1.0 2010-04-08 22:05:53 UTC 2025-11-18 22:53:15 UTC FDB003617 gamma-L-Glutamyl-L-leucine Gamma-glutamylleucine, also known as gamma-glutamyl-leucine, (d,l)-isomer or L-gamma-glu-L-leu, is a member of the class of compounds known as dipeptides. Dipeptides are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. Gamma-glutamylleucine is slightly soluble (in water) and a moderately acidic compound (based on its pKa). Gamma-glutamylleucine can be found in soft-necked garlic, which makes gamma-glutamylleucine a potential biomarker for the consumption of this food product. Gamma-glutamylleucine can be found primarily in blood and feces. C11H20N2O5 260.2869 260.13722176 (2S)-2-[(4S)-4-amino-4-carboxybutanamido]-4-methylpentanoic acid (2S)-2-[(4S)-4-amino-4-carboxybutanamido]-4-methylpentanoic acid 2566-39-4 CC(C)C[C@H](NC(=O)CC[C@H](N)C(O)=O)C(O)=O InChI=1S/C11H20N2O5/c1-6(2)5-8(11(17)18)13-9(14)4-3-7(12)10(15)16/h6-8H,3-5,12H2,1-2H3,(H,13,14)(H,15,16)(H,17,18)/t7-,8-/m0/s1 MYFMARDICOWMQP-YUMQZZPRSA-N belongs to the class of organic compounds known as dipeptides. These are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. Dipeptides Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Amino acids Carbonyl compounds Carboxylic acids Dicarboxylic acids and derivatives Gamma-glutamyl amino acids Glutamine and derivatives Hydrocarbon derivatives L-alpha-amino acids Leucine and derivatives Methyl-branched fatty acids Monoalkylamines N-acyl amines N-acyl-L-alpha-amino acids Organic oxides Organopnictogen compounds Secondary carboxylic acid amides Aliphatic acyclic compound Alpha-amino acid Alpha-amino acid or derivatives Alpha-dipeptide Amine Amino acid Amino acid or derivatives Branched fatty acid Carbonyl group Carboxamide group Carboxylic acid Dicarboxylic acid or derivatives Fatty acid Fatty acyl Fatty amide Gamma-glutamyl alpha-amino acid Glutamine or derivatives Hydrocarbon derivative L-alpha-amino acid Leucine or derivatives Methyl-branched fatty acid N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-amine N-acyl-l-alpha-amino acid Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Secondary carboxylic acid amide glutamyl-L-amino acid logp -2.60 ALOGPS logs -1.76 ALOGPS solubility 4.48e+00 g/l ALOGPS logp -2.5 ChemAxon pka_strongest_acidic 1.78 ChemAxon pka_strongest_basic 9.31 ChemAxon iupac (2S)-2-[(4S)-4-amino-4-carboxybutanamido]-4-methylpentanoic acid ChemAxon average_mass 260.2869 ChemAxon mono_mass 260.13722176 ChemAxon smiles CC(C)C[C@H](NC(=O)CC[C@H](N)C(O)=O)C(O)=O ChemAxon formula C11H20N2O5 ChemAxon inchi InChI=1S/C11H20N2O5/c1-6(2)5-8(11(17)18)13-9(14)4-3-7(12)10(15)16/h6-8H,3-5,12H2,1-2H3,(H,13,14)(H,15,16)(H,17,18)/t7-,8-/m0/s1 ChemAxon inchikey MYFMARDICOWMQP-YUMQZZPRSA-N ChemAxon polar_surface_area 129.72 ChemAxon refractivity 62.26 ChemAxon polarizability 26.29 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 6 ChemAxon donor_count 4 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 135448 Specdb::CMs 143182 Specdb::NmrOneD 93092 Specdb::NmrOneD 93093 Specdb::NmrOneD 93094 Specdb::NmrOneD 93095 Specdb::NmrOneD 93096 Specdb::NmrOneD 93097 Specdb::NmrOneD 93098 Specdb::NmrOneD 93099 Specdb::NmrOneD 93100 Specdb::NmrOneD 93101 Specdb::NmrOneD 93102 Specdb::NmrOneD 93103 Specdb::NmrOneD 93104 Specdb::NmrOneD 93105 Specdb::NmrOneD 93106 Specdb::NmrOneD 93107 Specdb::NmrOneD 93108 Specdb::NmrOneD 93109 Specdb::NmrOneD 93110 Specdb::NmrOneD 93111 Specdb::MsMs 53472 Specdb::MsMs 53473 Specdb::MsMs 53474 Specdb::MsMs 117003 Specdb::MsMs 117004 Specdb::MsMs 117005 Specdb::MsMs 2254380 Specdb::MsMs 2256167 Specdb::MsMs 2336566 Specdb::MsMs 2336567 Specdb::MsMs 2336568 Specdb::MsMs 2629955 Specdb::MsMs 2629956 Specdb::MsMs 2629957 Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682