1.0 2011-09-21 00:10:59 UTC 2015-07-21 06:57:05 UTC FDB022256 N-Butyrylglycine N-Butyrylglycine is an acyl glycine. Acyl glycines are normally minor metabolites of fatty acids. However, the excretion of certain acyl glycines is increased in several inborn errors of metabolism. In certain cases the measurement of these metabolites in body fluids can be used to diagnose disorders associated with mitochondrial fatty acid beta-oxidation. Acyl glycines are produced through the action of glycine N-acyltransferase (EC 2.3.1.13) which is an enzyme that catalyzes the chemical reaction: acyl-CoA + glycine < -- > CoA + N-acylglycine Amino acids composed of glycine substituted at the nitrogen rather than the usual carbon position, resulting in the loss of hydrogen bonding donors. Polymers of these compounds are called Peptoids. [HMDB] Butyrylglycine N-(1-Oxobutyl)glycine N-Butanoylglycine N-butyryl-Glycine N-Butyrylglycine C6H11NO3 145.1564 145.073893223 2-butanamidoacetic acid butyrylglycine 20208-73-5 CCCC(=O)NCC(O)=O InChI=1S/C6H11NO3/c1-2-3-5(8)7-4-6(9)10/h2-4H2,1H3,(H,7,8)(H,9,10) WPSSBBPLVMTKRN-UHFFFAOYSA-N belongs to the class of organic compounds known as n-acyl-alpha amino acids. N-acyl-alpha amino acids are compounds containing an alpha amino acid which bears an acyl group at its terminal nitrogen atom. N-acyl-alpha amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Carbonyl compounds Carboximidic acids Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Propargyl-type 1,3-dipolar organic compounds Aliphatic acyclic compound Carbonyl group Carboximidic acid Carboximidic acid derivative Carboxylic acid Hydrocarbon derivative Monocarboxylic acid or derivatives N-acyl-alpha-amino acid Organic 1,3-dipolar compound Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Propargyl-type 1,3-dipolar organic compound Solid logp 0.03 ALOGPS logs -0.92 ALOGPS solubility 1.76e+01 g/l ALOGPS logp -0.18 ChemAxon pka_strongest_acidic 4.06 ChemAxon pka_strongest_basic -1.9 ChemAxon iupac 2-butanamidoacetic acid ChemAxon average_mass 145.1564 ChemAxon mono_mass 145.073893223 ChemAxon smiles CCCC(=O)NCC(O)=O ChemAxon formula C6H11NO3 ChemAxon inchi InChI=1S/C6H11NO3/c1-2-3-5(8)7-4-6(9)10/h2-4H2,1H3,(H,7,8)(H,9,10) ChemAxon inchikey WPSSBBPLVMTKRN-UHFFFAOYSA-N ChemAxon polar_surface_area 66.4 ChemAxon refractivity 34.68 ChemAxon polarizability 14.64 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 1551 Specdb::MsIr 872 Specdb::MsIr 873 Specdb::MsIr 874 Specdb::CMs 14490 Specdb::CMs 37778 Specdb::CMs 133342 Specdb::CMs 141076 Specdb::CMs 1077427 Specdb::CMs 1077429 Specdb::CMs 1077431 Specdb::MsMs 1155 Specdb::MsMs 1156 Specdb::MsMs 1157 Specdb::MsMs 297982 Specdb::MsMs 297983 Specdb::MsMs 297984 Specdb::MsMs 339649 Specdb::MsMs 339650 Specdb::MsMs 339651 Specdb::MsMs 2228765 Specdb::MsMs 2230659 Specdb::MsMs 2232081 Specdb::MsMs 2232099 Specdb::MsMs 2234439 Specdb::MsMs 2234512 Specdb::MsMs 2252363 Specdb::MsMs 2254110 Specdb::MsMs 2254471 Specdb::MsMs 2256116 Specdb::MsMs 2256531 Specdb::MsMs 2258045 Specdb::MsMs 2258507 Specdb::MsMs 2260087 Specdb::MsMs 2269351 Specdb::MsMs 2269352 HMDB00808 #<Reference:0x00007f942a319578> #<Reference:0x00007f942a3193c0> #<Reference:0x00007f942a319208> #<Reference:0x00007f942a319050> #<Reference:0x00007f942a318e98> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Glycine N-acyltransferase Q6IB77 GLYAT Glycine N-acyltransferase-like protein 1 Q969I3 GLYATL1 Glycine N-acyltransferase-like protein 2 Q8WU03 GLYATL2 Glycine N-acyltransferase-like protein 3 Q5SZD4 GLYATL3