1.0 2011-09-21 00:39:31 UTC 2025-11-19 02:45:37 UTC FDB024077 Indole-5,6-quinone Indole-5,6-quinone is involved in the tyrosine metabolism pathway. More specifically, indole-5,6-quinone is an intermediate in the production of melanin. Indole-5,6-quinone is produced from 5,6-dihydroxyindole by tyrosinase [EC:1.14.18.1]. [HMDB] 1H-indole-5,6-dione indole-5,6 quinone C8H5NO2 147.1308 147.032028409 5,6-dihydro-1H-indole-5,6-dione indole-5,6-quinone O=C1C=C2NC=CC2=CC1=O InChI=1S/C8H5NO2/c10-7-3-5-1-2-9-6(5)4-8(7)11/h1-4,9H IGGVVGHJSQSLFO-UHFFFAOYSA-N belongs to the class of organic compounds known as indoles and derivatives. These are organic compounds containing an indole, which is a bicyclic ring system made up of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. Indoles and derivatives Organic compounds Organoheterocyclic compounds Indoles and derivatives Aromatic heteropolycyclic compounds Azacyclic compounds Cyclic ketones Heteroaromatic compounds Hydrocarbon derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Pyrroles Vinylogous amides Aromatic heteropolycyclic compound Azacycle Carbonyl group Cyclic ketone Heteroaromatic compound Hydrocarbon derivative Indole or derivatives Ketone Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyrrole Vinylogous amide an alkaloid indoledione quinone Solid logp 0.09 ALOGPS logs -1.15 ALOGPS solubility 1.05e+01 g/l ALOGPS logp 0.65 ChemAxon pka_strongest_basic 4.01 ChemAxon iupac 5,6-dihydro-1H-indole-5,6-dione ChemAxon average_mass 147.1308 ChemAxon mono_mass 147.032028409 ChemAxon smiles O=C1C=C2NC=CC2=CC1=O ChemAxon formula C8H5NO2 ChemAxon inchi InChI=1S/C8H5NO2/c10-7-3-5-1-2-9-6(5)4-8(7)11/h1-4,9H ChemAxon inchikey IGGVVGHJSQSLFO-UHFFFAOYSA-N ChemAxon polar_surface_area 46.17 ChemAxon refractivity 42.15 ChemAxon polarizability 13.76 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Tyrosine Metabolism SMP00006 map00350 Specdb::MsIr 2421 Specdb::MsIr 2422 Specdb::MsIr 2423 Specdb::CMs 10335 Specdb::CMs 150336 Specdb::MsMs 288778 Specdb::MsMs 288779 Specdb::MsMs 288780 Specdb::MsMs 328009 Specdb::MsMs 328010 Specdb::MsMs 328011 Specdb::MsMs 2367166 Specdb::MsMs 2367167 Specdb::MsMs 2367168 Specdb::MsMs 2598406 Specdb::MsMs 2598407 Specdb::MsMs 2598408 Specdb::NmrOneD 88612 Specdb::NmrOneD 88613 Specdb::NmrOneD 88614 Specdb::NmrOneD 88615 Specdb::NmrOneD 88616 Specdb::NmrOneD 88617 Specdb::NmrOneD 88618 Specdb::NmrOneD 88619 Specdb::NmrOneD 88620 Specdb::NmrOneD 88621 Specdb::NmrOneD 88622 Specdb::NmrOneD 88623 Specdb::NmrOneD 88624 Specdb::NmrOneD 88625 Specdb::NmrOneD 88626 Specdb::NmrOneD 88627 Specdb::NmrOneD 88628 Specdb::NmrOneD 88629 Specdb::NmrOneD 88630 Specdb::NmrOneD 88631 HMDB06779 27406 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Milk (Cow) Type 2 specific Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823