1.0 2011-09-21 01:38:38 UTC 2015-07-21 06:59:23 UTC FDB028364 D-Xylono-1,5-lactone D-xylonolactone is a lactone derivative of xylonic acid. It is an intermediate in the pentose and glucuronate interconversion pathway and can be formed from either D-xylonic acid or D-xylose. D-xylose is a simple 5 carbon sugar that is found in a variety of edible plants. It is also frequently used in intestinal absorption tests to help diagnose problems that prevent the small intestine from absorbing nutrients in food. Xylose is also the first saccharide added to the serine or threonine in the proteoglycan type O-glycosylation and so it is the first saccharide in biosynthetic pathways of most anionic polysaccharides such as heparan sulfate and chondroitin sulfate. D-xylose is normally easily absorbed by the intestines where it can be converted to D-xylonolactone by intestinal D-xylose 1-dehydrogenase (EC 1.1.1.175). [HMDB] D-Xylonolactone Xylonolactone C5H8O5 148.114 148.037173366 (3R,4S,5R)-3,4,5-trihydroxyoxan-2-one D-xylonolactone O[C@@H]1COC(=O)[C@H](O)[C@H]1O InChI=1S/C5H8O5/c6-2-1-10-5(9)4(8)3(2)7/h2-4,6-8H,1H2/t2-,3+,4-/m1/s1 XXBSUZSONOQQGK-FLRLBIABSA-N belongs to the class of organic compounds known as delta valerolactones. These are cyclic organic compounds containing an oxan-2- one moiety. Delta valerolactones Organic compounds Organoheterocyclic compounds Lactones Delta valerolactones Aliphatic heteromonocyclic compounds Carbonyl compounds Carboxylic acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Oxacyclic compounds Oxanes Polyols Secondary alcohols Alcohol Aliphatic heteromonocyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Delta valerolactone Delta_valerolactone Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Oxacycle Oxane Polyol Secondary alcohol xylonolactone Solid logp -2.09 ALOGPS logs 0.75 ALOGPS solubility 8.30e+02 g/l ALOGPS logp -2.1 ChemAxon pka_strongest_acidic 11.63 ChemAxon pka_strongest_basic -3.5 ChemAxon iupac (3R,4S,5R)-3,4,5-trihydroxyoxan-2-one ChemAxon average_mass 148.114 ChemAxon mono_mass 148.037173366 ChemAxon smiles O[C@@H]1COC(=O)[C@H](O)[C@H]1O ChemAxon formula C5H8O5 ChemAxon inchi InChI=1S/C5H8O5/c6-2-1-10-5(9)4(8)3(2)7/h2-4,6-8H,1H2/t2-,3+,4-/m1/s1 ChemAxon inchikey XXBSUZSONOQQGK-FLRLBIABSA-N ChemAxon polar_surface_area 86.99 ChemAxon refractivity 28.82 ChemAxon polarizability 12.53 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 13039 Specdb::CMs 39759 Specdb::CMs 163099 Specdb::MsIr 2570 Specdb::MsIr 2571 Specdb::MsIr 2572 Specdb::MsMs 294631 Specdb::MsMs 294632 Specdb::MsMs 294633 Specdb::MsMs 335413 Specdb::MsMs 335414 Specdb::MsMs 335415 Specdb::MsMs 2322511 Specdb::MsMs 2322512 Specdb::MsMs 2322513 Specdb::MsMs 2616069 Specdb::MsMs 2616070 Specdb::MsMs 2616071 Specdb::NmrOneD 150950 Specdb::NmrOneD 150951 Specdb::NmrOneD 150952 Specdb::NmrOneD 150953 Specdb::NmrOneD 150954 Specdb::NmrOneD 150955 Specdb::NmrOneD 150956 Specdb::NmrOneD 150957 Specdb::NmrOneD 150958 Specdb::NmrOneD 150959 Specdb::NmrOneD 150960 Specdb::NmrOneD 150961 Specdb::NmrOneD 150962 Specdb::NmrOneD 150963 Specdb::NmrOneD 150964 Specdb::NmrOneD 150965 Specdb::NmrOneD 150966 Specdb::NmrOneD 150967 Specdb::NmrOneD 150968 Specdb::NmrOneD 150969 HMDB11676 15867 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Q9UQ10 DHDH