1.0 2010-04-08 22:05:28 UTC 2019-11-26 02:57:47 UTC FDB002667 trans-p-Methoxycinnamic acid Esters of p-methoxycinnamic acid are among the popular UV-B screening compounds used in various cosmetic formulations in sunscreen products. trans-p-Methoxycinnamic acid is found in wild celery and turmeric. (2E)-3-(4-Methoxyphenyl)-2-propenoic acid (2E)-3-(4-methoxyphenyl)prop-2-enoic acid (E)-3-(4-Methoxy-phenyl)-acrylic acid (E)-3-(4-Methoxyphenyl)acrylate (E)-3-(4-Methoxyphenyl)acrylic acid (E)-p-Methoxycinnamic acid 3-(4-Methoxy-phenyl)-acrylate 3-(4-Methoxy-phenyl)-acrylic acid 3-(4-Methoxyphenyl)-2-propenoate 3-(4-Methoxyphenyl)-2-propenoic acid 3-(4-Methoxyphenyl)-2-propenoic acid, 9CI 3-(4-Methoxyphenyl)acrylate 3-(4-methoxyphenyl)acrylic acid 3-(4-methoxyphenyl)prop-2-enoic acid 4-Methoxy cinnamate 4-Methoxy cinnamic acid 4-Methoxycinnamate 4-Methoxycinnamic acid O-Methyl-p-coumarate O-Methyl-p-coumaric acid p-Hydroxy methyl cinnamate P-Methoxy ciannamate P-Methoxy ciannamic acid p-Methoxycinnamate p-Methoxycinnamic acid para-Methoxycinnamate para-Methoxycinnamic acid trans-2-Propenoic acid, 3-(4-methoxyphenyl)- trans-3-(4-Methoxyphenyl)acrylic acid trans-4-Methoxycinnamate trans-4-Methoxycinnamic acid trans-p-Methoxycinnamic acid C10H10O3 178.1846 178.062994186 (2E)-3-(4-methoxyphenyl)prop-2-enoic acid p-methoxy-cinnamic acid 830-09-1 COC1=CC=C(\C=C\C(O)=O)C=C1 InChI=1S/C10H10O3/c1-13-9-5-2-8(3-6-9)4-7-10(11)12/h2-7H,1H3,(H,11,12)/b7-4+ AFDXODALSZRGIH-QPJJXVBHSA-N belongs to the class of organic compounds known as cinnamic acids. These are organic aromatic compounds containing a benzene and a carboxylic acid group forming 3-phenylprop-2-enoic acid. Cinnamic acids Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Cinnamic acids Aromatic homomonocyclic compounds Alkyl aryl ethers Anisoles Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Methoxybenzenes Monocarboxylic acids and derivatives Organic oxides Phenoxy compounds Styrenes Alkyl aryl ether Anisole Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Cinnamic acid Ether Hydrocarbon derivative Methoxybenzene Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol ether Phenoxy compound Styrene Solid logp 2.37 ALOGPS logs -2.51 ALOGPS solubility 5.49e-01 g/l ALOGPS melting_point Mp 188-189.5° (174°) logp 1.98 ChemAxon pka_strongest_acidic 4.11 ChemAxon pka_strongest_basic -4.8 ChemAxon iupac (2E)-3-(4-methoxyphenyl)prop-2-enoic acid ChemAxon average_mass 178.1846 ChemAxon mono_mass 178.062994186 ChemAxon smiles COC1=CC=C(\C=C\C(O)=O)C=C1 ChemAxon formula C10H10O3 ChemAxon inchi InChI=1S/C10H10O3/c1-13-9-5-2-8(3-6-9)4-7-10(11)12/h2-7H,1H3,(H,11,12)/b7-4+ ChemAxon inchikey AFDXODALSZRGIH-QPJJXVBHSA-N ChemAxon polar_surface_area 46.53 ChemAxon refractivity 49.52 ChemAxon polarizability 18.34 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 1839 Specdb::NmrTwoD 1779 Specdb::MsIr 1562 Specdb::MsIr 1563 Specdb::MsIr 1564 Specdb::CMs 1515 Specdb::CMs 21193 Specdb::CMs 26862 Specdb::CMs 27993 Specdb::CMs 29679 Specdb::CMs 31385 Specdb::CMs 38238 Specdb::CMs 159270 Specdb::MsMs 1962 Specdb::MsMs 1963 Specdb::MsMs 1964 Specdb::MsMs 5681 Specdb::MsMs 5682 Specdb::MsMs 5683 Specdb::MsMs 5684 Specdb::MsMs 5685 Specdb::MsMs 5686 Specdb::MsMs 5687 Specdb::MsMs 313174 Specdb::MsMs 313175 Specdb::MsMs 313176 Specdb::MsMs 358612 Specdb::MsMs 358613 Specdb::MsMs 358614 Specdb::MsMs 374578 Specdb::MsMs 438997 Specdb::MsMs 438998 Specdb::MsMs 447894 Specdb::MsMs 447895 Specdb::MsMs 447896 Specdb::MsMs 451197 Specdb::MsMs 452304 Specdb::MsMs 2249206 HMDB02040 48541 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Milk (Cow) Type 2 specific Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Turmeric Type 1 specific Curcuma longa 136217 36.0 36.0 36.0 mg/100 g Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Wild celery Type 1 specific Apium graveolens 4045 Anti pyretic 567 A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. Fungicide 940 A substance used to destroy fungal pests. Hemolytic 973 Hypoglycemic 1017 A drug which lowers the blood glucose level. Pesticide 1210 Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests.