1.0 2011-09-21 01:31:15 UTC 2017-04-03 05:02:17 UTC FDB027872 3-Oxodecanoic acid In humans fatty acids are predominantly formed in the liver and adipose tissue, and mammary glands during lactation. 3-Oxodecanoic acid is an intermediate in fatty acid biosynthesis. Specifically, 3-Oxodecanoic acid is converted from Malonic acid via three enzymes; 3-oxoacyl-[acyl-carrier-protein] synthase, fatty-acid Synthase and beta-ketoacyl -acyl-carrier-protein synthase II. (EC:2.3.1.41, E.C: 2.3.1.85, 2.3.1.179) [HMDB] 3-Ketodecanoate 3-Ketodecanoic acid 3-Oxocaprate 3-Oxocapric acid b-Ketocaprate b-Ketocapric acid b-Ketodecanoate b-Ketodecanoic acid b-Oxodecanoate b-Oxodecanoic acid beta-Ketocaprate beta-Ketocapric acid beta-Ketodecanoate beta-Ketodecanoic acid beta-Oxodecanoate beta-Oxodecanoic acid β-ketocaprate β-ketocapric acid β-ketodecanoate β-ketodecanoic acid β-oxodecanoate β-oxodecanoic acid C10H18O3 186.2481 186.125594442 3-oxodecanoic acid 3-oxodecanoic acid 7235-40-7 CCCCCCCC(=O)CC(O)=O InChI=1S/C10H18O3/c1-2-3-4-5-6-7-9(11)8-10(12)13/h2-8H2,1H3,(H,12,13) YXTHWTPUTHTODU-UHFFFAOYSA-N belongs to the class of organic compounds known as medium-chain keto acids and derivatives. These are keto acids with a 6 to 12 carbon atoms long side chain. Medium-chain keto acids and derivatives Organic compounds Organic acids and derivatives Keto acids and derivatives Medium-chain keto acids and derivatives Aliphatic acyclic compounds 1,3-dicarbonyl compounds Beta-hydroxy ketones Beta-keto acids and derivatives Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides 1,3-dicarbonyl compound Aliphatic acyclic compound Beta-hydroxy ketone Beta-keto acid Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Ketone Medium-chain keto acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound 3-oxo monocarboxylic acid Oxo fatty acids oxo fatty acid Solid logp 2.61 ALOGPS logs -2.68 ALOGPS solubility 3.93e-01 g/l ALOGPS logp 2.92 ChemAxon pka_strongest_acidic 4.44 ChemAxon pka_strongest_basic -7.5 ChemAxon iupac 3-oxodecanoic acid ChemAxon average_mass 186.2481 ChemAxon mono_mass 186.125594442 ChemAxon smiles CCCCCCCC(=O)CC(O)=O ChemAxon formula C10H18O3 ChemAxon inchi InChI=1S/C10H18O3/c1-2-3-4-5-6-7-9(11)8-10(12)13/h2-8H2,1H3,(H,12,13) ChemAxon inchikey YXTHWTPUTHTODU-UHFFFAOYSA-N ChemAxon polar_surface_area 54.37 ChemAxon refractivity 50.17 ChemAxon polarizability 21.19 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Fatty Acid Biosynthesis SMP00456 Specdb::MsIr 2480 Specdb::MsIr 2481 Specdb::MsIr 2482 Specdb::CMs 2576 Specdb::CMs 39531 Specdb::CMs 130486 Specdb::CMs 138220 Specdb::MsMs 182664 Specdb::MsMs 182665 Specdb::MsMs 182666 Specdb::MsMs 183012 Specdb::MsMs 183013 Specdb::MsMs 183014 Specdb::MsMs 2768696 Specdb::MsMs 2768697 Specdb::MsMs 2768698 Specdb::MsMs 2914052 Specdb::MsMs 2914053 Specdb::MsMs 2914054 Specdb::NmrOneD 313201 Specdb::NmrOneD 313202 Specdb::NmrOneD 313203 Specdb::NmrOneD 313204 Specdb::NmrOneD 313205 Specdb::NmrOneD 313206 Specdb::NmrOneD 313207 Specdb::NmrOneD 313208 Specdb::NmrOneD 313209 Specdb::NmrOneD 313210 Specdb::NmrOneD 313211 Specdb::NmrOneD 313212 Specdb::NmrOneD 313213 Specdb::NmrOneD 313214 Specdb::NmrOneD 313215 Specdb::NmrOneD 313216 Specdb::NmrOneD 313217 Specdb::NmrOneD 313218 Specdb::NmrOneD 313219 Specdb::NmrOneD 313220 HMDB10724 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial Q9NWU1 OXSM Fatty acid synthase P49327 FASN