1.0 2011-09-21 01:38:32 UTC 2015-07-21 06:59:23 UTC FDB028356 5-L-Glutamylglycine 5-L-glutamylglycine is one of the dipeptides that is commonly produced from polypeptides by the action of the enzyme dipeptidyl peptidase. Dietary proteins are digested to dipeptides and amino acids, and the dipeptides are absorbed more rapidly than the amino acids, because their uptake involves a separate mechanism. Dipeptides activate G-cells found in the stomach to secrete gastrin. 5-L-glutamylglycine is an excitatory amino acid receptor antagonist with a structure similar to gamma-aminobutyric acid (GABA). (PMID: 6146532) [HMDB] 5-L-Glutamyl-glycine g-L-Glu-gly gamma-Glutamyl glycine gamma-L-Glu-gly gamma-L-Glutamyl-glycine L-g-Glu-gly L-gamma-Glu-gly L-γ-glu-gly N-L-g-Glutamylglycine N-L-gamma-glutamyl-Glycine N-L-gamma-Glutamylglycine N-L-γ-glutamylglycine γ-L-glu-gly C7H12N2O5 204.1806 204.074621504 (2S)-2-amino-4-[(carboxymethyl)carbamoyl]butanoic acid (2S)-2-amino-4-(carboxymethylcarbamoyl)butanoic acid 1948-29-4 N[C@@H](CCC(=O)NCC(O)=O)C(O)=O InChI=1S/C7H12N2O5/c8-4(7(13)14)1-2-5(10)9-3-6(11)12/h4H,1-3,8H2,(H,9,10)(H,11,12)(H,13,14)/t4-/m0/s1 ACIJGUBIMXQCMF-BYPYZUCNSA-N belongs to the class of organic compounds known as dipeptides. These are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. Dipeptides Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Amino acids Carbonyl compounds Carboxylic acids Dicarboxylic acids and derivatives Fatty acids and conjugates Gamma-glutamyl amino acids Glutamine and derivatives Hydrocarbon derivatives L-alpha-amino acids Monoalkylamines N-acyl amines N-acyl-alpha amino acids Organic oxides Organopnictogen compounds Secondary carboxylic acid amides Aliphatic acyclic compound Alpha-amino acid Alpha-amino acid or derivatives Alpha-dipeptide Amine Amino acid Amino acid or derivatives Carbonyl group Carboxamide group Carboxylic acid Dicarboxylic acid or derivatives Fatty acid Fatty acyl Fatty amide Gamma-glutamyl alpha-amino acid Glutamine or derivatives Hydrocarbon derivative L-alpha-amino acid N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-amine Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Secondary carboxylic acid amide dipeptide Solid logp -3.47 ALOGPS logs -0.98 ALOGPS solubility 2.12e+01 g/l ALOGPS logp -4.4 ChemAxon pka_strongest_acidic 1.83 ChemAxon pka_strongest_basic 9.31 ChemAxon iupac (2S)-2-amino-4-[(carboxymethyl)carbamoyl]butanoic acid ChemAxon average_mass 204.1806 ChemAxon mono_mass 204.074621504 ChemAxon smiles N[C@@H](CCC(=O)NCC(O)=O)C(O)=O ChemAxon formula C7H12N2O5 ChemAxon inchi InChI=1S/C7H12N2O5/c8-4(7(13)14)1-2-5(10)9-3-6(11)12/h4H,1-3,8H2,(H,9,10)(H,11,12)(H,13,14)/t4-/m0/s1 ChemAxon inchikey ACIJGUBIMXQCMF-BYPYZUCNSA-N ChemAxon polar_surface_area 129.72 ChemAxon refractivity 44.09 ChemAxon polarizability 18.82 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 6 ChemAxon donor_count 4 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 25772 Specdb::CMs 39753 Specdb::CMs 131475 Specdb::CMs 139209 Specdb::MsIr 2567 Specdb::MsIr 2568 Specdb::MsIr 2569 Specdb::NmrOneD 150870 Specdb::NmrOneD 150871 Specdb::NmrOneD 150872 Specdb::NmrOneD 150873 Specdb::NmrOneD 150874 Specdb::NmrOneD 150875 Specdb::NmrOneD 150876 Specdb::NmrOneD 150877 Specdb::NmrOneD 150878 Specdb::NmrOneD 150879 Specdb::NmrOneD 150880 Specdb::NmrOneD 150881 Specdb::NmrOneD 150882 Specdb::NmrOneD 150883 Specdb::NmrOneD 150884 Specdb::NmrOneD 150885 Specdb::NmrOneD 150886 Specdb::NmrOneD 150887 Specdb::NmrOneD 150888 Specdb::NmrOneD 150889 Specdb::MsMs 323116 Specdb::MsMs 323117 Specdb::MsMs 323118 Specdb::MsMs 371197 Specdb::MsMs 371198 Specdb::MsMs 371199 Specdb::MsMs 2304474 Specdb::MsMs 2304475 Specdb::MsMs 2304476 Specdb::MsMs 3061916 Specdb::MsMs 3061917 Specdb::MsMs 3061918 HMDB11667 #<Reference:0x000055ce32218350> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823