1.0 2010-04-08 22:04:54 UTC 2025-11-18 22:29:37 UTC FDB001276 Bis(2-furanylmethyl) disulfide Flavour component of roasted coffee, roasted sesame seeds and cooked meats. Flavouring ingredient. Bis(2-furanylmethyl) disulfide is found in cereals and cereal products, coffee and coffee products, and animal foods. 2-([(2-Furylmethyl)disulfanyl]methyl)furan 2-difurfuryl disulfide 2-Furfuryl disulfide 2,2'-(Dithiobis(methylene))bis-furan 2,2'-(Dithiobis(methylene))bisfuran 2,2'-(Dithiodimethylene)di-furan 2,2'-(Dithiodimethylene)difuran 2,2'-[Dithiobis(methylene)]bis-furan 2,2'-[Dithiobis(methylene)]bisfuran 2,2'-[Dithiobis(methylene)]bisfuran, 9CI Bis-(furylmethyl) disulfide Bis-2-furfuryldisulphide Bis-furfuryl disulfide Bis(2-furfuryl) disulfide Bis(2-furfuryl)disulfide bis(2-furylmethyl) disulphide bis(2-furylmethyl)disulfide di-2-furfuryl disulfide Difurfuryl disulfide Difurfuryldisulfide FEMA 3146 Furan, 2,2'-(dithiobis(methylene))bis- Furan, 2,2'-(dithiodimethylene)di- Furan, 2,2'-[dithiobis(methylene)]bis- Furfuryl disulfide C10H10O2S2 226.315 226.012220944 2-({[(furan-2-yl)methyl]disulfanyl}methyl)furan 2-{[(furan-2-ylmethyl)disulfanyl]methyl}furan 4437-20-1 C(SSCC1=CC=CO1)C1=CC=CO1 InChI=1S/C10H10O2S2/c1-3-9(11-5-1)7-13-14-8-10-4-2-6-12-10/h1-6H,7-8H2 CBJPZHSWLMJQRI-UHFFFAOYSA-N belongs to the class of organic compounds known as heteroaromatic compounds. Heteroaromatic compounds are compounds containing an aromatic ring where a carbon atom is linked to an hetero atom. Heteroaromatic compounds Organic compounds Organoheterocyclic compounds Heteroaromatic compounds Aromatic heteromonocyclic compounds Dialkyldisulfides Furans Hydrocarbon derivatives Organooxygen compounds Oxacyclic compounds Sulfenyl compounds Aromatic heteromonocyclic compound Dialkyldisulfide Furan Heteroaromatic compound Hydrocarbon derivative Organic disulfide Organic oxygen compound Organooxygen compound Organosulfur compound Oxacycle Sulfenyl compound Liquid logp 3.22 ALOGPS logs -3.71 ALOGPS solubility 4.38e-02 g/l ALOGPS melting_point Mp 10-11° logp 2.41 ChemAxon pka_strongest_basic -2.6 ChemAxon iupac 2-({[(furan-2-yl)methyl]disulfanyl}methyl)furan ChemAxon average_mass 226.315 ChemAxon mono_mass 226.012220944 ChemAxon smiles C(SSCC1=CC=CO1)C1=CC=CO1 ChemAxon formula C10H10O2S2 ChemAxon inchi InChI=1S/C10H10O2S2/c1-3-9(11-5-1)7-13-14-8-10-4-2-6-12-10/h1-6H,7-8H2 ChemAxon inchikey CBJPZHSWLMJQRI-UHFFFAOYSA-N ChemAxon polar_surface_area 26.28 ChemAxon refractivity 61.32 ChemAxon polarizability 23.77 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 0 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 12747 Specdb::CMs 171420 Specdb::MsMs 69279 Specdb::MsMs 69280 Specdb::MsMs 69281 Specdb::MsMs 127518 Specdb::MsMs 127519 Specdb::MsMs 127520 Specdb::MsMs 2843427 Specdb::MsMs 2843428 Specdb::MsMs 2843429 Specdb::MsMs 2865843 Specdb::MsMs 2865844 Specdb::MsMs 2865845 HMDB29988 #<Reference:0x000055ce30d05738> Anatidae Type 1 specific Anatidae 8830 Arabica coffee Type 1 specific Coffea arabica 13443 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Breakfast cereal Type 2 specific Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Cereals and cereal products Unknown generic Chicken Type 1 specific Gallus gallus 9031 Coffee and coffee products Unknown generic Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Robusta coffee Type 1 specific Coffea canephora 49390 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 cabbage chicken coffee meaty onion roasted sulfury