1.0 2010-04-08 22:09:59 UTC 2018-05-28 23:33:49 UTC FDB012088 4,5-Dimethoxy-1,2-benzenedicarboxylic acid Degradation production of many alkaloids. Isolated from poppy straw (Papaver somniferum). 1,2-Benzenedicarboxylic acid, 4,5-dimethoxy- 4, 5-Dimethoxy-1,2-benzenedicarboxylic acid 4,5-Dimethoxy-1,2-benzenedicarboxylic acid 4,5-Dimethoxy-phthalic acid 4,5-Dimethoxyphthalic acid M-hemipic acid m-Hemipinic acid Metahemipic acid Phthalic acid, 4,5-dimethoxy- Veratrole-4,5-dicarboxylic acid C10H10O6 226.1828 226.047738052 4,5-dimethoxybenzene-1,2-dicarboxylic acid 4,5-dimethoxybenzene-1,2-dicarboxylic acid 577-68-4 COC1=C(OC)C=C(C(O)=O)C(=C1)C(O)=O InChI=1S/C10H10O6/c1-15-7-3-5(9(11)12)6(10(13)14)4-8(7)16-2/h3-4H,1-2H3,(H,11,12)(H,13,14) SKBDLRWFSRLIPP-UHFFFAOYSA-N belongs to the class of organic compounds known as p-methoxybenzoic acids and derivatives. These are benzoic acids in which the hydrogen atom at position 4 of the benzene ring is replaced by a methoxy group. P-methoxybenzoic acids and derivatives Organic compounds Benzenoids Benzene and substituted derivatives Benzoic acids and derivatives Aromatic homomonocyclic compounds Alkyl aryl ethers Anisoles Benzoic acids Benzoyl derivatives Carboxylic acids Dicarboxylic acids and derivatives Dimethoxybenzenes Hydrocarbon derivatives M-methoxybenzoic acids and derivatives Organic oxides Phenoxy compounds Alkyl aryl ether Anisole Aromatic homomonocyclic compound Benzoic acid Benzoyl Carboxylic acid Carboxylic acid derivative Dicarboxylic acid or derivatives Dimethoxybenzene Ether Hydrocarbon derivative M-methoxybenzoic acid or derivatives Methoxybenzene O-dimethoxybenzene Organic oxide Organic oxygen compound Organooxygen compound P-methoxybenzoic acid or derivatives Phenol ether Phenoxy compound logp 1.16 ALOGPS logs -2.16 ALOGPS solubility 1.57e+00 g/l ALOGPS melting_point Mp 174-175° logp 0.97 ChemAxon pka_strongest_acidic 2.98 ChemAxon pka_strongest_basic -4.6 ChemAxon iupac 4,5-dimethoxybenzene-1,2-dicarboxylic acid ChemAxon average_mass 226.1828 ChemAxon mono_mass 226.047738052 ChemAxon smiles COC1=C(OC)C=C(C(O)=O)C(=C1)C(O)=O ChemAxon formula C10H10O6 ChemAxon inchi InChI=1S/C10H10O6/c1-15-7-3-5(9(11)12)6(10(13)14)4-8(7)16-2/h3-4H,1-2H3,(H,11,12)(H,13,14) ChemAxon inchikey SKBDLRWFSRLIPP-UHFFFAOYSA-N ChemAxon polar_surface_area 93.06 ChemAxon refractivity 53.5 ChemAxon polarizability 20.95 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 6 ChemAxon donor_count 2 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 14083 Specdb::CMs 43565 Specdb::CMs 156195 Specdb::MsMs 7673 Specdb::MsMs 7674 Specdb::MsMs 7675 Specdb::MsMs 14345 Specdb::MsMs 14346 Specdb::MsMs 14347 Specdb::MsMs 2742997 Specdb::MsMs 2742998 Specdb::MsMs 2742999 Specdb::MsMs 2935169 Specdb::MsMs 2935170 Specdb::MsMs 2935171 HMDB33893 #<Reference:0x000055ce326257e0>