1.0 2011-09-21 00:11:21 UTC 2015-07-21 06:57:07 UTC FDB022273 Capryloylglycine Capryloylglycine is an acyl glycine. Acyl glycines are normally minor metabolites of fatty acids. However, the excretion of certain acyl glycines is increased in several inborn errors of metabolism. In certain cases the measurement of these metabolites in body fluids can be used to diagnose disorders associated with mitochondrial fatty acid beta-oxidation. Acyl glycines are produced through the action of glycine N-acyltransferase (EC 2.3.1.13) which is an enzyme that catalyzes the chemical reaction: acyl-CoA + glycine < -- > CoA + N-acylglycine A complex of amino acid protein that helps kill microbes, and protects skin from water loss [HMDB] 2-Octanamidoacetate 2-Octanamidoacetic acid Capryloyl glycine Capryloylglycine Caprylylglycine Lipacide C 8G N-(1-Oxooctyl)-glycine N-(1-Oxooctyl)glycine N-octanoyl-Glycine N-Octanoylglycine C10H19NO3 201.2628 201.136493479 2-octanamidoacetic acid N-octanoylglycine 14246-53-8 CCCCCCCC(=O)NCC(O)=O InChI=1S/C10H19NO3/c1-2-3-4-5-6-7-9(12)11-8-10(13)14/h2-8H2,1H3,(H,11,12)(H,13,14) SAVLIIGUQOSOEP-UHFFFAOYSA-N belongs to the class of organic compounds known as n-acyl-alpha amino acids. N-acyl-alpha amino acids are compounds containing an alpha amino acid which bears an acyl group at its terminal nitrogen atom. N-acyl-alpha amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives N-acyl amines Organic oxides Organonitrogen compounds Organopnictogen compounds Secondary carboxylic acid amides Aliphatic acyclic compound Carbonyl group Carboxamide group Carboxylic acid Fatty acyl Fatty amide Hydrocarbon derivative Monocarboxylic acid or derivatives N-acyl-alpha-amino acid N-acyl-amine Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary carboxylic acid amide N-acylglycine fatty amide Solid logp 2.07 ALOGPS logs -2.30 ALOGPS solubility 9.99e-01 g/l ALOGPS logp 1.59 ChemAxon pka_strongest_acidic 4.05 ChemAxon pka_strongest_basic -1.7 ChemAxon iupac 2-octanamidoacetic acid ChemAxon average_mass 201.2628 ChemAxon mono_mass 201.136493479 ChemAxon smiles CCCCCCCC(=O)NCC(O)=O ChemAxon formula C10H19NO3 ChemAxon inchi InChI=1S/C10H19NO3/c1-2-3-4-5-6-7-9(12)11-8-10(13)14/h2-8H2,1H3,(H,11,12)(H,13,14) ChemAxon inchikey SAVLIIGUQOSOEP-UHFFFAOYSA-N ChemAxon polar_surface_area 66.4 ChemAxon refractivity 53.08 ChemAxon polarizability 22.92 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrTwoD 1503 Specdb::MsIr 896 Specdb::MsIr 897 Specdb::MsIr 898 Specdb::NmrOneD 1561 Specdb::CMs 18565 Specdb::CMs 37793 Specdb::CMs 167815 Specdb::CMs 1078353 Specdb::CMs 1078355 Specdb::CMs 1078357 Specdb::MsMs 1181 Specdb::MsMs 1182 Specdb::MsMs 1183 Specdb::MsMs 307177 Specdb::MsMs 307178 Specdb::MsMs 307179 Specdb::MsMs 351052 Specdb::MsMs 351053 Specdb::MsMs 351054 Specdb::MsMs 2241077 Specdb::MsMs 2244817 Specdb::MsMs 2245321 Specdb::MsMs 2246908 Specdb::MsMs 2247354 Specdb::MsMs 2249062 Specdb::MsMs 2249353 Specdb::MsMs 2251028 Specdb::MsMs 2251362 Specdb::MsMs 2328390 Specdb::MsMs 2328391 Specdb::MsMs 2328392 Specdb::MsMs 2633822 Specdb::MsMs 2633823 Specdb::MsMs 2633824 HMDB00832 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Glycine N-acyltransferase Q6IB77 GLYAT Glycine N-acyltransferase-like protein 1 Q969I3 GLYATL1 Glycine N-acyltransferase-like protein 2 Q8WU03 GLYATL2 Glycine N-acyltransferase-like protein 3 Q5SZD4 GLYATL3