1.0 2011-09-21 00:36:02 UTC 2019-11-26 03:21:10 UTC FDB023868 Linoelaidic acid Linoelaidic acid is an isomer of linoleic acid, or conjugated linoleic acid (CLA), a derivative of a fatty acid linoleic acid. Conjugated linoleic acid (CLA) isomers, a group of positional and geometric isomers of linoleic acid [18:2(n-6)], have been studied extensively due to their ability to modulate cancer, atherosclerosis, obesity, immune function and diabetes in a variety of experimental models. CLA's ability to modulate human obesity remains controversial because data from clinical trials using mixed isomers are conflicting. (PMID 10759137) Trans fatty acids are characteristically produced during industrial hydrogenation of plant oils. [HMDB]. Linoelaidic acid is found in green zucchini, green bell pepper, and red bell pepper. (9E,12E)-9,12-Octadecadienoate (9E,12E)-9,12-Octadecadienoic acid 18:2, N-6,9 all-trans 9E,12E-octadecadienoate 9E,12E-octadecadienoic acid C18:2, N-6,9 all-trans trans-9,trans-12-Linoleate trans-9,trans-12-Linoleic acid C18H32O2 280.4455 280.240230268 (9E,12E)-octadeca-9,12-dienoic acid linoelaidic acid 506-21-8 CCCCC\C=C\C\C=C\CCCCCCCC(O)=O InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b7-6+,10-9+ OYHQOLUKZRVURQ-AVQMFFATSA-N belongs to the class of organic compounds known as lineolic acids and derivatives. These are derivatives of lineolic acid. Lineolic acid is a polyunsaturated omega-6 18 carbon long fatty acid, with two CC double bonds at the 9- and 12-positions. Lineolic acids and derivatives Organic compounds Lipids and lipid-like molecules Fatty Acyls Lineolic acids and derivatives Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Long-chain fatty acids Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Unsaturated fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acid Hydrocarbon derivative Long-chain fatty acid Monocarboxylic acid or derivatives Octadecanoid Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Unsaturated fatty acid Unsaturated fatty acids octadecadienoic acid omega-6 fatty acid Solid logp 7.06 ALOGPS logs -6.26 ALOGPS solubility 1.54e-04 g/l ALOGPS logp 6.42 ChemAxon pka_strongest_acidic 4.99 ChemAxon iupac (9E,12E)-octadeca-9,12-dienoic acid ChemAxon average_mass 280.4455 ChemAxon mono_mass 280.240230268 ChemAxon smiles CCCCC\C=C\C\C=C\CCCCCCCC(O)=O ChemAxon formula C18H32O2 ChemAxon inchi InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b7-6+,10-9+ ChemAxon inchikey OYHQOLUKZRVURQ-AVQMFFATSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 88.52 ChemAxon polarizability 35.45 ChemAxon rotatable_bond_count 14 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 3099 Specdb::CMs 38985 Specdb::CMs 152501 Specdb::MsMs 106785 Specdb::MsMs 106786 Specdb::MsMs 106787 Specdb::MsMs 173616 Specdb::MsMs 173617 Specdb::MsMs 173618 Specdb::MsMs 285950 Specdb::MsMs 285951 Specdb::MsMs 285952 Specdb::MsMs 285953 Specdb::MsMs 285954 Specdb::MsMs 373990 Specdb::MsMs 373991 Specdb::MsMs 373992 Specdb::MsMs 373993 Specdb::MsMs 373994 Specdb::MsMs 440466 Specdb::MsMs 440467 Specdb::MsMs 440468 Specdb::MsMs 2257394 Specdb::MsMs 2259214 Specdb::MsMs 2259339 Specdb::MsMs 2281399 Specdb::MsMs 2281400 Specdb::MsMs 2281401 HMDB06270 #<Reference:0x000055ce33421f38> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Green bell pepper Type 1 specific Capsicum annuum 4072 96.0 96.0 96.0 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 29.0 29.0 29.0 mg/100 g Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Milk (Cow) Type 2 specific Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Red bell pepper Type 1 specific Capsicum annuum 4072 144.0 144.0 144.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823