1.0 2011-09-21 00:06:50 UTC 2015-10-09 22:29:36 UTC FDB022005 3-Hydroxydodecanoic acid 3-Hydroxydodecanoic acid is a medium-chain fatty acid associated with fatty acid metabolic disorders (PMID 11948802). Deficiency of medium-chain acyl-CoA dehydrogenase is characterized by intolerance to prolonged fasting, recurrent episodes of hypoglycemic coma with medium-chain dicarboxylic aciduria, impaired ketogenesis, and low plasma and tissue carnitine levels. (OMIM 201450) [HMDB] (RS)-3-Hydroxylaurate (RS)-3-Hydroxylauric acid 11:0(3-OH) 3-hydroxy-dodecanoate 3-hydroxy-dodecanoic acid 3-Hydroxydodecanoate 3-Hydroxydodecanoic acid 3-Hydroxylaurate 3-Hydroxylauric acid 3-OH Dodecanoate 3-OH Dodecanoic acid 3-OH Laate 3-OH Laic acid 3-OH Lauric acid b-Hydroxydodecanoate b-Hydroxydodecanoic acid b-Hydroxylaate b-Hydroxylaic acid b-Hydroxylaurate b-Hydroxylauric acid b-OH Dodecanoate b-OH Dodecanoic acid b-OH Laate b-OH Laic acid beta-hydroxydodecanoate beta-hydroxydodecanoic acid beta-Hydroxylaate beta-Hydroxylaic acid beta-hydroxylaurate beta-hydroxylauric acid beta-OH Dodecanoate beta-OH Dodecanoic acid beta-OH Laate beta-OH Laic acid beta-OH Lauric acid DL-b-Hydroxydodecanoate DL-b-Hydroxydodecanoic acid DL-beta-Hydroxydodecanoate DL-beta-Hydroxydodecanoic acid β-hydroxydodecanoate β-hydroxydodecanoic acid β-hydroxylaate β-hydroxylaic acid β-OH dodecanoate β-OH dodecanoic acid β-OH laate β-OH laic acid C12H24O3 216.3172 216.172544634 3-hydroxydodecanoic acid 3-hydroxydodecanoic acid 1883-13-2 CCCCCCCCCC(O)CC(O)=O InChI=1S/C12H24O3/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15) MUCMKTPAZLSKTL-UHFFFAOYSA-N belongs to the class of organic compounds known as medium-chain hydroxy acids and derivatives. These are hydroxy acids with a 6 to 12 carbon atoms long side chain. Medium-chain hydroxy acids and derivatives Organic compounds Organic acids and derivatives Hydroxy acids and derivatives Medium-chain hydroxy acids and derivatives Aliphatic acyclic compounds Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Hydroxy fatty acids Medium-chain fatty acids Monocarboxylic acids and derivatives Organic oxides Secondary alcohols Alcohol Aliphatic acyclic compound Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acid Fatty acyl Hydrocarbon derivative Hydroxy fatty acid Medium-chain fatty acid Medium-chain hydroxy acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Secondary alcohol 3-hydroxy fatty acid Hydroxy fatty acids medium-chain fatty acid Solid logp 3.63 ALOGPS logs -2.80 ALOGPS solubility 3.45e-01 g/l ALOGPS logp 3.25 ChemAxon pka_strongest_acidic 4.67 ChemAxon pka_strongest_basic -2.8 ChemAxon iupac 3-hydroxydodecanoic acid ChemAxon average_mass 216.3172 ChemAxon mono_mass 216.172544634 ChemAxon smiles CCCCCCCCCC(O)CC(O)=O ChemAxon formula C12H24O3 ChemAxon inchi InChI=1S/C12H24O3/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15) ChemAxon inchikey MUCMKTPAZLSKTL-UHFFFAOYSA-N ChemAxon polar_surface_area 57.53 ChemAxon refractivity 60.2 ChemAxon polarizability 26.59 ChemAxon rotatable_bond_count 10 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrTwoD 1293 Specdb::CMs 1496 Specdb::CMs 19545 Specdb::CMs 31137 Specdb::CMs 37488 Specdb::NmrOneD 1351 Specdb::MsMs 594 Specdb::MsMs 595 Specdb::MsMs 596 Specdb::MsMs 11642 Specdb::MsMs 11643 Specdb::MsMs 11644 Specdb::MsMs 18314 Specdb::MsMs 18315 Specdb::MsMs 18316 HMDB00387 #<Reference:0x000055ce335e4be0> #<Reference:0x000055ce335e4a00> #<Reference:0x000055ce335e4730> Almond Type 1 specific Prunus dulcis 3755 0.0 0.0 0.0 mg/100 g Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Cheddar Cheese Type 2 Cheddar Cheese 0.0 0.0 0.0 mg/100 g Cheese Type 2 specific 0.0 0.0 0.0 mg/100 g Chicken Type 1 specific Gallus gallus 9031 0.0 0.0 0.0 mg/100 g Coconut oil Type 2 0.0 0.0 0.0 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Cottage cheese Type 2 0.0 0.0 0.0 mg/100 g Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Haddock Type 1 specific Melanogrammus aeglefinus 8056 0.0 0.0 0.0 mg/100 g Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mozzarella cheese Type 2 0.0 0.0 0.0 mg/100 g Mule deer Type 1 specific Odocoileus 9871 Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Olive Type 1 specific Olea europaea 4146 0.0 0.0 0.0 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 Parmesan cheese Type 2 0.0 0.0 0.0 mg/100 g Pheasant Type 1 specific Phasianus colchicus 9054 Pollock Type 1 specific Pollachius 8059 0.0 0.0 0.0 mg/100 g Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rice Type 1 specific Oryza sativa 4530 0.0 0.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 Rye bread Type 2 specific 0.0 0.0 0.0 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Swiss cheese Type 2 0.0 0.0 0.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 White bread Type 1 0.0 0.0 0.0 mg/100 g Wild boar Type 1 specific Sus scrofa 9823