1.0 2011-09-21 00:36:30 UTC 2015-07-21 06:57:55 UTC FDB023894 3-Dehydro-L-gulonate 3-Dehydro-L-gulonate is an intermediate in Ascorbate and aldarate metabolism. 3-Dehydro-L-gulonate is the 4th to last step in the synthesis of D-Xylulose 5-phosphate and is converted from 2,3-Diketo-L-gulonate via the enzyme 3-dehydro-L-gulonate 2-dehydrogenase (EC 1.1.1.130). It is then converted to 3-Dehydro-L-gulonate 6-phosphate via the enzyme L-xylulokinase (EC 2.7.1.53). [HMDB] 3-dehydro-L-gulonic acid L-xylo-hex-3-ulosonic acid C6H10O7 194.1394 194.042652674 (2S,4R,5S)-2,4,5,6-tetrahydroxy-3-oxohexanoic acid 3-dehydro-L-gulonic acid OC[C@H](O)[C@@H](O)C(=O)[C@H](O)C(O)=O InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-3,5,7-9,11H,1H2,(H,12,13)/t2-,3+,5-/m0/s1 WTAHRPBPWHCMHW-LWKDLAHASA-N belongs to the class of organic compounds known as sugar acids and derivatives. Sugar acids and derivatives are compounds containing a saccharide unit which bears a carboxylic acid group. Sugar acids and derivatives Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic acyclic compounds 1,3-dicarbonyl compounds Acyloins Alpha hydroxy acids and derivatives Alpha-hydroxy ketones Beta-hydroxy ketones Beta-keto acids and derivatives Carboxylic acids Hexoses Hydrocarbon derivatives Medium-chain keto acids and derivatives Monocarboxylic acids and derivatives Organic oxides Polyols Primary alcohols Secondary alcohols 1,3-dicarbonyl compound Acyloin Alcohol Aliphatic acyclic compound Alpha-hydroxy acid Alpha-hydroxy ketone Beta-hydroxy ketone Beta-keto acid Carbonyl group Carboxylic acid Carboxylic acid derivative Hexose monosaccharide Hydrocarbon derivative Hydroxy acid Keto acid Ketone Medium-chain keto acid Monocarboxylic acid or derivatives Monosaccharide Organic oxide Polyol Primary alcohol Secondary alcohol Sugar acid hexonic acid ketoaldonic acid Solid logp -2.56 ALOGPS logs -0.27 ALOGPS solubility 1.05e+02 g/l ALOGPS logp -2.6 ChemAxon pka_strongest_acidic 3.16 ChemAxon pka_strongest_basic -3 ChemAxon iupac (2S,4R,5S)-2,4,5,6-tetrahydroxy-3-oxohexanoic acid ChemAxon average_mass 194.1394 ChemAxon mono_mass 194.042652674 ChemAxon smiles OC[C@H](O)[C@@H](O)C(=O)[C@H](O)C(O)=O ChemAxon formula C6H10O7 ChemAxon inchi InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-3,5,7-9,11H,1H2,(H,12,13)/t2-,3+,5-/m0/s1 ChemAxon inchikey WTAHRPBPWHCMHW-LWKDLAHASA-N ChemAxon polar_surface_area 135.29 ChemAxon refractivity 37.58 ChemAxon polarizability 16.3 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 7 ChemAxon donor_count 5 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 26864 Specdb::MsMs 26865 Specdb::MsMs 26866 Specdb::MsMs 33422 Specdb::MsMs 33423 Specdb::MsMs 33424 Specdb::MsMs 2421678 Specdb::MsMs 2421679 Specdb::MsMs 2421680 Specdb::MsMs 2513450 Specdb::MsMs 2513451 Specdb::MsMs 2513452 Specdb::MsIr 2392 Specdb::MsIr 2393 Specdb::MsIr 2394 Specdb::CMs 20889 Specdb::CMs 39002 Specdb::CMs 169797 Specdb::NmrOneD 150160 Specdb::NmrOneD 150161 Specdb::NmrOneD 150162 Specdb::NmrOneD 150163 Specdb::NmrOneD 150164 Specdb::NmrOneD 150165 Specdb::NmrOneD 150166 Specdb::NmrOneD 150167 Specdb::NmrOneD 150168 Specdb::NmrOneD 150169 Specdb::NmrOneD 150170 Specdb::NmrOneD 150171 Specdb::NmrOneD 150172 Specdb::NmrOneD 150173 Specdb::NmrOneD 150174 Specdb::NmrOneD 150175 Specdb::NmrOneD 150176 Specdb::NmrOneD 150177 Specdb::NmrOneD 150178 Specdb::NmrOneD 150179 HMDB06334 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823