mg/100 g Pine nut Type 1 specific Pinus 3337 0.0 0.0 0.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.0 0.0 0.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 71.708333 170.0 0.0 mg/100 g Pizza Type 2 specific 1064.576271 2430.0 0.0 mg/100 g Plains prickly pear Type 1 specific Opuntia macrorhiza 1041245 0.0 0.0 0.0 mg/100 g Plantain Type 1 Musa × paradisiaca 0.0 0.0 0.0 mg/100 g Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 300.0 900.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.0 0.0 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Popcorn Type 2 specific 0.0 0.0 0.0 mg/100 g Poppy Type 1 specific Papaver 3468 0.0 0.0 0.0 mg/100 g Port wine Type 2 specific 0.0 0.0 0.0 mg/100 g Pot pie Type 2 specific 1745.0 1830.0 1660.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 32.6 520.0 0.0 mg/100 g Potato chip Type 2 specific 153.333333 320.0 70.0 mg/100 g Potato puffs Type 2 specific 0.0 0.0 0.0 mg/100 g Prairie turnip Type 1 specific Pediomelum esculentum 458363 1200.0 3530.0 0.0 mg/100 g Prickly pear Type 1 specific Opuntia 106975 0.0 0.0 0.0 mg/100 g Processed cheese Type 2 specific 338.0 890.0 0.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 0.0 0.0 0.0 mg/100 g Pudding Type 2 specific 0.0 0.0 0.0 mg/100 g Pupusa Type 2 specific 353.333333 390.0 320.0 mg/100 g Quesadilla Type 2 specific 430.0 430.0 430.0 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 0.0 0.0 0.0 mg/100 g Rabbit Type 1 specific Leporidae 9979 0.0 0.0 0.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 0.0 0.0 0.0 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 0.0 0.0 0.0 mg/100 g Rape Type 1 specific Brassica napus var. napus 138011 0.0 0.0 0.0 mg/100 g Rapini Type 1 specific Brassica ruvo 1204434 0.0 0.0 0.0 mg/100 g Ravioli Type 2 specific 145.0 290.0 0.0 mg/100 g Red algae Type 1 specific Rhodophyta 2763 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 0.0 0.0 0.0 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 0.0 0.0 0.0 mg/100 g Red tea Type 1 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Remoulade Type 2 specific 0.0 0.0 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 0.0 0.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 0.0 0.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 0.0 0.0 0.0 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 0.0 0.0 0.0 mg/100 g Rose hip Type 1 specific Rosa 3764 0.0 0.0 0.0 mg/100 g Rowal Type 1 specific Pangium edule 112823 0.0 0.0 0.0 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 70.0 700.0 0.0 mg/100 g Rum Type 2 specific 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 1112.5 3390.0 0.0 mg/100 g Rye bread Type 2 specific 419.466667 2270.0 0.0 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 0.0 0.0 0.0 mg/100 g Salad Type 2 specific 48.75 390.0 0.0 mg/100 g Salad dressing Type 2 specific 149.666667 1380.0 0.0 mg/100 g Salmonberry Type 1 specific Rubus spectabilis 59499 0.0 0.0 0.0 mg/100 g Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 0.0 0.0 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Sauce Type 2 specific 128.461538 450.0 0.0 mg/100 g Sausage Type 2 specific 55.862069 760.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 0.0 0.0 0.0 mg/100 g Scallop Type 1 specific Pectinidae 6566 0.0 0.0 0.0 mg/100 g Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 0.0 0.0 0.0 mg/100 g Scrapple Type 2 specific 0.0 0.0 0.0 mg/100 g Semolina Type 2 specific 0.0 0.0 0.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 0.0 0.0 0.0 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 0.0 0.0 0.0 mg/100 g Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 0.0 0.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 170.0 740.0 0.0 mg/100 g Smelt Type 1 specific Osmeridae 8012 0.0 0.0 0.0 mg/100 g Snack bar Type 2 specific 5383.333333 10040.0 1650.0 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 0.0 0.0 0.0 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 0.0 0.0 0.0 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 0.0 0.0 0.0 mg/100 g Soup Type 2 specific 107.727273 780.0 0.0 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 0.0 0.0 0.0 mg/100 g Soursop Type 1 specific Annona muricata 13337 760.0 760.0 760.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 298.571429 1140.0 0.0 mg/100 g Soy milk Type 2 specific 0.0 0.0 0.0 mg/100 g Soy sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Spelt Type 1 specific Triticum spelta 58933 2575.8075 5150.0 1.615 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 0.0 0.0 0.0 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.0 0.0 0.0 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Spotted seal Type 1 specific Phoca largha 39090 0.0 0.0 0.0 mg/100 g Spread Type 2 specific 1600.0 1600.0 1600.0 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 0.0 0.0 0.0 mg/100 g Stew Type 2 specific 57.142857 210.0 0.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.0 0.0 0.0 mg/100 g Stuffing Type 2 specific 0.0 0.0 0.0 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 0.0 0.0 0.0 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar substitute Type 2 specific 588.0 2940.0 0.0 mg/100 g Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 0.0 0.0 0.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 0.0 0.0 0.0 mg/100 g Swede Type 1 specific Brassica napus 3708 0.01 0.02 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 0.0 0.0 0.0 mg/100 g Sweet cherry Type 1 specific Prunus avium 42229 495.0 870.0 120.0 mg/100 g Sweet custard Type 2 specific 5.0 10.0 0.0 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.0 0.0 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 2358.571429 6710.0 0.0 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.0 0.0 0.0 mg/100 g Swiss cheese Type 2 0.0 0.0 0.0 mg/100 g Syrup Type 2 specific 2703.333333 8110.0 0.0 mg/100 g Taco Type 2 specific 232.5 400.0 0.0 mg/100 g Tallow Type 2 specific 0.0 0.0 0.0 mg/100 g Tamale Type 2 specific 55.0 220.0 0.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 285.0 570.0 0.0 mg/100 g Tarragon Type 1 specific Artemisia dracunculus 72341 274.5 274.5 274.5 mg/100 g Tea Type 1 specific Camellia sinensis 4442 0.0 0.0 0.0 mg/100 g Teff Type 1 specific Eragrostis tef 110835 5.0 10.0 0.0 mg/100 g Thistle Type 1 specific Cirsium 41549 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 0.0 0.0 0.0 mg/100 g Tinda Type 1 specific Citrullus lanatus var. fistulosus 0.0 0.0 0.0 mg/100 g Toffee Type 2 specific 3250.0 6500.0 0.0 mg/100 g Tofu Type 2 specific 0.0 0.0 0.0 mg/100 g Topping Type 2 specific 0.0 0.0 0.0 mg/100 g Tortilla Type 2 specific 2757.5 3630.0 2060.0 mg/100 g Tortilla chip Type 2 specific 0.0 0.0 0.0 mg/100 g True frog Type 1 specific Ranidae 8397 0.0 0.0 0.0 mg/100 g True oyster Type 1 specific Ostreidae 6563 0.0 0.0 0.0 mg/100 g True seal Type 1 specific Phocidae 9709 0.0 0.0 0.0 mg/100 g True sole Type 1 specific Soleidae 30948 0.0 0.0 0.0 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 0.0 0.0 0.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 0.0 0.0 0.0 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 0.0 0.0 0.0 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 0.0 0.0 0.0 mg/100 g Unclassified food or beverage Type 2 specific 470.0 2350.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 34.285714 120.0 0.0 mg/100 g Vegetable juice Type 2 specific 0.0 0.0 0.0 mg/100 g Vegetarian food Type 2 specific 0.0 0.0 0.0 mg/100 g Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Waffle Type 2 specific 260.0 340.0 170.0 mg/100 g Walnut Type 1 specific Juglans 16718 0.0 0.0 0.0 mg/100 g Wasabi Type 1 specific Wasabia japonica 75806 0.0 0.0 0.0 mg/100 g Water Type 2 specific 0.0 0.0 0.0 mg/100 g Water spinach Type 1 Ipomoea aquatica 0.0 0.0 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.0 0.0 0.0 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 20.023333 60.0 0.0 mg/100 g Wheat Type 1 specific Triticum 4564 332.857143 900.0 0.0 mg/100 g Wheat bread Type 2 specific 475.416667 1820.0 0.0 mg/100 g Whey Type 2 specific 0.0 0.0 0.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 1014.421429 2640.0 0.0 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 2.5 10.0 0.0 mg/100 g White mustard Type 1 specific Sinapis alba 3728 0.0 0.0 0.0 mg/100 g Whitefish Type 1 specific Coregonus 27772 0.0 0.0 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.0 0.0 0.0 mg/100 g Wild carrot Type 1 specific Daucus carota 4039 0.0 0.0 0.0 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 0.0 0.0 0.0 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 Yam Type 1 specific Dioscorea 4672 0.0 0.0 0.0 mg/100 g Yellow bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Yellow pond-lily Type 1 specific Nuphar lutea 77113 0.0 0.0 0.0 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.0 0.0 0.0 mg/100 g Ymer Type 2 specific 0.0 0.0 0.0 mg/100 g Yogurt Type 2 specific 5.833333 70.0 0.0 mg/100 g Glycogen debranching enzyme P35573 AGL Lysosomal alpha-glucosidase P10253 GAA Maltase-glucoamylase, intestinal O43451 MGAM Neutral alpha-glucosidase C Q8TET4 GANC Anti-diabetic 228 Any substance introduced into a living organism with therapeutic or diagnostic purpose. Sweetener 1341 Substance that sweeten food, beverages, medications, etc.