1.0 2010-04-08 22:08:21 UTC 2025-11-18 23:14:50 UTC FDB008969 Anisic acid P-anisic acid, also known as 4-methoxybenzoic acid or anisate, belongs to P-methoxybenzoic acids and derivatives class of compounds. Those are benzoic acids in which the hydrogen atom at position 4 of the benzene ring is replaced by a methoxy group. P-anisic acid is slightly soluble (in water) and a weakly acidic compound (based on its pKa). P-anisic acid can be synthesized from benzoic acid. P-anisic acid can also be synthesized into methyl p-anisate. P-anisic acid is a faint, sweet, and cadaverous tasting compound found in anise, cocoa bean, fennel, and german camomile, which makes P-anisic acid a potential biomarker for the consumption of these food products. P-anisic acid can be found primarily in feces. P-anisic acid exists in all eukaryotes, ranging from yeast to humans. C8H8O3 152.1473 152.047344122 4-methoxybenzoic acid P-anisic acid 1335-08-6 COC1=CC=C(C=C1)C(O)=O InChI=1S/C8H8O3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10) ZEYHEAKUIGZSGI-UHFFFAOYSA-N belongs to the class of organic compounds known as p-methoxybenzoic acids and derivatives. These are benzoic acids in which the hydrogen atom at position 4 of the benzene ring is replaced by a methoxy group. P-methoxybenzoic acids and derivatives Organic compounds Benzenoids Benzene and substituted derivatives Benzoic acids and derivatives Aromatic homomonocyclic compounds Alkyl aryl ethers Anisoles Benzoic acids Benzoyl derivatives Carboxylic acids Hydrocarbon derivatives Methoxybenzenes Monocarboxylic acids and derivatives Organic oxides Phenoxy compounds Alkyl aryl ether Anisole Aromatic homomonocyclic compound Benzoic acid Benzoyl Carboxylic acid Carboxylic acid derivative Ether Hydrocarbon derivative Methoxybenzene Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound P-methoxybenzoic acid or derivatives Phenol ether Phenoxy compound methoxybenzoic acid logp 1.63 ALOGPS logs -1.88 ALOGPS solubility 2.00e+00 g/l ALOGPS melting_point 185 oC logp 1.47 ChemAxon pka_strongest_acidic 4.37 ChemAxon pka_strongest_basic -4.8 ChemAxon iupac 4-methoxybenzoic acid ChemAxon average_mass 152.1473 ChemAxon mono_mass 152.047344122 ChemAxon smiles COC1=CC=C(C=C1)C(O)=O ChemAxon formula C8H8O3 ChemAxon inchi InChI=1S/C8H8O3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10) ChemAxon inchikey ZEYHEAKUIGZSGI-UHFFFAOYSA-N ChemAxon polar_surface_area 46.53 ChemAxon refractivity 39.78 ChemAxon polarizability 14.99 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrTwoD 1584 Specdb::NmrOneD 1643 Specdb::NmrOneD 8602 Specdb::NmrOneD 8603 Specdb::NmrOneD 8604 Specdb::NmrOneD 8605 Specdb::NmrOneD 8606 Specdb::NmrOneD 8607 Specdb::NmrOneD 8608 Specdb::NmrOneD 8609 Specdb::NmrOneD 8610 Specdb::NmrOneD 8611 Specdb::NmrOneD 8612 Specdb::NmrOneD 8613 Specdb::NmrOneD 8614 Specdb::NmrOneD 8615 Specdb::NmrOneD 8616 Specdb::NmrOneD 8617 Specdb::NmrOneD 8618 Specdb::NmrOneD 8619 Specdb::NmrOneD 8620 Specdb::NmrOneD 8621 Specdb::MsIr 1071 Specdb::MsIr 1072 Specdb::MsIr 1073 Specdb::CMs 2671 Specdb::CMs 29593 Specdb::CMs 29833 Specdb::CMs 32307 Specdb::CMs 37926 Specdb::CMs 99649 Specdb::CMs 99650 Specdb::CMs 99651 Specdb::CMs 158968 Specdb::MsMs 1421 Specdb::MsMs 1422 Specdb::MsMs 1423 Specdb::MsMs 5041 Specdb::MsMs 5042 Specdb::MsMs 5043 Specdb::MsMs 5044 Specdb::MsMs 5045 Specdb::MsMs 5046 Specdb::MsMs 178647 Specdb::MsMs 178648 Specdb::MsMs 178649 Specdb::MsMs 180966 Specdb::MsMs 180967 Specdb::MsMs 180968 Specdb::MsMs 437279 Specdb::MsMs 437280 Specdb::MsMs 437281 Specdb::MsMs 437282 Specdb::MsMs 437283 Specdb::MsMs 2238352 Specdb::MsMs 2239211 Specdb::MsMs 2763325 Specdb::MsMs 2763326 Specdb::MsMs 2763327 HMDB0001101 Anatidae Type 1 specific Anatidae 8830 Anise Type 1 specific Pimpinella anisum 271192 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Fennel Type 1 specific Foeniculum vulgare 48038 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Tarragon Type 1 specific Artemisia dracunculus 72341 4.4 4.4 4.4 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Anti bacterial 145 A substance that kills or slows the growth of bacteria. Anti septic 603 A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. Anti-rheumatic 585 Any substance introduced into a living organism with therapeutic or diagnostic purpose. Anti-salmonella 591 A substance that kills or slows the growth of bacteria. Pesticide 1210 Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. Tyrosinase inhibitor 1389 Any EC 1.14.18.* (oxidoreductase acting on paired donors, miscellaneous compound as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosinase (monophenol monooxygenase), EC 1.14.18.1, an enzyme that catalyses the oxidation of phenols (such as tyrosine) and is widespread in plants and animals.