1.0 2010-04-08 22:10:10 UTC 2019-11-26 03:06:46 UTC FDB012437 Methyl stearate Antifoaming agent and fermentation nutrient. Methyl stearate is found in cloves. Kemester 4516 Kemester 9018 Kemester 9718 Metholene 2218 Methyl (Z)-9-octadecenoate Methyl ester of octadecanoic acid Methyl n-octadecanoate Methyl octadecanoate Methyl stearate N-octadecanoic acid methyl ester N-octadecanoic acid, methyl ester Octadecanoic acid, methyl ester Octadecanoic acid,methyl ester Stearic acid methyl ester Stearic acid, methyl ester C19H38O2 298.5038 298.28718046 methyl octadecanoate methyl stearate 112-61-8 CCCCCCCCCCCCCCCCCC(=O)OC InChI=1S/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 HPEUJPJOZXNMSJ-UHFFFAOYSA-N belongs to the class of organic compounds known as fatty acid methyl esters. Fatty acid methyl esters are compounds containing a fatty acid that is esterified with a methyl group. They have the general structure RC(=O)OR', where R=fatty aliphatic tail or organyl group and R'=methyl group. Fatty acid methyl esters Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acid esters Aliphatic acyclic compounds Carbonyl compounds Hydrocarbon derivatives Methyl esters Monocarboxylic acids and derivatives Organic oxides Aliphatic acyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Fatty acid methyl ester Hydrocarbon derivative Methyl ester Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Wax monoesters fatty acid methyl ester logp 8.45 ALOGPS logs -6.94 ALOGPS solubility 3.39e-05 g/l ALOGPS melting_point Mp 39.1° logp 7.29 ChemAxon pka_strongest_basic -7 ChemAxon iupac methyl octadecanoate ChemAxon average_mass 298.5038 ChemAxon mono_mass 298.28718046 ChemAxon smiles CCCCCCCCCCCCCCCCCC(=O)OC ChemAxon formula C19H38O2 ChemAxon inchi InChI=1S/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 ChemAxon inchikey HPEUJPJOZXNMSJ-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 91.05 ChemAxon polarizability 40.68 ChemAxon rotatable_bond_count 17 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 50733 Specdb::MsMs 50734 Specdb::MsMs 50735 Specdb::MsMs 127959 Specdb::MsMs 127960 Specdb::MsMs 127961 Specdb::MsMs 2301627 Specdb::MsMs 2301628 Specdb::MsMs 2301629 Specdb::MsMs 3063952 Specdb::MsMs 3063953 Specdb::MsMs 3063954 Specdb::CMs 1815 Specdb::CMs 18529 Specdb::CMs 27300 Specdb::CMs 27485 Specdb::CMs 28228 Specdb::CMs 28246 Specdb::CMs 28640 Specdb::CMs 28873 Specdb::CMs 31639 Specdb::CMs 32314 Specdb::CMs 171071 HMDB34154 #<Reference:0x000055ce3211a778> Blackberry Type 1 specific Rubus Cloves Type 1 specific Syzygium aromaticum 219868 Evergreen blackberry Type 1 specific Rubus laciniatus fat oily waxy