1.0 2011-09-21 00:10:36 UTC 2024-11-29 22:27:01 UTC FDB022231 N-Acetyl-L-alanine N-Acetyl-L-alanine is a substrate for Guanine nucleotide-binding protein G(I)/G(S)/G(O) gamma-2 subunit, Myelin basic protein, GTP-binding nuclear protein Ran, Tropomyosin alpha 4 chain, HIV-1 Rev binding protein 2, Xaa-Pro dipeptidase, Thymosin beta-10, Actin-like protein 3, Alanine aminotransferase, Serine/threonine protein phosphatase PP1-beta catalytic subunit, 10 kDa heat shock protein (mitochondrial), Calmodulin and Beta-1-syntrophin. [HMDB] (S)-(-)-N-Acetylalanine (S)-2-(acetylamino)Propanoate (S)-2-(acetylamino)Propanoic acid (S)-N-Acetylalanine 2-Acetamidopropionate 2-Acetamidopropionic acid Ac-ala-OH Acetyl-L-alanine Acetylalanine L-N-Acetylalanine N-Acetyl-(S)-alanine N-Acetyl-L-a-alanine N-Acetyl-L-alanine N-Acetyl-L-alpha-alanine N-Acetyl-L-α-alanine N-Acetyl-S-alanine N-Acetylalanine C5H9NO3 131.1299 131.058243159 (2S)-2-acetamidopropanoic acid N-acetylalanine 97-69-8 C[C@H](NC(C)=O)C(O)=O InChI=1S/C5H9NO3/c1-3(5(8)9)6-4(2)7/h3H,1-2H3,(H,6,7)(H,8,9)/t3-/m0/s1 KTHDTJVBEPMMGL-VKHMYHEASA-N belongs to the class of organic compounds known as n-acyl-l-alpha-amino acids. These are n-acylated alpha amino acids which have the L-configuration of the alpha-carbon atom. N-acyl-L-alpha-amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Acetamides Alanine and derivatives Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Secondary carboxylic acid amides Acetamide Alanine or derivatives Aliphatic acyclic compound Carbonyl group Carboxamide group Carboxylic acid Hydrocarbon derivative Monocarboxylic acid or derivatives N-acyl-l-alpha-amino acid Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary carboxylic acid amide L-alanine derivative N-acetyl-L-amino acid Solid logp -0.53 ALOGPS logs -0.48 ALOGPS solubility 4.36e+01 g/l ALOGPS logp -0.76 ChemAxon pka_strongest_acidic 3.89 ChemAxon pka_strongest_basic -2 ChemAxon iupac (2S)-2-acetamidopropanoic acid ChemAxon average_mass 131.1299 ChemAxon mono_mass 131.058243159 ChemAxon smiles C[C@H](NC(C)=O)C(O)=O ChemAxon formula C5H9NO3 ChemAxon inchi InChI=1S/C5H9NO3/c1-3(5(8)9)6-4(2)7/h3H,1-2H3,(H,6,7)(H,8,9)/t3-/m0/s1 ChemAxon inchikey KTHDTJVBEPMMGL-VKHMYHEASA-N ChemAxon polar_surface_area 66.4 ChemAxon refractivity 29.94 ChemAxon polarizability 12.5 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Metabolism and Physiological Effects of N-Acetyl-L-Alanine SMP0126554 Specdb::NmrTwoD 1039 Specdb::NmrTwoD 1478 Specdb::MsIr 849 Specdb::MsIr 850 Specdb::MsIr 851 Specdb::CMs 1010 Specdb::CMs 3316 Specdb::CMs 31226 Specdb::CMs 37753 Specdb::CMs 130680 Specdb::CMs 138414 Specdb::CMs 1074984 Specdb::CMs 1074985 Specdb::CMs 1074987 Specdb::NmrOneD 1270 Specdb::NmrOneD 1532 Specdb::NmrOneD 145270 Specdb::NmrOneD 145271 Specdb::NmrOneD 145272 Specdb::NmrOneD 145273 Specdb::NmrOneD 145274 Specdb::NmrOneD 145275 Specdb::NmrOneD 145276 Specdb::NmrOneD 145277 Specdb::NmrOneD 145278 Specdb::NmrOneD 145279 Specdb::NmrOneD 145280 Specdb::NmrOneD 145281 Specdb::NmrOneD 145282 Specdb::NmrOneD 145283 Specdb::NmrOneD 145284 Specdb::NmrOneD 145285 Specdb::NmrOneD 145286 Specdb::NmrOneD 145287 Specdb::NmrOneD 145288 Specdb::NmrOneD 145289 Specdb::NmrOneD 166455 Specdb::MsMs 1104 Specdb::MsMs 1105 Specdb::MsMs 1106 Specdb::MsMs 179901 Specdb::MsMs 179902 Specdb::MsMs 179903 Specdb::MsMs 182235 Specdb::MsMs 182236 Specdb::MsMs 182237 Specdb::MsMs 438686 Specdb::MsMs 2228756 Specdb::MsMs 2230707 Specdb::MsMs 2242194 Specdb::MsMs 2243651 Specdb::MsMs 2252466 Specdb::MsMs 2254037 Specdb::MsMs 2254476 Specdb::MsMs 2256076 Specdb::MsMs 2256435 Specdb::MsMs 2258175 Specdb::MsMs 2258453 Specdb::MsMs 2260109 Specdb::MsMs 2409208 Specdb::MsMs 2409209 Specdb::MsMs 2409210 HMDB00766 17533 AYA Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Carbamoyl-phosphate synthase [ammonia], mitochondrial P31327 CPS1 Glycine N-acyltransferase Q6IB77 GLYAT Glycine N-acyltransferase-like protein 1 Q969I3 GLYATL1 Glycine N-acyltransferase-like protein 2 Q8WU03 GLYATL2 N-acetylglutamate synthase, mitochondrial Q8N159 NAGS