1.0 2010-04-08 22:06:08 UTC 2025-11-18 22:55:31 UTC FDB004209 Caffeic acid ester Caffeic acid ester, also known as caffeic acid phenethyl ester or cape, belongs to coumaric acids and derivatives class of compounds. Those are aromatic compounds containing Aromatic compounds containing a cinnamic acid moiety (or a derivative thereof) hydroxylated at the C2 (ortho-), C3 (meta-), or C4 (para-) carbon atom of the benzene ring. Caffeic acid ester is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Caffeic acid ester can be found in corn, flaxseed, oat, and peach, which makes caffeic acid ester a potential biomarker for the consumption of these food products. C17H16O4 284.3065 284.104859 2-phenylethyl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate caffeic acid phenethyl ester [H]\C(=C(\[H])C1=CC(O)=C(O)C=C1)C(=O)OCCC1=CC=CC=C1 InChI=1S/C17H16O4/c18-15-8-6-14(12-16(15)19)7-9-17(20)21-11-10-13-4-2-1-3-5-13/h1-9,12,18-19H,10-11H2/b9-7+ SWUARLUWKZWEBQ-VQHVLOKHSA-N belongs to the class of organic compounds known as coumaric acids and derivatives. These are aromatic compounds containing Aromatic compounds containing a cinnamic acid moiety (or a derivative thereof) hydroxylated at the C2 (ortho-), C3 (meta-), or C4 (para-) carbon atom of the benzene ring. Coumaric acids and derivatives Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Carbonyl compounds Catechols Cinnamic acid esters Enoate esters Fatty acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Styrenes 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Alpha,beta-unsaturated carboxylic ester Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid derivative Carboxylic acid ester Catechol Cinnamic acid ester Coumaric acid or derivatives Enoate ester Fatty acid ester Fatty acyl Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol Styrene alkyl caffeate ester logp 3.65 ALOGPS logs -3.66 ALOGPS solubility 6.29e-02 g/l ALOGPS logp 3.92 ChemAxon pka_strongest_acidic 9.21 ChemAxon pka_strongest_basic -6.3 ChemAxon iupac 2-phenylethyl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate ChemAxon average_mass 284.3065 ChemAxon mono_mass 284.104859 ChemAxon smiles [H]\C(=C(\[H])C1=CC(O)=C(O)C=C1)C(=O)OCCC1=CC=CC=C1 ChemAxon formula C17H16O4 ChemAxon inchi InChI=1S/C17H16O4/c18-15-8-6-14(12-16(15)19)7-9-17(20)21-11-10-13-4-2-1-3-5-13/h1-9,12,18-19H,10-11H2/b9-7+ ChemAxon inchikey SWUARLUWKZWEBQ-VQHVLOKHSA-N ChemAxon polar_surface_area 66.76 ChemAxon refractivity 81.16 ChemAxon polarizability 30.74 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 5759 Specdb::MsMs 47586 Specdb::MsMs 47587 Specdb::MsMs 47588 Specdb::MsMs 155736 Specdb::MsMs 155737 Specdb::MsMs 155738 Specdb::MsMs 3600134 Specdb::MsMs 3600135 Specdb::MsMs 3600136 Specdb::MsMs 3600137 Specdb::MsMs 3600138 Specdb::MsMs 3600139 Corn Type 1 specific Zea mays 4577 Flaxseed Type 1 specific Linum usitatissimum 4006 Oat Type 1 specific Avena sativa 4498 Peach Type 1 specific Prunus persica 3760