1.0 2011-09-21 00:19:14 UTC 2015-07-21 06:57:21 UTC FDB022765 Pristanal Intermediate in the metabolism of phytanic acid and pristanic acid [HMDB] (2R,6R,10R)-2,6,10,14-tetramethylpentadecanal (2R)-pristanal (2S,6R,10R)-2,6,10,14-tetramethylpentadecanal (2S)-pristanal 2,6,10,14-Tetramethylpentadecanal 2(R)-pristanal 2(S)-pristanal 2RPr-al (2R,6R,10R,14)-tetramethylpentadecanal 2SPr-al C19H38O 282.5044 282.292265838 2,6,10,14-tetramethylpentadecanal pristanal 105373-75-9 CC(C)CCCC(C)CCCC(C)CCCC(C)C=O InChI=1S/C19H38O/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20/h15-19H,6-14H2,1-5H3 IZJRIIWUSIGEAJ-UHFFFAOYSA-N belongs to the class of organic compounds known as acyclic diterpenoids. These are diterpenoids (compounds made of four consecutive isoprene units) that do not contain a cycle. Acyclic diterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Diterpenoids Aliphatic acyclic compounds Aldehydes Fatty aldehydes Hydrocarbon derivatives Organic oxides Acyclic diterpenoid Aldehyde Aliphatic acyclic compound Carbonyl group Fatty acyl Fatty aldehyde Hydrocarbon derivative Organic oxide Organic oxygen compound Organooxygen compound 2-methyl-branched fatty aldehyde Acyclic diterpenoids Solid logp 7.79 ALOGPS logs -7.21 ALOGPS solubility 1.73e-05 g/l ALOGPS logp 7.06 ChemAxon pka_strongest_acidic 16.07 ChemAxon pka_strongest_basic -7 ChemAxon iupac 2,6,10,14-tetramethylpentadecanal ChemAxon average_mass 282.5044 ChemAxon mono_mass 282.292265838 ChemAxon smiles CC(C)CCCC(C)CCCC(C)CCCC(C)C=O ChemAxon formula C19H38O ChemAxon inchi InChI=1S/C19H38O/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20/h15-19H,6-14H2,1-5H3 ChemAxon inchikey IZJRIIWUSIGEAJ-UHFFFAOYSA-N ChemAxon polar_surface_area 17.07 ChemAxon refractivity 89.78 ChemAxon polarizability 38.06 ChemAxon rotatable_bond_count 13 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Oxidation of Branched Chain Fatty Acids SMP00030 Phytanic Acid Peroxisomal Oxidation SMP00450 Specdb::CMs 26497 Specdb::CMs 162108 Specdb::MsMs 324745 Specdb::MsMs 324746 Specdb::MsMs 324747 Specdb::MsMs 373228 Specdb::MsMs 373229 Specdb::MsMs 373230 Specdb::MsMs 2669671 Specdb::MsMs 2669672 Specdb::MsMs 2669673 Specdb::MsMs 3009556 Specdb::MsMs 3009557 Specdb::MsMs 3009558 HMDB01958 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823