1.0 2011-09-21 01:45:04 UTC 2015-07-21 06:59:32 UTC FDB028795 (S)-5-Amino-3-oxohexanoate S)-5-Amino-3-oxohexanoate is an intermediate in lysine degradation. L-Lysine is an essential amino acid that is a necessary building block for all protein in the body and It plays a major role in calcium absorption; building muscle protein; recovering from surgery or sports injuries; and the body's production of hormones, enzymes, and antibodies. In lysine degradation pathway, (S)-5-Amino-3-oxohexanoate is a substrate for the enzyme L-erythro-3,5-diaminohexanoate dehydrogenase (EC 1.4.1.11) and can be generated from L-erythro-3,5-Diaminohexanoate. [HMDB] (S)-5-amino-3-oxo-Hexanoate (S)-5-amino-3-oxo-Hexanoic acid (S)-5-Amino-3-oxohexanoate (S)-5-Amino-3-oxohexanoic acid 3-Keto-5-aminohexanoate 3-Keto-5-aminohexanoic acid 5-Amino-3-oxohexanoate 5-Amino-3-oxohexanoic acid C6H11NO3 145.1564 145.073893223 (5S)-5-amino-3-oxohexanoic acid (S)-5-amino-3-oxohexanoic acid 19355-90-9 C[C@H](N)CC(=O)CC(O)=O InChI=1S/C6H11NO3/c1-4(7)2-5(8)3-6(9)10/h4H,2-3,7H2,1H3,(H,9,10)/t4-/m0/s1 FAASBXNEOGMQHS-BYPYZUCNSA-N belongs to the class of organic compounds known as medium-chain keto acids and derivatives. These are keto acids with a 6 to 12 carbon atoms long side chain. Medium-chain keto acids and derivatives Organic compounds Organic acids and derivatives Keto acids and derivatives Medium-chain keto acids and derivatives Aliphatic acyclic compounds 1,3-dicarbonyl compounds Amino acids Amino fatty acids Beta-amino ketones Beta-hydroxy ketones Beta-keto acids and derivatives Carboxylic acids Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds 1,3-dicarbonyl compound Aliphatic acyclic compound Amine Amino acid Amino acid or derivatives Amino fatty acid Beta-aminoketone Beta-hydroxy ketone Beta-keto acid Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acyl Hydrocarbon derivative Ketone Medium-chain keto acid Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine 3-oxo monocarboxylic acid Oxo fatty acids Oxo fatty acids delta-amino acid Solid logp -2.45 ALOGPS logs -0.35 ALOGPS solubility 6.43e+01 g/l ALOGPS logp -2.5 ChemAxon pka_strongest_acidic 4.08 ChemAxon pka_strongest_basic 9.89 ChemAxon iupac (5S)-5-amino-3-oxohexanoic acid ChemAxon average_mass 145.1564 ChemAxon mono_mass 145.073893223 ChemAxon smiles C[C@H](N)CC(=O)CC(O)=O ChemAxon formula C6H11NO3 ChemAxon inchi InChI=1S/C6H11NO3/c1-4(7)2-5(8)3-6(9)10/h4H,2-3,7H2,1H3,(H,9,10)/t4-/m0/s1 ChemAxon inchikey FAASBXNEOGMQHS-BYPYZUCNSA-N ChemAxon polar_surface_area 80.39 ChemAxon refractivity 35.02 ChemAxon polarizability 14.24 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 2637 Specdb::MsIr 2638 Specdb::MsIr 2639 Specdb::CMs 21229 Specdb::CMs 39822 Specdb::CMs 161978 Specdb::NmrOneD 95458 Specdb::NmrOneD 95459 Specdb::NmrOneD 95460 Specdb::NmrOneD 95461 Specdb::NmrOneD 95462 Specdb::NmrOneD 95463 Specdb::NmrOneD 95464 Specdb::NmrOneD 95465 Specdb::NmrOneD 95466 Specdb::NmrOneD 95467 Specdb::NmrOneD 95468 Specdb::NmrOneD 95469 Specdb::NmrOneD 95470 Specdb::NmrOneD 95471 Specdb::NmrOneD 95472 Specdb::NmrOneD 95473 Specdb::NmrOneD 95474 Specdb::NmrOneD 95475 Specdb::NmrOneD 95476 Specdb::NmrOneD 95477 Specdb::MsMs 313237 Specdb::MsMs 313238 Specdb::MsMs 313239 Specdb::MsMs 358687 Specdb::MsMs 358688 Specdb::MsMs 358689 Specdb::MsMs 2772887 Specdb::MsMs 2772888 Specdb::MsMs 2772889 Specdb::MsMs 2909783 Specdb::MsMs 2909784 Specdb::MsMs 2909785 HMDB12131 27713 KMH Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823