1.0 2011-09-21 00:31:48 UTC 2015-07-21 06:57:46 UTC FDB023573 m-Tyramine m-Tyramine is an amine derived from Tyrosine, Phenylethylamine and other catecholamines. (PMID 7335956) [HMDB] 2-(3-hydroxyphenyl)ethylamine 3-(2-aminoethyl)phenol 3-hydroxyphenethylamine 3-hydroxyphenylethylamine 3-tyramine M-hydroxyphenethylamine Meta-tyramine Metatyramine C8H11NO 137.179 137.084063979 3-(2-aminoethyl)phenol m-tyramine 588-05-6 NCCC1=CC(O)=CC=C1 InChI=1S/C8H11NO/c9-5-4-7-2-1-3-8(10)6-7/h1-3,6,10H,4-5,9H2 GHFGJTVYMNRGBY-UHFFFAOYSA-N belongs to the class of organic compounds known as phenethylamines. Phenethylamines are compounds containing a phenethylamine moiety, which consists of a phenyl group substituted at the second position by an ethan-1-amine. Phenethylamines Organic compounds Benzenoids Benzene and substituted derivatives Phenethylamines Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids 2-arylethylamines Aralkylamines Hydrocarbon derivatives Monoalkylamines Organooxygen compounds Organopnictogen compounds 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid 2-arylethylamine Amine Aralkylamine Aromatic homomonocyclic compound Hydrocarbon derivative Organic nitrogen compound Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenethylamine Phenol Primary aliphatic amine Primary amine Solid logp -0.17 ALOGPS logs -1.30 ALOGPS solubility 6.82e+00 g/l ALOGPS logp 0.64 ChemAxon pka_strongest_acidic 10.27 ChemAxon pka_strongest_basic 9.58 ChemAxon iupac 3-(2-aminoethyl)phenol ChemAxon average_mass 137.179 ChemAxon mono_mass 137.084063979 ChemAxon smiles NCCC1=CC(O)=CC=C1 ChemAxon formula C8H11NO ChemAxon inchi InChI=1S/C8H11NO/c9-5-4-7-2-1-3-8(10)6-7/h1-3,6,10H,4-5,9H2 ChemAxon inchikey GHFGJTVYMNRGBY-UHFFFAOYSA-N ChemAxon polar_surface_area 46.25 ChemAxon refractivity 41.27 ChemAxon polarizability 15.28 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 17647 Specdb::CMs 38829 Specdb::CMs 154751 Specdb::NmrOneD 54842 Specdb::NmrOneD 54843 Specdb::NmrOneD 54844 Specdb::NmrOneD 54845 Specdb::NmrOneD 54846 Specdb::NmrOneD 54847 Specdb::NmrOneD 54848 Specdb::NmrOneD 54849 Specdb::NmrOneD 54850 Specdb::NmrOneD 54851 Specdb::NmrOneD 54852 Specdb::NmrOneD 54853 Specdb::NmrOneD 54854 Specdb::NmrOneD 54855 Specdb::NmrOneD 54856 Specdb::NmrOneD 54857 Specdb::NmrOneD 54858 Specdb::NmrOneD 54859 Specdb::NmrOneD 54860 Specdb::NmrOneD 54861 Specdb::MsMs 58299 Specdb::MsMs 58300 Specdb::MsMs 58301 Specdb::MsMs 114204 Specdb::MsMs 114205 Specdb::MsMs 114206 Specdb::MsMs 2414929 Specdb::MsMs 2414930 Specdb::MsMs 2414931 Specdb::MsMs 2546922 Specdb::MsMs 2546923 Specdb::MsMs 2546924 Specdb::MsIr 2270 Specdb::MsIr 2271 Specdb::MsIr 2272 HMDB04989 #<Reference:0x000055ce32ceafa8> #<Reference:0x000055ce32ceadc8> #<Reference:0x000055ce32ceab48> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823