1.0 2010-04-08 22:15:04 UTC 2019-11-26 03:19:01 UTC FDB020496 Agaritinal Isolated from Agaricus campestris (field mushroom). Agaritinal is found in mushrooms. Agaritinal N2-(g-Glutamyl)-4-formylphenylhydrazine C12H15N3O4 265.2652 265.106255983 (2S)-2-amino-4-[(4-formylphenyl)-C-hydroxycarbonohydrazonoyl]butanoic acid (2S)-2-amino-4-[(4-formylphenyl)-C-hydroxycarbonohydrazonoyl]butanoic acid 114847-20-0 [H][C@](N)(CCC(=O)NNC1=CC=C(C=O)C=C1)C(O)=O InChI=1S/C12H15N3O4/c13-10(12(18)19)5-6-11(17)15-14-9-3-1-8(7-16)2-4-9/h1-4,7,10,14H,5-6,13H2,(H,15,17)(H,18,19)/t10-/m0/s1 OLPOUQMVOMXOGV-JTQLQIEISA-N belongs to the class of organic compounds known as glutamine and derivatives. Glutamine and derivatives are compounds containing glutamine or a derivative thereof resulting from reaction of glutamine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Glutamine and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic homomonocyclic compounds Amino acids Benzaldehydes Benzoyl derivatives Carboxylic acid hydrazides Carboxylic acids Hydrocarbon derivatives L-alpha-amino acids Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Phenylhydrazines Aldehyde Alpha-amino acid Amine Amino acid Aromatic homomonocyclic compound Aryl-aldehyde Benzaldehyde Benzenoid Benzoyl Carbonyl group Carboxylic acid Carboxylic acid hydrazide Glutamine or derivatives Hydrocarbon derivative L-alpha-amino acid Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenylhydrazine Primary aliphatic amine Primary amine logp -0.74 ALOGPS logs -2.97 ALOGPS solubility 2.86e-01 g/l ALOGPS logp -1.4 ChemAxon pka_strongest_acidic 1.82 ChemAxon pka_strongest_basic 9.54 ChemAxon iupac (2S)-2-amino-4-[(4-formylphenyl)-C-hydroxycarbonohydrazonoyl]butanoic acid ChemAxon average_mass 265.2652 ChemAxon mono_mass 265.106255983 ChemAxon smiles [H][C@](N)(CCC(=O)NNC1=CC=C(C=O)C=C1)C(O)=O ChemAxon formula C12H15N3O4 ChemAxon inchi InChI=1S/C12H15N3O4/c13-10(12(18)19)5-6-11(17)15-14-9-3-1-8(7-16)2-4-9/h1-4,7,10,14H,5-6,13H2,(H,15,17)(H,18,19)/t10-/m0/s1 ChemAxon inchikey OLPOUQMVOMXOGV-JTQLQIEISA-N ChemAxon polar_surface_area 125.01 ChemAxon refractivity 69.9 ChemAxon polarizability 26.97 ChemAxon rotatable_bond_count 7 ChemAxon acceptor_count 7 ChemAxon donor_count 4 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon HMDB40694 #<Reference:0x00007f093c1503c8> Common mushroom Type 1 specific Agaricus bisporus 5341 Mushrooms Unknown generic Oyster mushroom Type 1 specific Pleurotus ostreatus 5322