1.0 2011-09-21 01:39:17 UTC 2019-11-26 03:21:28 UTC FDB028406 2-Methylhippuric acid Methylhippuric acid is an acyl glycine. Acyl glycines are normally minor metabolites of fatty acids. However, the excretion of certain acyl glycines is increased in several inborn errors of metabolism. In certain cases the measurement of these metabolites in body fluids can be used to diagnose disorders associated with mitochondrial fatty acid beta-oxidation. Acyl glycines are produced through the action of glycine N-acyltransferase (EC 2.3.1.13) which is an enzyme that catalyzes the chemical reaction: acyl-CoA + glycine < -- > CoA + N-acylglycine. Methylhippuric acid is a metabolite of xylene which is an aromatic hydrocarbon widely used as a solvant. It's level can be measured in urine of workers exposed to xylene (PMID 8689499). [HMDB] 2-Methylhippate 2-Methylhippic acid 2-Methylhippuric acid N-(2-methylbenzoyl)-Glycine N-(2-Methylbenzoyl)glycine N-(methylbenzoyl)-Glycine N-(Methylbenzoyl)glycine N-(o-Toluoyl)-glycine N-(o-Toluoyl)glycine o-Methylhippuric acid O-Tolate O-Tolic acid o-Toluric acid C10H11NO3 193.1992 193.073893223 2-[(2-methylphenyl)formamido]acetic acid methyl hippurate 42013-20-7 CC1=CC=CC=C1C(=O)NCC(O)=O InChI=1S/C10H11NO3/c1-7-4-2-3-5-8(7)10(14)11-6-9(12)13/h2-5H,6H2,1H3,(H,11,14)(H,12,13) YOEBAVRJHRCKRE-UHFFFAOYSA-N belongs to the class of organic compounds known as hippuric acids. Hippuric acids are compounds containing hippuric acid, which consists of a of a benzoyl group linked to the N-terminal of a glycine. Hippuric acids Organic compounds Benzenoids Benzene and substituted derivatives Benzoic acids and derivatives Aromatic homomonocyclic compounds Benzoyl derivatives Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives N-acyl-alpha amino acids Organic oxides Organonitrogen compounds Organopnictogen compounds Secondary carboxylic acid amides o-Toluamides Alpha-amino acid or derivatives Aromatic homomonocyclic compound Benzoyl Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid derivative Hippuric acid Hydrocarbon derivative Monocarboxylic acid or derivatives N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid O-toluamide Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary carboxylic acid amide Toluamide Toluene N-acylglycine Solid logp 0.66 ALOGPS logs -2.51 ALOGPS solubility 6.04e-01 g/l ALOGPS logp 1.04 ChemAxon pka_strongest_acidic 3.76 ChemAxon pka_strongest_basic -1.2 ChemAxon iupac 2-[(2-methylphenyl)formamido]acetic acid ChemAxon average_mass 193.1992 ChemAxon mono_mass 193.073893223 ChemAxon smiles CC1=CC=CC=C1C(=O)NCC(O)=O ChemAxon formula C10H11NO3 ChemAxon inchi InChI=1S/C10H11NO3/c1-7-4-2-3-5-8(7)10(14)11-6-9(12)13/h2-5H,6H2,1H3,(H,11,14)(H,12,13) ChemAxon inchikey YOEBAVRJHRCKRE-UHFFFAOYSA-N ChemAxon polar_surface_area 66.4 ChemAxon refractivity 51.16 ChemAxon polarizability 19.48 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 2054 Specdb::NmrOneD 166380 Specdb::NmrOneD 166662 Specdb::CMs 19998 Specdb::CMs 27219 Specdb::CMs 30086 Specdb::CMs 30087 Specdb::CMs 30431 Specdb::CMs 30432 Specdb::CMs 39776 Specdb::CMs 99972 Specdb::CMs 99973 Specdb::CMs 99974 Specdb::CMs 99975 Specdb::CMs 99976 Specdb::CMs 162910 Specdb::NmrTwoD 1987 Specdb::MsIr 2585 Specdb::MsIr 2586 Specdb::MsIr 2587 Specdb::MsMs 83073 Specdb::MsMs 83074 Specdb::MsMs 83075 Specdb::MsMs 144591 Specdb::MsMs 144592 Specdb::MsMs 144593 Specdb::MsMs 2244649 Specdb::MsMs 2245455 Specdb::MsMs 2246801 Specdb::MsMs 2247500 Specdb::MsMs 2248912 Specdb::MsMs 2249465 Specdb::MsMs 2459785 Specdb::MsMs 2459786 Specdb::MsMs 2459787 Specdb::MsMs 2475788 Specdb::MsMs 2475789 Specdb::MsMs 2475790 HMDB11723 #<Reference:0x00007f09102b5b90> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Milk (Cow) Type 2 specific Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Glycine N-acyltransferase Q6IB77 GLYAT