1.0 2011-09-21 01:31:18 UTC 2015-07-21 06:59:16 UTC FDB027876 trans-Dodec-2-enoic acid In humans fatty acids are predominantly formed in the liver and adipose tissue, and mammary glands during lactation. trans-Dodec-2-enoic acid is an intermediate in fatty acid biosynthesis. Specifically, trans-Dodec-2-enoic acid is converted from (R)-3-Hydroxydodecanoic acid via two enzymes; fatty-acid Synthase and 3-Hydroxypalmitoyl- [acyl-carrier-protein] dehydratase (EC: 2.3.1.85 and EC: 4.2.1.61) [HMDB] (e)-2-Dodecenoate (e)-2-Dodecenoic acid 12:1, N-10 trans 2-Lauroleate 2-Lauroleic acid 2t-Dodecensaeure C12:1, N-10 trans Dodecen-(2t)-saeure trans-2-Lauroleate trans-2-Lauroleic acid trans-Dodec-2-enoate C12H22O2 198.3019 198.161979948 (2E)-dodec-2-enoic acid trans-2-dodecenoic acid CCCCCCCCC\C=C\C(O)=O InChI=1S/C12H22O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h10-11H,2-9H2,1H3,(H,13,14)/b11-10+ PAWGRNGPMLVJQH-ZHACJKMWSA-N belongs to the class of organic compounds known as medium-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 4 and 12 carbon atoms. Medium-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Unsaturated fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Medium-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Unsaturated fatty acid 2-dodecenoic acid Unsaturated fatty acids Solid logp 5.02 ALOGPS logs -4.46 ALOGPS solubility 6.87e-03 g/l ALOGPS logp 4.48 ChemAxon pka_strongest_acidic 5.03 ChemAxon iupac (2E)-dodec-2-enoic acid ChemAxon average_mass 198.3019 ChemAxon mono_mass 198.161979948 ChemAxon smiles CCCCCCCCC\C=C\C(O)=O ChemAxon formula C12H22O2 ChemAxon inchi InChI=1S/C12H22O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h10-11H,2-9H2,1H3,(H,13,14)/b11-10+ ChemAxon inchikey PAWGRNGPMLVJQH-ZHACJKMWSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 59.77 ChemAxon polarizability 25.21 ChemAxon rotatable_bond_count 9 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Fatty Acid Biosynthesis SMP00456 Specdb::CMs 3165 Specdb::CMs 39536 Specdb::CMs 161265 Specdb::MsIr 2486 Specdb::MsIr 2487 Specdb::MsIr 2488 Specdb::MsMs 182853 Specdb::MsMs 182854 Specdb::MsMs 182855 Specdb::MsMs 183201 Specdb::MsMs 183202 Specdb::MsMs 183203 Specdb::MsMs 2842716 Specdb::MsMs 2842717 Specdb::MsMs 2842718 Specdb::MsMs 2866953 Specdb::MsMs 2866954 Specdb::MsMs 2866955 HMDB10729 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Fatty acid synthase P49327 FASN