1.0 2011-09-21 01:31:09 UTC 2015-07-21 06:59:15 UTC FDB027866 gamma-Glutamyl-Se-methylselenocysteine gamma-Glutamyl-Se-methylselenocysteine is an intermediate in selenoamino acid metabolism(KEGG ID C05695). It is generated from Se-methyl-selenocysteine via the enzyme gamma-glutamyltranspeptidase [EC:2.3.2.2]. [HMDB] C9H16N2O5Se 311.19 312.02244346 2-amino-4-{[1-carboxy-2-(methylselanyl)ethyl]carbamoyl}butanoic acid 2-amino-4-{[1-carboxy-2-(methylselanyl)ethyl]carbamoyl}butanoic acid C[Se]CC(NC(=O)CCC(N)C(O)=O)C(O)=O InChI=1S/C9H16N2O5Se/c1-17-4-6(9(15)16)11-7(12)3-2-5(10)8(13)14/h5-6H,2-4,10H2,1H3,(H,11,12)(H,13,14)(H,15,16) IEFQLTYCECVOLL-UHFFFAOYSA-N belongs to the class of organic compounds known as dipeptides. These are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. Dipeptides Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Alpha amino acids Amino acids Carbonyl compounds Carboxylic acids Dicarboxylic acids and derivatives Fatty acids and conjugates Gamma-glutamyl amino acids Glutamine and derivatives Hydrocarbon derivatives Monoalkylamines N-acyl amines N-acyl-alpha amino acids Organic oxides Organopnictogen compounds Secondary carboxylic acid amides Selenoethers Aliphatic acyclic compound Alpha-amino acid Alpha-amino acid or derivatives Alpha-dipeptide Amine Amino acid Amino acid or derivatives Carbonyl group Carboxamide group Carboxylic acid Dicarboxylic acid or derivatives Fatty acid Fatty acyl Fatty amide Gamma-glutamyl alpha-amino acid Glutamine or derivatives Hydrocarbon derivative N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-amine Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Organoselenium compound Primary aliphatic amine Primary amine Secondary carboxylic acid amide Selenoether Solid logp -3.14 ALOGPS logs -1.00 ALOGPS solubility 3.11e+01 g/l ALOGPS logp -4.5 ChemAxon pka_strongest_acidic 1.28 ChemAxon pka_strongest_basic 9.31 ChemAxon iupac 2-amino-4-{[1-carboxy-2-(methylselanyl)ethyl]carbamoyl}butanoic acid ChemAxon average_mass 311.19 ChemAxon mono_mass 312.02244346 ChemAxon smiles C[Se]CC(NC(=O)CCC(N)C(O)=O)C(O)=O ChemAxon formula C9H16N2O5Se ChemAxon inchi InChI=1S/C9H16N2O5Se/c1-17-4-6(9(15)16)11-7(12)3-2-5(10)8(13)14/h5-6H,2-4,10H2,1H3,(H,11,12)(H,13,14)(H,15,16) ChemAxon inchikey IEFQLTYCECVOLL-UHFFFAOYSA-N ChemAxon polar_surface_area 129.72 ChemAxon refractivity 66.28 ChemAxon polarizability 24.81 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 6 ChemAxon donor_count 4 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Selenoamino Acid Metabolism SMP00029 map00450 Specdb::MsMs 9023 Specdb::MsMs 9024 Specdb::MsMs 9025 Specdb::MsMs 15695 Specdb::MsMs 15696 Specdb::MsMs 15697 Specdb::MsMs 2732574 Specdb::MsMs 2732575 Specdb::MsMs 2732576 Specdb::MsMs 2976878 Specdb::MsMs 2976879 Specdb::MsMs 2976880 Specdb::NmrOneD 92512 Specdb::NmrOneD 92513 Specdb::NmrOneD 92514 Specdb::NmrOneD 92515 Specdb::NmrOneD 92516 Specdb::NmrOneD 92517 Specdb::NmrOneD 92518 Specdb::NmrOneD 92519 Specdb::NmrOneD 92520 Specdb::NmrOneD 92521 Specdb::NmrOneD 92522 Specdb::NmrOneD 92523 Specdb::NmrOneD 92524 Specdb::NmrOneD 92525 Specdb::NmrOneD 92526 Specdb::NmrOneD 92527 Specdb::NmrOneD 92528 Specdb::NmrOneD 92529 Specdb::NmrOneD 92530 Specdb::NmrOneD 92531 Specdb::CMs 10313 Specdb::CMs 39524 Specdb::CMs 147485 HMDB10716 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Gamma-glutamyltransferase 5 P36269 GGT5 Gamma-glutamyltransferase 6 Q6P531 GGT6 Gamma-glutamyltransferase 7 Q9UJ14 GGT7 Gamma-glutamyltranspeptidase 1 P19440 GGT1