1.0 2011-09-21 00:08:31 UTC 2025-11-19 02:40:49 UTC FDB022100 Acetylglycine N-Acetylglycine is used is in biological research of peptidomimetics. It is used as the blocking agent of the N-terminus to prepare unnatural and unusual amino acids and amino acid analogs as well as to modify peptides. N-Substituted glycine analogs are widely used in peptidomimetics and drug research. Excessive amounts N-acetyl amino acids including N-acetylglycine (as well as N-acetylserine, N-acetylglutamine, N-acetylglutamate, N-acetylalanine, Nacetylmethionine and smaller amounts of N-acetylthreonine, N-acetylleucine, N-acetylvaline and N-acetylisoleucine) can be detected in the urine with individuals with Acylase I defiency. This enzyme is involved in the degradation of N-acylated proteins. Individuals with this disorder will experience convulsions, hearing loss ond difficulty feeding. [HMDB] 15N-acetylglycine a-radical 2-acetamidoacetate 2-acetamidoacetic acid Ac Gly Ac-gly-OH acetamidoacetate acetamidoacetic acid Acetic acid aceturate aceturic acid acetylamino-Acetate acetylamino-Acetic acid acetylaminoacetate acetylaminoacetic acid Acetylglycine acetylglycocoll ethanoylaminoethanoate ethanoylaminoethanoic acid n-acetyl-glycine n-acetylglycine N-acetylglycine sodium salt C4H7NO3 117.1033 117.042593095 2-acetamidoacetic acid aceturate 543-24-8 CC(=O)NCC(O)=O InChI=1S/C4H7NO3/c1-3(6)5-2-4(7)8/h2H2,1H3,(H,5,6)(H,7,8) OKJIRPAQVSHGFK-UHFFFAOYSA-N belongs to the class of organic compounds known as n-acyl-alpha amino acids. N-acyl-alpha amino acids are compounds containing an alpha amino acid which bears an acyl group at its terminal nitrogen atom. N-acyl-alpha amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Carbonyl compounds Carboximidic acids Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Propargyl-type 1,3-dipolar organic compounds Aliphatic acyclic compound Carbonyl group Carboximidic acid Carboximidic acid derivative Carboxylic acid Hydrocarbon derivative Monocarboxylic acid or derivatives N-acyl-alpha-amino acid Organic 1,3-dipolar compound Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Propargyl-type 1,3-dipolar organic compound N-acetyl-amino acid N-acylglycine Solid logp -0.89 ALOGPS logs -0.36 ALOGPS solubility 5.13e+01 g/l ALOGPS logp -1.3 ChemAxon pka_strongest_acidic 3.77 ChemAxon pka_strongest_basic -2 ChemAxon iupac 2-acetamidoacetic acid ChemAxon average_mass 117.1033 ChemAxon mono_mass 117.042593095 ChemAxon smiles CC(=O)NCC(O)=O ChemAxon formula C4H7NO3 ChemAxon inchi InChI=1S/C4H7NO3/c1-3(6)5-2-4(7)8/h2H2,1H3,(H,5,6)(H,7,8) ChemAxon inchikey OKJIRPAQVSHGFK-UHFFFAOYSA-N ChemAxon polar_surface_area 66.4 ChemAxon refractivity 25.45 ChemAxon polarizability 10.69 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 1013 Specdb::CMs 14084 Specdb::CMs 29851 Specdb::CMs 31163 Specdb::CMs 37602 Specdb::CMs 136170 Specdb::CMs 143904 Specdb::CMs 1065136 Specdb::CMs 1065138 Specdb::CMs 1065140 Specdb::MsIr 608 Specdb::MsIr 609 Specdb::MsIr 610 Specdb::NmrOneD 1408 Specdb::NmrOneD 144230 Specdb::NmrOneD 144231 Specdb::NmrOneD 144232 Specdb::NmrOneD 144233 Specdb::NmrOneD 144234 Specdb::NmrOneD 144235 Specdb::NmrOneD 144236 Specdb::NmrOneD 144237 Specdb::NmrOneD 144238 Specdb::NmrOneD 144239 Specdb::NmrOneD 144240 Specdb::NmrOneD 144241 Specdb::NmrOneD 144242 Specdb::NmrOneD 144243 Specdb::NmrOneD 144244 Specdb::NmrOneD 144245 Specdb::NmrOneD 144246 Specdb::NmrOneD 144247 Specdb::NmrOneD 144248 Specdb::NmrOneD 144249 Specdb::NmrTwoD 1352 Specdb::MsMs 752 Specdb::MsMs 753 Specdb::MsMs 754 Specdb::MsMs 4181 Specdb::MsMs 8849 Specdb::MsMs 8850 Specdb::MsMs 8851 Specdb::MsMs 15521 Specdb::MsMs 15522 Specdb::MsMs 15523 Specdb::MsMs 439211 Specdb::MsMs 440084 Specdb::MsMs 2236482 Specdb::MsMs 2236910 Specdb::MsMs 2238564 Specdb::MsMs 2238721 Specdb::MsMs 2238998 Specdb::MsMs 2240684 Specdb::MsMs 2241029 Specdb::MsMs 2242765 Specdb::MsMs 2243056 Specdb::MsMs 2250989 Specdb::MsMs 2251440 Specdb::MsMs 2336896 Specdb::MsMs 2336897 HMDB00532 AAC Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Beer Type 2 specific 1700.0 1700.0 1700.0 mg/100 g Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Glycine N-acyltransferase Q6IB77 GLYAT Glycine N-acyltransferase-like protein 1 Q969I3 GLYATL1 Glycine N-acyltransferase-like protein 2 Q8WU03 GLYATL2