1.0 2010-04-08 22:06:57 UTC 2025-11-18 23:00:43 UTC FDB006016 Methylgeraniate Methyl geranate, also known as methyl geranic acid or methyl (2e)-3,7-dimethylocta-2,6-dienoate, is a member of the class of compounds known as acyclic monoterpenoids. Acyclic monoterpenoids are monoterpenes that do not contain a cycle. Methyl geranate is practically insoluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). Methyl geranate can be found in caraway, which makes methyl geranate a potential biomarker for the consumption of this food product. Methyl geranate exists in all eukaryotes, ranging from yeast to humans. Methyl (2E)-3,7-dimethyl-2,6-octadienoate Methyl geranate Methyl geraniate C11H18O2 182.263 182.13067982 methyl (2E)-3,7-dimethylocta-2,6-dienoate methyl (2E)-3,7-dimethylocta-2,6-dienoate COC(=O)\C=C(/C)CCC=C(C)C InChI=1S/C11H18O2/c1-9(2)6-5-7-10(3)8-11(12)13-4/h6,8H,5,7H2,1-4H3/b10-8+ ACOBBFVLNKYODD-CSKARUKUSA-N belongs to the class of organic compounds known as acyclic monoterpenoids. These are monoterpenes that do not contain a cycle. Acyclic monoterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Monoterpenoids Aliphatic acyclic compounds Carbonyl compounds Enoate esters Fatty acid esters Hydrocarbon derivatives Methyl esters Monocarboxylic acids and derivatives Organic oxides Acyclic monoterpenoid Aliphatic acyclic compound Alpha,beta-unsaturated carboxylic ester Carbonyl group Carboxylic acid derivative Carboxylic acid ester Enoate ester Fatty acid ester Fatty acyl Hydrocarbon derivative Methyl ester Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound logp 3.67 ALOGPS logs -2.69 ALOGPS solubility 3.76e-01 g/l ALOGPS logp 3.2 ChemAxon pka_strongest_basic -6.8 ChemAxon iupac methyl (2E)-3,7-dimethylocta-2,6-dienoate ChemAxon average_mass 182.263 ChemAxon mono_mass 182.13067982 ChemAxon smiles COC(=O)\C=C(/C)CCC=C(C)C ChemAxon formula C11H18O2 ChemAxon inchi InChI=1S/C11H18O2/c1-9(2)6-5-7-10(3)8-11(12)13-4/h6,8H,5,7H2,1-4H3/b10-8+ ChemAxon inchikey ACOBBFVLNKYODD-CSKARUKUSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 55.82 ChemAxon polarizability 21.68 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 9695 Specdb::MsIr 9696 Specdb::CMs 2343 Specdb::CMs 156275 Specdb::MsMs 107583 Specdb::MsMs 107584 Specdb::MsMs 107585 Specdb::MsMs 174588 Specdb::MsMs 174589 Specdb::MsMs 174590 Specdb::MsMs 2328417 Specdb::MsMs 2328418 Specdb::MsMs 2328419 Specdb::MsMs 2633831 Specdb::MsMs 2633832 Specdb::MsMs 2633833 HMDB0059816 Cucumber Type 1 specific Cucumis sativus 3659 Grape Type 1 specific Vitis 3603 Lemon balm Type 1 specific Melissa officinalis 39338 1.8 1.8 1.8 mg/100 g