1.0 2010-04-08 22:14:08 UTC 2019-11-26 03:17:06 UTC FDB019102 N-Malonylanthranilic acid Isolated from the leaves of the peanut (Arachis hypogaea). N-Malonylanthranilic acid is found in nuts. 2-(Malonylamino)benzoic acid 2-[(2-carboxyacetyl)amino]benzenecarboxylic acid 2-[(Carboxyacetyl)amino]benzoic acid, 9CI N-Malonylanthranilate N-Malonylanthranilic acid C10H9NO5 223.1822 223.048072403 2-(2-carboxyacetamido)benzoic acid N-malonylanthranilic acid 53947-84-5 OC(=O)CC(=O)NC1=CC=CC=C1C(O)=O InChI=1S/C10H9NO5/c12-8(5-9(13)14)11-7-4-2-1-3-6(7)10(15)16/h1-4H,5H2,(H,11,12)(H,13,14)(H,15,16) ZDSSCYCDBASEJQ-UHFFFAOYSA-N belongs to the class of organic compounds known as acylaminobenzoic acid and derivatives. These are derivatives of amino benzoic acid derivatives where the amine group is N-acylated. Acylaminobenzoic acid and derivatives Organic compounds Benzenoids Benzene and substituted derivatives Benzoic acids and derivatives Aromatic homomonocyclic compounds 1,3-dicarbonyl compounds Anilides Benzoic acids Benzoyl derivatives Carboxylic acids Dicarboxylic acids and derivatives Hydrocarbon derivatives N-arylamides Organic oxides Organopnictogen compounds Secondary carboxylic acid amides Vinylogous amides 1,3-dicarbonyl compound Acylaminobenzoic acid or derivatives Anilide Aromatic homomonocyclic compound Benzoic acid Benzoyl Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid derivative Dicarboxylic acid or derivatives Hydrocarbon derivative N-arylamide Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary carboxylic acid amide Vinylogous amide dicarboxylic acid monoamide logp 0.26 ALOGPS logs -2.22 ALOGPS solubility 1.34e+00 g/l ALOGPS melting_point Mp 190-192° logp 1.41 ChemAxon pka_strongest_acidic 3.19 ChemAxon pka_strongest_basic -7.9 ChemAxon iupac 2-(2-carboxyacetamido)benzoic acid ChemAxon average_mass 223.1822 ChemAxon mono_mass 223.048072403 ChemAxon smiles OC(=O)CC(=O)NC1=CC=CC=C1C(O)=O ChemAxon formula C10H9NO5 ChemAxon inchi InChI=1S/C10H9NO5/c12-8(5-9(13)14)11-7-4-2-1-3-6(7)10(15)16/h1-4H,5H2,(H,11,12)(H,13,14)(H,15,16) ChemAxon inchikey ZDSSCYCDBASEJQ-UHFFFAOYSA-N ChemAxon polar_surface_area 103.7 ChemAxon refractivity 54.52 ChemAxon polarizability 20.38 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 5 ChemAxon donor_count 3 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 10938 Specdb::CMs 46430 Specdb::CMs 146079 Specdb::MsMs 74199 Specdb::MsMs 74200 Specdb::MsMs 74201 Specdb::MsMs 133515 Specdb::MsMs 133516 Specdb::MsMs 133517 Specdb::MsMs 2401445 Specdb::MsMs 2401446 Specdb::MsMs 2401447 Specdb::MsMs 2533458 Specdb::MsMs 2533459 Specdb::MsMs 2533460 HMDB39495 52430 #<Reference:0x00005632e55088e0> Nuts Unknown generic