1.0 2010-04-08 22:09:01 UTC 2025-11-18 23:18:52 UTC FDB010210 Rubber, natural-smoked sheet and latex solids (hevea brasiliensis) Rubber, natural-smoked sheet and latex solids (hevea brasiliensis) is a member of the class of compounds known as phenyl phosphates. Phenyl phosphates are aromatic organooxygen compounds containing a phosphate group, which is O-esterified with a phenyl group. Rubber, natural-smoked sheet and latex solids (hevea brasiliensis) is slightly soluble (in water) and a moderately acidic compound (based on its pKa). Rubber, natural-smoked sheet and latex solids (hevea brasiliensis) can be found in a number of food items such as sapodilla, fig, chicory, and common salsify, which makes rubber, natural-smoked sheet and latex solids (hevea brasiliensis) a potential biomarker for the consumption of these food products. Brocresine dihydrogen phosphate C7H9BrNO5P 298.028 296.940171562 {5-[(aminooxy)methyl]-2-bromophenoxy}phosphonic acid 5-[(aminooxy)methyl]-2-bromophenoxyphosphonic acid 9006-04-6 NOCC1=CC(OP(O)(O)=O)=C(Br)C=C1 InChI=1S/C7H9BrNO5P/c8-6-2-1-5(4-13-9)3-7(6)14-15(10,11)12/h1-3H,4,9H2,(H2,10,11,12) WXTCJRIXRVJTPP-UHFFFAOYSA-N belongs to the class of organic compounds known as phenyl phosphates. These are aromatic organooxygen compounds containing a phosphate group, which is O-esterified with a phenyl group. Phenyl phosphates Organic compounds Organic acids and derivatives Organic phosphoric acids and derivatives Phosphate esters Aromatic homomonocyclic compounds Aryl bromides Bromobenzenes Hydrocarbon derivatives Organic nitrogen compounds Organic oxides Organobromides Organooxygen compounds Phenoxy compounds Aromatic homomonocyclic compound Aryl bromide Aryl halide Benzenoid Bromobenzene Halobenzene Hydrocarbon derivative Monocyclic benzene moiety Organic nitrogen compound Organic oxide Organic oxygen compound Organobromide Organohalogen compound Organooxygen compound Phenoxy compound Phenyl phosphate logp 0.84 ALOGPS logs -2.20 ALOGPS solubility 1.87e+00 g/l ALOGPS logp 0.02 ChemAxon pka_strongest_acidic 1.74 ChemAxon pka_strongest_basic 3.99 ChemAxon iupac {5-[(aminooxy)methyl]-2-bromophenoxy}phosphonic acid ChemAxon average_mass 298.028 ChemAxon mono_mass 296.940171562 ChemAxon smiles NOCC1=CC(OP(O)(O)=O)=C(Br)C=C1 ChemAxon formula C7H9BrNO5P ChemAxon inchi InChI=1S/C7H9BrNO5P/c8-6-2-1-5(4-13-9)3-7(6)14-15(10,11)12/h1-3H,4,9H2,(H2,10,11,12) ChemAxon inchikey WXTCJRIXRVJTPP-UHFFFAOYSA-N ChemAxon polar_surface_area 102.01 ChemAxon refractivity 57.42 ChemAxon polarizability 22.15 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 5 ChemAxon donor_count 3 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 90894 Specdb::MsMs 90895 Specdb::MsMs 90896 Specdb::MsMs 154164 Specdb::MsMs 154165 Specdb::MsMs 154166 Specdb::MsMs 3605110 Specdb::MsMs 3605111 Specdb::MsMs 3605112 Specdb::MsMs 3605113 Specdb::MsMs 3605114 Specdb::MsMs 3605115 Black elderberry Type 1 specific Sambucus nigra 4202 Chicory Type 1 specific Cichorium intybus 13427 Common salsify Type 1 specific Tragopogon porrifolius 13731 200.0 200.0 200.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 300.0 300.0 300.0 mg/100 g Endive Type 1 specific Cichorium endivia 114280 Fig Type 1 specific Ficus carica 3494 2400.0 2400.0 2400.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 8000.0 8000.0 8000.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 90.0 90.0 90.0 mg/100 g Opium poppy Type 1 specific Papaver somniferum 3469 7500.0 7500.0 7500.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 4500.0 4500.0 4500.0 mg/100 g Sapodilla Type 1 specific Manilkara zapota 3741 15000.0 15000.0 15000.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 405.0 550.0 260.0 mg/100 g