1.0 2011-09-21 00:13:51 UTC 2017-04-03 04:53:11 UTC FDB022429 Glucosamine-1P Glucosamine-1P is a substrate of enzyme UDP-N-acetylglucosamine diphosphorylase [EC 2.7.7.23] (KEGG). [HMDB] alpha-D-Glucosamine 1-ate alpha-D-glucosamine 1-phosphate alpha-D-glucosamine 1P alpha-delta-Glucosamine 1-ate alpha-delta-glucosamine 1-phosphate alpha-delta-glucosamine 1P glucosamine-1P C6H14NO8P 259.151 259.045702941 {[(2S,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phosphonic acid glucosamine-1P 2152-75-2 N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OP(O)(O)=O InChI=1S/C6H14NO8P/c7-3-5(10)4(9)2(1-8)14-6(3)15-16(11,12)13/h2-6,8-10H,1,7H2,(H2,11,12,13)/t2-,3-,4-,5-,6+/m1/s1 YMJBYRVFGYXULK-UKFBFLRUSA-N belongs to the class of organic compounds known as monosaccharide phosphates. These are monosaccharides comprising a phosphated group linked to the carbohydrate unit. Monosaccharide phosphates Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic heteromonocyclic compounds 1,2-aminoalcohols Aminosaccharides Hexoses Hydrocarbon derivatives Monoalkyl phosphates Monoalkylamines Organic oxides Organopnictogen compounds Oxacyclic compounds Oxanes Primary alcohols Secondary alcohols 1,2-aminoalcohol Alcohol Aliphatic heteromonocyclic compound Alkyl phosphate Amine Amino saccharide Hexose monosaccharide Hydrocarbon derivative Monoalkyl phosphate Monosaccharide phosphate Organic nitrogen compound Organic oxide Organic phosphoric acid derivative Organoheterocyclic compound Organonitrogen compound Organopnictogen compound Oxacycle Oxane Phosphoric acid ester Primary alcohol Primary aliphatic amine Primary amine Secondary alcohol Solid logp -2.59 ALOGPS logs -0.87 ALOGPS solubility 3.51e+01 g/l ALOGPS logp -4.2 ChemAxon pka_strongest_acidic 1.18 ChemAxon pka_strongest_basic 8.69 ChemAxon iupac {[(2S,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phosphonic acid ChemAxon average_mass 259.151 ChemAxon mono_mass 259.045702941 ChemAxon smiles N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OP(O)(O)=O ChemAxon formula C6H14NO8P ChemAxon inchi InChI=1S/C6H14NO8P/c7-3-5(10)4(9)2(1-8)14-6(3)15-16(11,12)13/h2-6,8-10H,1,7H2,(H2,11,12,13)/t2-,3-,4-,5-,6+/m1/s1 ChemAxon inchikey YMJBYRVFGYXULK-UKFBFLRUSA-N ChemAxon polar_surface_area 162.7 ChemAxon refractivity 48.45 ChemAxon polarizability 21.43 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 8 ChemAxon donor_count 6 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 262788 Specdb::NmrOneD 262789 Specdb::NmrOneD 262790 Specdb::NmrOneD 262791 Specdb::NmrOneD 262792 Specdb::NmrOneD 262793 Specdb::NmrOneD 262794 Specdb::NmrOneD 262795 Specdb::NmrOneD 262796 Specdb::NmrOneD 262797 Specdb::NmrOneD 262798 Specdb::NmrOneD 262799 Specdb::NmrOneD 262800 Specdb::NmrOneD 262801 Specdb::NmrOneD 262802 Specdb::NmrOneD 262803 Specdb::NmrOneD 262804 Specdb::NmrOneD 262805 Specdb::NmrOneD 262806 Specdb::NmrOneD 262807 Specdb::CMs 22985 Specdb::CMs 37929 Specdb::CMs 152067 Specdb::MsMs 317050 Specdb::MsMs 317051 Specdb::MsMs 317052 Specdb::MsMs 363442 Specdb::MsMs 363443 Specdb::MsMs 363444 Specdb::MsMs 3061583 Specdb::MsMs 3061584 Specdb::MsMs 3061585 Specdb::MsMs 3109518 Specdb::MsMs 3109519 Specdb::MsMs 3109520 HMDB01109 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 UDP-N-acetylhexosamine pyrophosphorylase Q16222 UAP1