1.0 2010-04-08 22:13:20 UTC 2025-11-19 02:03:50 UTC FDB017828 Luteolin 7-glucuronide Luteolin 7-glucuronide, also known as cyanidenon-7-O-B-D-glucuronate or luteolin 7-O-beta-D-glucuronopyranoside, is a member of the class of compounds known as flavonoid-7-o-glucuronides. Flavonoid-7-o-glucuronides are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to glucuronic acid at the C7-position. Luteolin 7-glucuronide is slightly soluble (in water) and a moderately acidic compound (based on its pKa). Luteolin 7-glucuronide can be found in a number of food items such as globe artichoke, wild carrot, carrot, and lettuce, which makes luteolin 7-glucuronide a potential biomarker for the consumption of these food products. Luteolin 7-glucuronide Luteolin 7-O-beta-D-glucuronide Luteolin 7-O-glucuronide Luteolin-7-glucuronide C21H18O12 462.3604 462.07982604 (2S,3S,4S,5R,6S)-6-{[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-4H-chromen-7-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid luteolin 7-O-glucuronide 29741-10-4 O[C@@H]1[C@@H](O)[C@H](OC2=CC(O)=C3C(=O)C=C(OC3=C2)C2=CC=C(O)C(O)=C2)O[C@@H]([C@H]1O)C(O)=O InChI=1S/C21H18O12/c22-9-2-1-7(3-10(9)23)13-6-12(25)15-11(24)4-8(5-14(15)32-13)31-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-6,16-19,21-24,26-28H,(H,29,30)/t16-,17-,18+,19-,21+/m0/s1 VSUOKLTVXQRUSG-ZFORQUDYSA-N belongs to the class of organic compounds known as flavonoid-7-o-glucuronides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to glucuronic acid at the C7-position. Flavonoid-7-O-glucuronides Organic compounds Phenylpropanoids and polyketides Flavonoids Flavonoid glycosides Aromatic heteropolycyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids 3'-hydroxyflavonoids 4'-hydroxyflavonoids 5-hydroxyflavonoids Acetals Benzene and substituted derivatives Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Catechols Chromones Flavones Flavonoid-7-O-glycosides Heteroaromatic compounds Hexoses Hydrocarbon derivatives Monocarboxylic acids and derivatives O-glucuronides O-glycosyl compounds Organic oxides Oxacyclic compounds Oxanes Phenolic glycosides Polyols Pyranones and derivatives Secondary alcohols Vinylogous acids 1-benzopyran 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid 1-o-glucuronide 3'-hydroxyflavonoid 4'-hydroxyflavonoid 5-hydroxyflavonoid Acetal Alcohol Aromatic heteropolycyclic compound Benzenoid Benzopyran Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Catechol Chromone Flavone Flavonoid-7-o-glucuronide Flavonoid-7-o-glycoside Glucuronic acid or derivatives Glycosyl compound Heteroaromatic compound Hexose monosaccharide Hydrocarbon derivative Hydroxy acid Hydroxyflavonoid Monocarboxylic acid or derivatives Monocyclic benzene moiety Monosaccharide O-glucuronide O-glycosyl compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Oxane Phenol Phenolic glycoside Polyol Pyran Pyranone Secondary alcohol Vinylogous acid Flavones and Flavonols flavones glycosyloxyflavone luteolin O-glucuronoside monosaccharide derivative trihydroxyflavone logp 1.22 ALOGPS logs -2.52 ALOGPS solubility 1.38e+00 g/l ALOGPS logp 0.46 ChemAxon pka_strongest_acidic 2.74 ChemAxon pka_strongest_basic -3.7 ChemAxon iupac (2S,3S,4S,5R,6S)-6-{[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-4H-chromen-7-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid ChemAxon average_mass 462.3604 ChemAxon mono_mass 462.07982604 ChemAxon smiles O[C@@H]1[C@@H](O)[C@H](OC2=CC(O)=C3C(=O)C=C(OC3=C2)C2=CC=C(O)C(O)=C2)O[C@@H]([C@H]1O)C(O)=O ChemAxon formula C21H18O12 ChemAxon inchi InChI=1S/C21H18O12/c22-9-2-1-7(3-10(9)23)13-6-12(25)15-11(24)4-8(5-14(15)32-13)31-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-6,16-19,21-24,26-28H,(H,29,30)/t16-,17-,18+,19-,21+/m0/s1 ChemAxon inchikey VSUOKLTVXQRUSG-ZFORQUDYSA-N ChemAxon polar_surface_area 203.44 ChemAxon refractivity 106.91 ChemAxon polarizability 42.87 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 12 ChemAxon donor_count 7 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 133272 Specdb::CMs 141006 Specdb::MsMs 87069 Specdb::MsMs 87070 Specdb::MsMs 87071 Specdb::MsMs 149496 Specdb::MsMs 149497 Specdb::MsMs 149498 Specdb::MsMs 2227171 Specdb::MsMs 2227549 Specdb::MsMs 2229582 Specdb::MsMs 2229881 Specdb::MsMs 2231885 Specdb::MsMs 2232330 Specdb::MsMs 2729806 Specdb::MsMs 2729807 Specdb::MsMs 2729808 Specdb::MsMs 2975651 Specdb::MsMs 2975652 Specdb::MsMs 2975653 18128 Carrot Type 1 specific Daucus carota ssp. sativus 79200 Chicory Type 1 specific Cichorium intybus 13427 Common oregano Type 1 specific Origanum vulgare 39352 Common sage Type 1 specific Salvia officinalis 38868 Common thyme Type 1 specific Thymus vulgaris 49992 Endive Type 1 specific Cichorium endivia 114280 0.0 0.0 0.0 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 8.3 8.300000191 8.300000191 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 1.456538 2.511922956 0.401153844 mg/100 g Wild carrot Type 1 specific Daucus carota 4039