1.0 2010-04-08 22:14:52 UTC 2025-11-19 02:28:41 UTC FDB020195 Calcium ferrocyanide Acidity regulator Calcium ferrocyanide Dicalcium hexacyanoferrate E538 C6CaFeN6 252.027 251.915977318 calcium ironhexacarbonitrile calcium prussian blue [Ca++].N#C[Fe](C#N)(C#N)(C#N)(C#N)C#N InChI=1S/6CN.Ca.Fe/c6*1-2;;/q;;;;;;+2; DZJGEGDKTGBFDK-UHFFFAOYSA-N belongs to the class of organic compounds known as transition metal cyanide salts. These are organic compounds containing a transition metal and a cyanide ion [C-]#N. Transition metal cyanide salts Organic compounds Organic salts Organic metal salts Organic transition metal salts Aliphatic acyclic compounds Hydrocarbon derivatives Organic cations Organonitrogen compounds Organopnictogen compounds Organotransition metal compounds Aliphatic acyclic compound Hydrocarbon derivative Organic cation Organic nitrogen compound Organic transition metal moeity Organometallic compound Organonitrogen compound Organopnictogen compound Transition metal cyanide salt logp -0.26 ChemAxon iupac calcium ironhexacarbonitrile ChemAxon average_mass 252.027 ChemAxon mono_mass 251.915977318 ChemAxon smiles [Ca++].N#C[Fe](C#N)(C#N)(C#N)(C#N)C#N ChemAxon formula C6CaFeN6 ChemAxon inchi InChI=1S/6CN.Ca.Fe/c6*1-2;;/q;;;;;;+2; ChemAxon inchikey DZJGEGDKTGBFDK-UHFFFAOYSA-N ChemAxon polar_surface_area 142.74 ChemAxon refractivity 39.93 ChemAxon polarizability 16.92 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 6 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 2 ChemAxon