1.0 2011-09-21 00:22:01 UTC 2015-07-21 06:57:26 UTC FDB022938 4-Hydroxy-L-glutamic acid 4-Hydroxy-L-glutamic acid is an intermediate in the metabolism of gamma-hydroxyglutamic acid. Specifically 4-Hydroxy-L-glutamic acid combines with 2-oxoglutarate to produce 4-hydroxy-2-oxoglutarate and glutamate. The reaction can be described as: 4-Hydroxy-L-glutamate + 2-Oxoglutarate <=> 4-Hydroxy-2-oxoglutarate + L-Glutamate. This reaction is catalyzed by 4-hydroxyglutamate aminotransferase (PMID 13948827). [HMDB] (2S)-2-amino-4-hydroxypentanedioate (2S)-2-amino-4-hydroxypentanedioic acid 4-hydroxy-L-glutamate 4-Hydroxy-L-glutamic acid erythro-4-hydroxyglutamate L-erythro-4-hydroxy-glutamate L-erythro-4-Hydroxyglutamate C5H7NO5 161.1128 161.032422339 (2S)-2-amino-4-hydroxypentanedioate erythro-4-hydroxyglutamate 2485-33-8 N[C@@H](CC(O)C([O-])=O)C([O-])=O InChI=1S/C5H9NO5/c6-2(4(8)9)1-3(7)5(10)11/h2-3,7H,1,6H2,(H,8,9)(H,10,11)/p-2/t2-,3?/m0/s1 HBDWQSHEVMSFGY-SCQFTWEKSA-L belongs to the class of organic compounds known as glutamic acid and derivatives. Glutamic acid and derivatives are compounds containing glutamic acid or a derivative thereof resulting from reaction of glutamic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Glutamic acid and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds 1,3-aminoalcohols Amino acids Amino fatty acids Carbonyl compounds Carboxylic acids Dicarboxylic acids and derivatives Hydrocarbon derivatives Hydroxy fatty acids L-alpha-amino acids Monoalkylamines Organic anions Organic oxides Organopnictogen compounds Secondary alcohols Short-chain hydroxy acids and derivatives 1,3-aminoalcohol Alcohol Aliphatic acyclic compound Alpha-amino acid Amine Amino acid Amino fatty acid Carbonyl group Carboxylic acid Dicarboxylic acid or derivatives Fatty acid Fatty acyl Glutamic acid or derivatives Hydrocarbon derivative Hydroxy fatty acid L-alpha-amino acid Organic anion Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Secondary alcohol Short-chain hydroxy acid L-alpha-amino acid anion dicarboxylic acid dianion Solid logp -1.48 ALOGPS logs 0.46 ALOGPS solubility 5.65e+02 g/l ALOGPS logp -4.2 ChemAxon pka_strongest_acidic 1.68 ChemAxon pka_strongest_basic 9.16 ChemAxon iupac (2S)-2-amino-4-hydroxypentanedioate ChemAxon average_mass 161.1128 ChemAxon mono_mass 161.032422339 ChemAxon smiles N[C@@H](CC(O)C([O-])=O)C([O-])=O ChemAxon formula C5H7NO5 ChemAxon inchi InChI=1S/C5H9NO5/c6-2(4(8)9)1-3(7)5(10)11/h2-3,7H,1,6H2,(H,8,9)(H,10,11)/p-2/t2-,3?/m0/s1 ChemAxon inchikey HBDWQSHEVMSFGY-SCQFTWEKSA-L ChemAxon polar_surface_area 126.51 ChemAxon refractivity 54.41 ChemAxon polarizability 13.35 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 6 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge -2 ChemAxon Arginine and Proline Metabolism SMP00020 map00330 HMDB02273 16338 #<Reference:0x000055ce30342728> #<Reference:0x000055ce30342570> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Aspartate aminotransferase, cytoplasmic P17174 GOT1 Aspartate aminotransferase, mitochondrial P00505 GOT2