1.0 2010-04-08 22:08:32 UTC 2019-11-26 03:03:26 UTC FDB009340 11-Dodecenoic acid It is used as a food additive . 11-Dodecenoate 11-Lauroleate 11-lauroleic acid Dodecenoic acid C12H22O2 198.3019 198.161979948 dodec-11-enoic acid 11-dodecenoic acid 65423-25-8 OC(=O)CCCCCCCCCC=C InChI=1S/C12H22O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2H,1,3-11H2,(H,13,14) GZZPOFFXKUVNSW-UHFFFAOYSA-N belongs to the class of organic compounds known as medium-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 4 and 12 carbon atoms. Medium-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Unsaturated fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Medium-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Unsaturated fatty acid Unsaturated fatty acids dodecenoic acid logp 4.37 ALOGPS logs -4.39 ALOGPS solubility 8.16e-03 g/l ALOGPS logp 4.17 ChemAxon pka_strongest_acidic 4.95 ChemAxon iupac dodec-11-enoic acid ChemAxon average_mass 198.3019 ChemAxon mono_mass 198.161979948 ChemAxon smiles OC(=O)CCCCCCCCCC=C ChemAxon formula C12H22O2 ChemAxon inchi InChI=1S/C12H22O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2H,1,3-11H2,(H,13,14) ChemAxon inchikey GZZPOFFXKUVNSW-UHFFFAOYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 58.72 ChemAxon polarizability 24.88 ChemAxon rotatable_bond_count 10 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 5202 Specdb::MsIr 5203 Specdb::CMs 14927 Specdb::CMs 42794 Specdb::CMs 173652 Specdb::MsMs 6926 Specdb::MsMs 6927 Specdb::MsMs 6928 Specdb::MsMs 13598 Specdb::MsMs 13599 Specdb::MsMs 13600 Specdb::MsMs 2364439 Specdb::MsMs 2364440 Specdb::MsMs 2364441 Specdb::MsMs 2597368 Specdb::MsMs 2597369 Specdb::MsMs 2597370 HMDB32248 #<Reference:0x000055ce306816a0> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Milk (Cow) Type 2 specific Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 citrus fatty