1.0 2011-09-21 00:24:54 UTC 2024-11-29 22:26:26 UTC FDB023114 Argininic acid Tissue accumulation of argininic acid (AA) occurs in hyperargininemia. Hyperargininemia, an inborn error of the urea cycle, is caused by a severe deficiency of liver arginase, resulting in elevated tissue levels of arginine (Arg) and other guanidino compounds (GC). Affected patients present a neurological syndrome consisting of a variable degree of mental retardation, epilepsy and progressive spasticity whose pathophysiology is far from understood. Guanidino compounds accumulate in other pathological conditions such as uremia and epilepsy and some evidence supports the hypothesis that these compounds contribute to the neurological dysfunction characteristic of these diseases. The increase of these compounds occurs by blockage of the arginase reaction, activating secondary biochemical pathways. Thus, Arg is converted to &#945;-keto-&#948;-guanidinovaleric acid by transamination, and this compound forms AA by hydrogenation. (PMID 12615083) [HMDB] Arginic acid Argininic acid C6H13N3O3 175.1857 175.095691297 (2S)-5-carbamimidamido-2-hydroxypentanoic acid argininic acid 157-07-3 NC(=N)NCCC[C@H](O)C(O)=O InChI=1S/C6H13N3O3/c7-6(8)9-3-1-2-4(10)5(11)12/h4,10H,1-3H2,(H,11,12)(H4,7,8,9)/t4-/m0/s1 BMFMQGXDDJALKQ-BYPYZUCNSA-N belongs to the class of organic compounds known as delta amino acids and derivatives. Delta amino acids and derivatives are compounds containing a carboxylic acid group and an amino group at the C5 carbon atom. Delta amino acids and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Alpha hydroxy acids and derivatives Carbonyl compounds Carboximidamides Carboxylic acids Fatty acids and conjugates Guanidines Hydrocarbon derivatives Imines Monocarboxylic acids and derivatives Monosaccharides Organic oxides Organopnictogen compounds Secondary alcohols Alcohol Aliphatic acyclic compound Alpha-hydroxy acid Carbonyl group Carboximidamide Carboxylic acid Delta amino acid or derivatives Fatty acid Guanidine Hydrocarbon derivative Hydroxy acid Imine Monocarboxylic acid or derivatives Monosaccharide Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary alcohol Solid logp -1.70 ALOGPS logs -1.87 ALOGPS solubility 2.35e+00 g/l ALOGPS logp -3 ChemAxon pka_strongest_acidic 3.67 ChemAxon pka_strongest_basic 12.37 ChemAxon iupac (2S)-5-carbamimidamido-2-hydroxypentanoic acid ChemAxon average_mass 175.1857 ChemAxon mono_mass 175.095691297 ChemAxon smiles NC(=N)NCCC[C@H](O)C(O)=O ChemAxon formula C6H13N3O3 ChemAxon inchi InChI=1S/C6H13N3O3/c7-6(8)9-3-1-2-4(10)5(11)12/h4,10H,1-3H2,(H,11,12)(H4,7,8,9)/t4-/m0/s1 ChemAxon inchikey BMFMQGXDDJALKQ-BYPYZUCNSA-N ChemAxon polar_surface_area 119.43 ChemAxon refractivity 52.27 ChemAxon polarizability 17.5 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 6 ChemAxon donor_count 5 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Metabolsim and Physiological Effects of Argininic acid SMP0125504 Specdb::MsMs 68415 Specdb::MsMs 68416 Specdb::MsMs 68417 Specdb::MsMs 126438 Specdb::MsMs 126439 Specdb::MsMs 126440 Specdb::MsMs 2295057 Specdb::MsMs 2295058 Specdb::MsMs 2295059 Specdb::MsMs 2640244 Specdb::MsMs 2640245 Specdb::MsMs 2640246 Specdb::CMs 24185 Specdb::CMs 38532 Specdb::CMs 169025 Specdb::MsIr 1883 Specdb::MsIr 1884 Specdb::MsIr 1885 Specdb::NmrOneD 129318 Specdb::NmrOneD 129319 Specdb::NmrOneD 129320 Specdb::NmrOneD 129321 Specdb::NmrOneD 129322 Specdb::NmrOneD 129323 Specdb::NmrOneD 129324 Specdb::NmrOneD 129325 Specdb::NmrOneD 129326 Specdb::NmrOneD 129327 Specdb::NmrOneD 129328 Specdb::NmrOneD 129329 Specdb::NmrOneD 129330 Specdb::NmrOneD 129331 Specdb::NmrOneD 129332 Specdb::NmrOneD 129333 Specdb::NmrOneD 129334 Specdb::NmrOneD 129335 Specdb::NmrOneD 129336 Specdb::NmrOneD 129337 HMDB03148 #<Reference:0x000055ce3066cb88> #<Reference:0x000055ce3066c980> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823