1.0 2010-04-08 22:07:38 UTC 2025-11-18 23:04:57 UTC FDB007506 Imidazoleacrylic acid Trans-urocanic acid, also known as 4-imidazoleacrylic acid or urocanate, belongs to imidazolyl carboxylic acids and derivatives class of compounds. Those are organic compounds containing a carboxylic acid chain (of at least 2 carbon atoms) linked to an imidazole ring. Trans-urocanic acid is soluble (in water) and a weakly acidic compound (based on its pKa). Trans-urocanic acid can be found in mung bean, which makes trans-urocanic acid a potential biomarker for the consumption of this food product. Trans-urocanic acid can be found primarily in most biofluids, including sweat, feces, blood, and urine, as well as in human liver and skin tissues. Trans-urocanic acid exists in all living organisms, ranging from bacteria to humans. In humans, trans-urocanic acid is involved in the histidine metabolism. Trans-urocanic acid is also involved in a couple of metabolic disorders, which include ammonia recycling and histidinemia. C6H6N2O2 138.124 138.042927446 (2E)-3-(1H-imidazol-4-yl)prop-2-enoic acid trans-urocanic acid 3465-72-3 OC(=O)\C=C\C1=CNC=N1 InChI=1S/C6H6N2O2/c9-6(10)2-1-5-3-7-4-8-5/h1-4H,(H,7,8)(H,9,10)/b2-1+ LOIYMIARKYCTBW-OWOJBTEDSA-N belongs to the class of organic compounds known as imidazolyl carboxylic acids and derivatives. These are organic compounds containing a carboxylic acid chain (of at least 2 carbon atoms) linked to an imidazole ring. Imidazolyl carboxylic acids and derivatives Organic compounds Organoheterocyclic compounds Azoles Imidazoles Aromatic heteromonocyclic compounds Azacyclic compounds Carbonyl compounds Carboxylic acids Heteroaromatic compounds Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Aromatic heteromonocyclic compound Azacycle Carbonyl group Carboxylic acid Carboxylic acid derivative Heteroaromatic compound Hydrocarbon derivative Imidazolyl carboxylic acid derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound urocanic acid logp 0.22 ALOGPS logs -0.51 ALOGPS solubility 4.25e+01 g/l ALOGPS logp -1 ChemAxon pka_strongest_acidic 3.85 ChemAxon pka_strongest_basic 6.13 ChemAxon iupac (2E)-3-(1H-imidazol-4-yl)prop-2-enoic acid ChemAxon average_mass 138.124 ChemAxon mono_mass 138.042927446 ChemAxon smiles OC(=O)\C=C\C1=CNC=N1 ChemAxon formula C6H6N2O2 ChemAxon inchi InChI=1S/C6H6N2O2/c9-6(10)2-1-5-3-7-4-8-5/h1-4H,(H,7,8)(H,9,10)/b2-1+ ChemAxon inchikey LOIYMIARKYCTBW-OWOJBTEDSA-N ChemAxon polar_surface_area 65.98 ChemAxon refractivity 35.57 ChemAxon polarizability 13.1 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrTwoD 1264 Specdb::MsIr 51 Specdb::MsIr 393 Specdb::MsIr 394 Specdb::MsIr 395 Specdb::NmrOneD 1322 Specdb::NmrOneD 6522 Specdb::NmrOneD 6523 Specdb::NmrOneD 6524 Specdb::NmrOneD 6525 Specdb::NmrOneD 6526 Specdb::NmrOneD 6527 Specdb::NmrOneD 6528 Specdb::NmrOneD 6529 Specdb::NmrOneD 6530 Specdb::NmrOneD 6531 Specdb::NmrOneD 6532 Specdb::NmrOneD 6533 Specdb::NmrOneD 6534 Specdb::NmrOneD 6535 Specdb::NmrOneD 6536 Specdb::NmrOneD 6537 Specdb::NmrOneD 6538 Specdb::NmrOneD 6539 Specdb::NmrOneD 6540 Specdb::NmrOneD 6541 Specdb::CMs 531 Specdb::CMs 532 Specdb::CMs 533 Specdb::CMs 1728 Specdb::CMs 8610 Specdb::CMs 29558 Specdb::CMs 30237 Specdb::CMs 30711 Specdb::CMs 30921 Specdb::CMs 31121 Specdb::CMs 32123 Specdb::CMs 32124 Specdb::CMs 37411 Specdb::CMs 151786 Specdb::CMs 1057495 Specdb::CMs 1057497 Specdb::CMs 1057498 Specdb::MsMs 513 Specdb::MsMs 514 Specdb::MsMs 515 Specdb::MsMs 3975 Specdb::MsMs 3976 Specdb::MsMs 3977 Specdb::MsMs 3978 Specdb::MsMs 3979 Specdb::MsMs 3980 Specdb::MsMs 3984 Specdb::MsMs 3985 Specdb::MsMs 260679 Specdb::MsMs 260680 Specdb::MsMs 260681 Specdb::MsMs 280614 Specdb::MsMs 280615 Specdb::MsMs 280616 Specdb::MsMs 438573 Specdb::MsMs 438574 Specdb::MsMs 438575 Specdb::MsMs 438576 Specdb::MsMs 438577 Specdb::MsMs 439163 Specdb::MsMs 448111 Specdb::MsMs 2226226 HMDB0000301 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Mung bean Type 1 specific Vigna radiata 157791 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823