1.0 2010-04-08 22:12:52 UTC 2025-11-19 01:52:20 UTC FDB017148 Cyanidin 3-arabinoside Isolated from numerous plant subspecies including red pears and apples. Cyanidin 3-arabinoside is found in many foods, some of which are common grape, american cranberry, blackcurrant, and lingonberry. Cyanidin 3-arabinoside Cyanidin 3-b-L-arabinoside Cyanidin 3-O-arabinoside C20H19O10 419.3589 419.097821828 3-{[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy}-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-1λ⁴-chromen-1-ylium 3-{[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy}-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-1λ⁴-chromen-1-ylium 27214-72-8 OC[C@@H]1O[C@H](OC2=CC3=C(C=C(O)C=C3O)[O+]=C2C2=CC(O)=C(O)C=C2)[C@H](O)[C@H]1O InChI=1S/C20H18O10/c21-7-16-17(26)18(27)20(30-16)29-15-6-10-12(24)4-9(22)5-14(10)28-19(15)8-1-2-11(23)13(25)3-8/h1-6,16-18,20-21,26-27H,7H2,(H3-,22,23,24,25)/p+1/t16-,17-,18+,20-/m0/s1 SBBFXSBQYRSIPP-GNBUJSLZSA-O belongs to the class of organic compounds known as anthocyanidin-3-o-glycosides. These are phenolic compounds containing one anthocyanidin moiety which is O-glycosidically linked to a carbohydrate moiety at the C3-position. Anthocyanidin-3-O-glycosides Organic compounds Phenylpropanoids and polyketides Flavonoids Flavonoid glycosides Aromatic heteropolycyclic compounds 1-benzopyrans 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids 3'-hydroxyflavonoids 4'-hydroxyflavonoids 5-hydroxyflavonoids 7-hydroxyflavonoids Acetals Anthocyanidins Benzene and substituted derivatives Catechols Flavonoid-3-O-glycosides Heteroaromatic compounds Hydrocarbon derivatives O-glycosyl compounds Organic cations Oxacyclic compounds Pentoses Primary alcohols Secondary alcohols Tetrahydrofurans 1-benzopyran 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid 3'-hydroxyflavonoid 4'-hydroxyflavonoid 5-hydroxyflavonoid 7-hydroxyflavonoid Acetal Alcohol Anthocyanidin Anthocyanidin-3-o-glycoside Aromatic heteropolycyclic compound Benzenoid Benzopyran Catechol Flavonoid-3-o-glycoside Glycosyl compound Heteroaromatic compound Hydrocarbon derivative Hydroxyflavonoid Monocyclic benzene moiety Monosaccharide O-glycosyl compound Organic cation Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Pentose monosaccharide Phenol Primary alcohol Secondary alcohol Tetrahydrofuran logp 1.45 ALOGPS logs -3.05 ALOGPS solubility 4.06e-01 g/l ALOGPS logp 1.06 ChemAxon pka_strongest_acidic 6.39 ChemAxon pka_strongest_basic -3 ChemAxon iupac 3-{[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy}-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-1λ⁴-chromen-1-ylium ChemAxon average_mass 419.3589 ChemAxon mono_mass 419.097821828 ChemAxon smiles OC[C@@H]1O[C@H](OC2=CC3=C(C=C(O)C=C3O)[O+]=C2C2=CC(O)=C(O)C=C2)[C@H](O)[C@H]1O ChemAxon formula C20H19O10 ChemAxon inchi InChI=1S/C20H18O10/c21-7-16-17(26)18(27)20(30-16)29-15-6-10-12(24)4-9(22)5-14(10)28-19(15)8-1-2-11(23)13(25)3-8/h1-6,16-18,20-21,26-27H,7H2,(H3-,22,23,24,25)/p+1/t16-,17-,18+,20-/m0/s1 ChemAxon inchikey SBBFXSBQYRSIPP-GNBUJSLZSA-O ChemAxon polar_surface_area 173.21 ChemAxon refractivity 110.3 ChemAxon polarizability 40.01 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 9 ChemAxon donor_count 7 ChemAxon physiological_charge 0 ChemAxon formal_charge 1 ChemAxon Specdb::CMs 23749 Specdb::CMs 45619 Specdb::CMs 170986 Specdb::MsMs 44358 Specdb::MsMs 44359 Specdb::MsMs 44360 Specdb::MsMs 155013 Specdb::MsMs 155014 Specdb::MsMs 155015 Specdb::MsMs 2870975 Specdb::MsMs 2870976 Specdb::MsMs 2870977 HMDB37972 #<Reference:0x000055ce3220fc50> Amaranth Type 1 specific Amaranthus 3564 American cranberry Type 1 specific Vaccinium macrocarpon 13750 4.479288 4.479287624 4.479287624 mg/100 g Annual wild rice Type 1 specific Zizania aquatica 75727 Apple Type 1 specific Malus pumila 283210 0.066006 0.066005758 0.066005758 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 Bilberry Type 1 specific Vaccinium myrtillus 180763 32.85 32.85 32.85 mg/100 g Black chokeberry Type 1 specific Photinia melanocarpa 661339 252.767113 252.767112732 252.767112732 mg/100 g Black crowberry Type 1 specific Empetrum nigrum 191066 Black elderberry Type 1 specific Sambucus nigra 4202 0.0 0.0 0.0 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 0.0 0.0 0.0 mg/100 g Breakfast cereal Type 2 specific Bulgur Type 2 specific Canada blueberry Type 1 specific Vaccinium myrtilloides 1503870 Cereals and cereal products Unknown generic Cocoa bean Type 1 specific Theobroma cacao 3641 Common buckwheat Type 1 specific Fagopyrum esculentum 3617 Common grape Type 1 specific Vitis vinifera 29760 0.0 0.0 0.0 mg/100 g Common wheat Type 1 specific Triticum aestivum 4565 Corn Type 1 specific Zea mays 4577 Flour Type 2 specific Gooseberry Type 1 specific Ribes uva-crispa 135518 0.0 0.0 0.0 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 2.161488 2.16148777 2.16148777 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 5.851069 5.851068974 5.851068974 mg/100 g Lowbush blueberry Type 1 specific Vaccinium angustifolium 472369 2.354896 4.032291746 0.67749998 mg/100 g Mango Type 1 specific Mangifera indica 29780 Millet Type 1 specific Panicum miliaceum 4540 Oat Type 1 specific Avena sativa 4498 Oriental wheat Type 1 specific Triticum turanicum 376534 Pomes Unknown generic Quinoa Type 1 specific Chenopodium quinoa 63459 Red raspberry Type 1 specific Rubus idaeus 32247 0.0 0.0 0.0 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 Sorghum Type 1 specific Sorghum bicolor 4558 Soy bean Type 1 specific Glycine max 3847 Spelt Type 1 specific Triticum spelta 58933 Strawberry Type 1 specific Fragaria X ananassa 3747 0.0 0.0 0.0 mg/100 g Summer grape Type 1 specific Vitis aestivalis 3605 0.0 0.0 0.0 mg/100 g Sweet cherry Type 1 specific Prunus avium 42229 0.0 0.0 0.0 mg/100 g Tartary buckwheat Type 1 specific Fagopyrum tataricum 62330 Teff Type 1 specific Eragrostis tef 110835 Triticale Type 1 specific X Triticosecale rimpaui Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 Wheat Type 1 specific Triticum 4564 Wild rice Type 1 specific Zizania 15949