1.0 2010-04-08 22:10:00 UTC 2025-11-18 23:33:54 UTC FDB012108 Rubrofusarin Rubrofusarin, also known as nsc 258316, is a member of the class of compounds known as naphthopyranones. Naphthopyranones are compounds containing a naphthopyran skeleton where a ring carbon bears a carboxylic acid group. Naphthtopyran is made up of the pyran ring fused to a naphthalene ring system. Rubrofusarin is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Rubrofusarin can be found in mango, which makes rubrofusarin a potential biomarker for the consumption of this food product. 5,6-dihydroxy-8-methoxy-2-methyl-4H-benzo[g]chromen-4-one 5,6-Dihydroxy-8-methoxy-2-methyl-4H-naphtho[2,3-b]pyran-4-one, 9CI 5,6-Dihydroxy-8-methoxy-2-methyl-benzo[g]chromen-4-one 5,6-Dihydroxy-8-methoxy-2-methylbenzo[g]chromen-4-one Rubrafusarin Rubrofusarin C15H12O5 272.2528 272.068473494 5,6-dihydroxy-8-methoxy-2-methyl-4H-benzo[g]chromen-4-one rubrofusarin 3567-00-8 COC1=CC(O)=C2C(O)=C3C(=O)C=C(C)OC3=CC2=C1 InChI=1S/C15H12O5/c1-7-3-10(16)14-12(20-7)5-8-4-9(19-2)6-11(17)13(8)15(14)18/h3-6,17-18H,1-2H3 FPNKCZKRICBAKG-UHFFFAOYSA-N belongs to the class of organic compounds known as naphthopyranones. Naphthopyranones are compounds containing a naphthopyran skeleton where a ring carbon bears a carboxylic acid group. Naphthtopyran is made up of the pyran ring fused to a naphthalene ring system. Naphthopyranones Organic compounds Organoheterocyclic compounds Naphthopyrans Naphthopyranones Aromatic heteropolycyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Alkyl aryl ethers Anisoles Chromones Heteroaromatic compounds Hydrocarbon derivatives Naphthols and derivatives Organic oxides Oxacyclic compounds Pyranones and derivatives Vinylogous acids 1-benzopyran 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid 1-naphthol Alkyl aryl ether Anisole Aromatic heteropolycyclic compound Benzenoid Benzopyran Chromone Ether Heteroaromatic compound Hydrocarbon derivative Naphthalene Naphthopyranone Organic oxide Organic oxygen compound Organooxygen compound Oxacycle Pyran Pyranone Vinylogous acid Naphthopyrones aromatic ether benzochromenone phenols polyketide logp 2.90 ALOGPS logs -3.27 ALOGPS solubility 1.46e-01 g/l ALOGPS melting_point Mp 210-211° logp 2.75 ChemAxon pka_strongest_acidic 6.82 ChemAxon pka_strongest_basic -4.7 ChemAxon iupac 5,6-dihydroxy-8-methoxy-2-methyl-4H-benzo[g]chromen-4-one ChemAxon average_mass 272.2528 ChemAxon mono_mass 272.068473494 ChemAxon smiles COC1=CC(O)=C2C(O)=C3C(=O)C=C(C)OC3=CC2=C1 ChemAxon formula C15H12O5 ChemAxon inchi InChI=1S/C15H12O5/c1-7-3-10(16)14-12(20-7)5-8-4-9(19-2)6-11(17)13(8)15(14)18/h3-6,17-18H,1-2H3 ChemAxon inchikey FPNKCZKRICBAKG-UHFFFAOYSA-N ChemAxon polar_surface_area 75.99 ChemAxon refractivity 73.98 ChemAxon polarizability 27.53 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 5 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 79368 Specdb::MsMs 109260 Specdb::MsMs 109261 Specdb::MsMs 109262 Specdb::MsMs 176667 Specdb::MsMs 176668 Specdb::MsMs 176669 Mango Type 1 specific Mangifera indica 29780