1.0 2010-04-08 22:11:49 UTC 2025-11-19 00:54:41 UTC FDB015392 Zinc acetate Nutrient supplement Zinc acetate is the chemical compound with the formula Zn(O2CCH3)2, which commonly occurs as a dihydrate Zn(O2CCH3)2(H2O)2. Both the hydrate and the anhydrous forms are colorless solids that are commonly used in chemical synthesis and as dietary supplements. Zinc acetates are prepared by the action of acetic acid on zinc carbonate or zinc metal. When used as a food additive, it has the E number E650. Acetic acid, zinc salt Acetic acid, zinc(II) salt E650 Zinc diacetate C4H6O4Zn 183.497 181.955755258 zinc(2+) ion diacetate zinc(2+) ion diacetate 557-34-6 [Zn++].CC([O-])=O.CC([O-])=O InChI=1S/2C2H4O2.Zn/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 DJWUNCQRNNEAKC-UHFFFAOYSA-L belongs to the class of organic compounds known as carboxylic acids. Carboxylic acids are compounds containing a carboxylic acid group with the formula -C(=O)OH. Carboxylic acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Carboxylic acids Carbonyl compounds Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organic salts Aliphatic acyclic compound Carbonyl group Carboxylic acid Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organic salt Organooxygen compound acetate salt zinc molecular entity liquid logp 0.20 ALOGPS logs -0.57 ALOGPS solubility 4.99e+01 g/l ALOGPS melting_point Mp 242° logp -0.22 ChemAxon pka_strongest_acidic 4.54 ChemAxon iupac zinc(2+) ion diacetate ChemAxon average_mass 183.497 ChemAxon mono_mass 181.955755258 ChemAxon smiles [Zn++].CC([O-])=O.CC([O-])=O ChemAxon formula C4H6O4Zn ChemAxon inchi InChI=1S/2C2H4O2.Zn/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 ChemAxon inchikey DJWUNCQRNNEAKC-UHFFFAOYSA-L ChemAxon polar_surface_area 40.13 ChemAxon refractivity 23.48 ChemAxon polarizability 4.96 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon HMDB36495