1.0 2010-04-08 22:05:20 UTC 2020-02-24 19:10:29 UTC FDB002351 Cardanolmonoene Major constituent of lipids of Anacardium occidentale (cashew nut). Isolated from fruit of Ginkgo biloba (ginkgo). Cardanolmonoene is found in cashew nut, fats and oils, and nuts. 3-(8-Pentadecenyl)-(Z)-phenol 3-(8-Pentadecenyl)phenol Anacardol Cardanol15:1 Cardanolmonoene Ginkgol Phenol, 3-(8-pentadecenyl)-, (Z)- C21H34O 302.4941 302.26096571 3-[(8E)-pentadec-8-en-1-yl]phenol 3-[(8E)-pentadec-8-en-1-yl]phenol 501-26-8 CCCCCC\C=C\CCCCCCCC1=CC(O)=CC=C1 InChI=1S/C21H34O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h7-8,15,17-19,22H,2-6,9-14,16H2,1H3/b8-7+ YLKVIMNNMLKUGJ-BQYQJAHWSA-N belongs to the class of organic compounds known as 1-hydroxy-4-unsubstituted benzenoids. These are phenols that are unsubstituted at the 4-position. 1-hydroxy-4-unsubstituted benzenoids Organic compounds Benzenoids Phenols 1-hydroxy-4-unsubstituted benzenoids Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Benzene and substituted derivatives Hydrocarbon derivatives Organooxygen compounds 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Aromatic homomonocyclic compound Hydrocarbon derivative Monocyclic benzene moiety Organic oxygen compound Organooxygen compound logp 8.76 ALOGPS logs -6.95 ALOGPS solubility 3.38e-05 g/l ALOGPS logp 8.05 ChemAxon pka_strongest_acidic 10.11 ChemAxon pka_strongest_basic -5.5 ChemAxon iupac 3-[(8E)-pentadec-8-en-1-yl]phenol ChemAxon average_mass 302.4941 ChemAxon mono_mass 302.26096571 ChemAxon smiles CCCCCC\C=C\CCCCCCCC1=CC(O)=CC=C1 ChemAxon formula C21H34O ChemAxon inchi InChI=1S/C21H34O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h7-8,15,17-19,22H,2-6,9-14,16H2,1H3/b8-7+ ChemAxon inchikey YLKVIMNNMLKUGJ-BQYQJAHWSA-N ChemAxon polar_surface_area 20.23 ChemAxon refractivity 98.61 ChemAxon polarizability 40.25 ChemAxon rotatable_bond_count 13 ChemAxon acceptor_count 1 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 81252 Specdb::MsMs 81253 Specdb::MsMs 81254 Specdb::MsMs 142314 Specdb::MsMs 142315 Specdb::MsMs 142316 Specdb::MsMs 2756221 Specdb::MsMs 2756222 Specdb::MsMs 2756223 Specdb::MsMs 2953122 Specdb::MsMs 2953123 Specdb::MsMs 2953124 Specdb::CMs 19579 Specdb::CMs 41956 Specdb::CMs 166432 HMDB30482 #<Reference:0x000055ce32db2760> Almond Type 1 specific Prunus dulcis 3755 0.0 0.0 0.0 mg/100 g Almond milk Type 1 0.0 0.0 0.0 mg/100 g Amaranth Type 1 specific Amaranthus 3564 0.0 0.0 0.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 0.0 0.0 0.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 0.0 0.0 0.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.0 0.0 0.0 mg/100 g Avocado Type 1 specific Persea americana 3435 0.0 0.0 0.0 mg/100 g Bison Type 1 specific Bison bison 9901 0.0 0.0 0.0 mg/100 g Black raisin Type 1 0.0 0.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 0.0 0.0 0.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.0 0.0 0.0 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 0.0 0.0 0.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.0 0.0 0.0 mg/100 g Cheddar Cheese Type 2 Cheddar Cheese 0.0 0.0 0.0 mg/100 g Cheese Type 2 specific 0.0 0.0 0.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.0 0.0 0.0 mg/100 g Chicken Type 1 specific Gallus gallus 9031 0.0 0.0 0.0 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 0.0 0.0 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.0 0.0 0.0 mg/100 g Clam Type 1 0.0 0.0 0.0 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 0.0 0.0 0.0 mg/100 g Coconut oil Type 2 0.0 0.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 0.0 0.0 0.0 mg/100 g Cottage cheese Type 2 0.0 0.0 0.0 mg/100 g Cream Type 2 specific 0.0 0.0 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.0 0.0 0.0 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 0.0 0.0 0.0 mg/100 g Elk Type 1 specific Cervus canadensis 1574408 0.01 0.01 0.01 mg/100 g Emu Type 1 specific Dromaius novaehollandiae 8790 0.0 0.0 0.0 mg/100 g Fats and oils Unknown generic Feijoa Type 1 specific Feijoa sellowiana 260130 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 0.0 0.0 0.0 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 0.0 0.0 0.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.005 0.005 0.005 mg/100 g Garden onion Type 1 specific Allium cepa 4679 0.0 0.0 0.0 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.0 0.0 0.0 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 0.0 0.0 0.0 mg/100 g Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 0.0015 0.0015 0.0015 mg/100 g Italian oregano Type 1 specific Origanum X majoricum 1384207 0.0 0.0 0.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 0.0 0.0 0.0 mg/100 g Jalapeno pepper Type 1 Capsicum annuum 'Jalapeño' 0.0 0.0 0.0 mg/100 g Kefir Type 2 specific 0.0 0.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 0.0 0.0 0.0 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.0 0.0 0.0 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 0.0 0.0 0.0 mg/100 g Mexican oregano Type 1 specific Lippia graveolens 0.0 0.0 0.0 mg/100 g Morchella (Morel) Type 1 specific Morchellaceae 5192 0.0 0.0 0.0 mg/100 g Mozzarella cheese Type 2 0.0 0.0 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Nuts Unknown generic Olive Type 1 specific Olea europaea 4146 0.0 0.0 0.0 mg/100 g Orange roughy Type 1 specific Hoplostethus atlanticus 96778 0.0 0.0 0.0 mg/100 g Oriental wheat Type 1 specific Triticum turanicum 376534 0.0 0.0 0.0 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 0.0 0.0 0.0 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.0 0.0 0.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 0.005 0.005 0.005 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 0.0015 0.0015 0.0015 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.0025 0.0025 0.0025 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 0.0015 0.0015 0.0015 mg/100 g Parmesan cheese Type 2 0.0 0.0 0.0 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 0.0 0.0 0.0 mg/100 g Pine nut Type 1 specific Pinus 3337 0.0 0.0 0.0 mg/100 g Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 0.0025 0.0025 0.0025 mg/100 g Plantain Type 1 Musa × paradisiaca 0.0 0.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.0015 0.0015 0.0015 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 0.0 0.0 0.0 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 0.0 0.0 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 0.0 0.0 0.0 mg/100 g Rye bread Type 2 specific 0.0 0.0 0.0 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 0.0 0.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 0.0 0.0 0.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 0.0 0.0 0.0 mg/100 g Soybean oil Type 2 0.0 0.0 0.0 mg/100 g Spelt Type 1 specific Triticum spelta 58933 0.0 0.0 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.0 0.0 0.0 mg/100 g Swiss cheese Type 2 0.0 0.0 0.0 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 0.001 0.001 0.001 mg/100 g Teff Type 1 specific Eragrostis tef 110835 0.0 0.0 0.0 mg/100 g True sole Type 1 specific Soleidae 30948 0.0 0.0 0.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 0.0 0.0 0.0 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 0.0 0.0 0.0 mg/100 g Walnut Type 1 specific Juglans 16718 0.0 0.0 0.0 mg/100 g Wasabi Type 1 specific Wasabia japonica 75806 0.0 0.0 0.0 mg/100 g White bread Type 1 0.0 0.0 0.0 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.0 0.0 0.0 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 0.0015 0.0015 0.0015 mg/100 g Antitumor 672 A substance that inhibits or prevents the proliferation of neoplasms.