1.0 2010-04-08 22:09:14 UTC 2025-11-18 23:21:11 UTC FDB010658 L,L-Cyclo(prolylalanyl) Isolated from cocoa. L,L-Cyclo(prolylalanyl) is found in cocoa and cocoa products. Cyclo(prolylalanyl); (3S-trans)-form Cyclo(prolylalanyl); L,L-form C8H12N2O2 168.1931 168.089877638 3-methyl-octahydropyrrolo[1,2-a]piperazine-1,4-dione 3-methyl-hexahydropyrrolo[1,2-a]piperazine-1,4-dione 36357-32-1 CC1NC(=O)C2CCCN2C1=O InChI=1S/C8H12N2O2/c1-5-8(12)10-4-2-3-6(10)7(11)9-5/h5-6H,2-4H2,1H3,(H,9,11) WSLYCILIEOFQPK-UHFFFAOYSA-N belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof. Alpha amino acids and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic heteropolycyclic compounds 2,5-dioxopiperazines Azacyclic compounds Carbonyl compounds Hydrocarbon derivatives Lactams N-alkylpiperazines Organic oxides Organonitrogen compounds Organopnictogen compounds Pyrrolidines Secondary carboxylic acid amides Tertiary carboxylic acid amides 1,4-diazinane 2,5-dioxopiperazine Aliphatic heteropolycyclic compound Alpha-amino acid or derivatives Azacycle Carbonyl group Carboxamide group Dioxopiperazine Hydrocarbon derivative Lactam N-alkylpiperazine Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Piperazine Pyrrolidine Secondary carboxylic acid amide Tertiary carboxylic acid amide logp -1.06 ALOGPS logs 0.08 ALOGPS solubility 2.01e+02 g/l ALOGPS melting_point Mp 153-156° logp -0.8 ChemAxon pka_strongest_acidic 11.28 ChemAxon pka_strongest_basic -4 ChemAxon iupac 3-methyl-octahydropyrrolo[1,2-a]piperazine-1,4-dione ChemAxon average_mass 168.1931 ChemAxon mono_mass 168.089877638 ChemAxon smiles CC1NC(=O)C2CCCN2C1=O ChemAxon formula C8H12N2O2 ChemAxon inchi InChI=1S/C8H12N2O2/c1-5-8(12)10-4-2-3-6(10)7(11)9-5/h5-6H,2-4H2,1H3,(H,9,11) ChemAxon inchikey WSLYCILIEOFQPK-UHFFFAOYSA-N ChemAxon polar_surface_area 49.41 ChemAxon refractivity 42.28 ChemAxon polarizability 17.08 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 100158 Specdb::MsMs 100159 Specdb::MsMs 100160 Specdb::MsMs 165408 Specdb::MsMs 165409 Specdb::MsMs 165410 Specdb::MsMs 3605173 Specdb::MsMs 3605174 Specdb::MsMs 3605175 Specdb::MsMs 3605176 Specdb::MsMs 3605177 Specdb::MsMs 3605178 Cocoa and cocoa products Unknown generic Cocoa bean Type 1 specific Theobroma cacao 3641