1.0 2011-09-21 00:21:34 UTC 2019-11-26 03:21:06 UTC FDB022909 2-Phenylglycine 2-Phenylglycine is a metabolite described in normal human urine (PMID 14473597) and plasma (PMID 5888801) [HMDB] (+/-)-a-phenylglycine (+/-)-alpha-phenylglycine 2-amino-2-phenylacetate 2-amino-2-phenylacetic acid 2-phenyl-glycine a-amino-a-Toluate a-amino-a-Toluic acid a-Aminobenzeneacetate a-Aminobenzeneacetic acid a-Aminophenylacetate a-Aminophenylacetic acid alpha-amino-alpha-toluate alpha-amino-alpha-toluic acid alpha-amino-benzeneacetate alpha-amino-benzeneacetic acid alpha-aminobenzeneacetate alpha-aminobenzeneacetic acid alpha-aminophenylacetate alpha-aminophenylacetic acid alpha-phenylgycine amino-Phenyl-acetate amino-Phenyl-acetic acid amino(phenyl)acetate amino(phenyl)acetic acid aminophenylacetic acid DL-2-phenyl-glycine DL-2-Phenylglycine DL-a-aminophenylacetate DL-a-aminophenylacetic acid DL-a-phenylglycine DL-alpha-aminophenylacetate DL-alpha-aminophenylacetic acid DL-alpha-phenylaminoacetate DL-alpha-phenylaminoacetic acid DL-alpha-phenylglycine DL-phenylglycine DL-α-phenylglycine α-amino-α-toluate α-amino-α-toluic acid α-aminobenzeneacetate α-aminobenzeneacetic acid α-aminophenylacetate α-aminophenylacetic acid C8H9NO2 151.1626 151.063328537 2-amino-2-phenylacetic acid (+/-)-α-phenylglycine 2835-06-5 NC(C(O)=O)C1=CC=CC=C1 InChI=1S/C8H9NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H,10,11) ZGUNAGUHMKGQNY-UHFFFAOYSA-N belongs to the class of organic compounds known as alpha amino acids. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Alpha amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic homomonocyclic compounds Amino acids Aralkylamines Benzene and substituted derivatives Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Alpha-amino acid Amine Amino acid Aralkylamine Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine non-proteinogenic alpha-amino acid Solid logp -1.52 ALOGPS logs -1.30 ALOGPS solubility 7.65e+00 g/l ALOGPS logp -1.5 ChemAxon pka_strongest_acidic 2.23 ChemAxon pka_strongest_basic 8.64 ChemAxon iupac 2-amino-2-phenylacetic acid ChemAxon average_mass 151.1626 ChemAxon mono_mass 151.063328537 ChemAxon smiles NC(C(O)=O)C1=CC=CC=C1 ChemAxon formula C8H9NO2 ChemAxon inchi InChI=1S/C8H9NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H,10,11) ChemAxon inchikey ZGUNAGUHMKGQNY-UHFFFAOYSA-N ChemAxon polar_surface_area 63.32 ChemAxon refractivity 40.36 ChemAxon polarizability 15.18 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::NmrTwoD 1803 Specdb::MsIr 1687 Specdb::MsIr 1688 Specdb::MsIr 1689 Specdb::NmrOneD 1864 Specdb::NmrOneD 166338 Specdb::NmrOneD 166568 Specdb::NmrOneD 166569 Specdb::CMs 1132 Specdb::CMs 1200 Specdb::CMs 21637 Specdb::CMs 30026 Specdb::CMs 31400 Specdb::CMs 31401 Specdb::CMs 38319 Specdb::CMs 117381 Specdb::CMs 137188 Specdb::CMs 144922 Specdb::CMs 832942 Specdb::CMs 832943 Specdb::CMs 832944 Specdb::MsMs 2031 Specdb::MsMs 2032 Specdb::MsMs 2033 Specdb::MsMs 314131 Specdb::MsMs 314132 Specdb::MsMs 314133 Specdb::MsMs 359812 Specdb::MsMs 359813 Specdb::MsMs 359814 Specdb::MsMs 445474 Specdb::MsMs 445475 Specdb::MsMs 445476 Specdb::MsMs 2226818 Specdb::MsMs 2227921 Specdb::MsMs 2228634 Specdb::MsMs 2229141 Specdb::MsMs 2230296 Specdb::MsMs 2231605 Specdb::MsMs 2232607 Specdb::MsMs 2234018 Specdb::MsMs 2234901 Specdb::MsMs 2244098 Specdb::MsMs 2245979 Specdb::MsMs 2246222 Specdb::MsMs 2248082 HMDB02210 #<Reference:0x000055ce32c2ea10> #<Reference:0x000055ce32c2e808> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Milk (Cow) Type 2 specific Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823