1.0 2011-09-21 01:45:28 UTC 2015-07-21 06:59:32 UTC FDB028817 4-(Glutamylamino) butanoate 4-(Glutamylamino) butanoate is a polyamine that is an intermediate in putrescine degradation II. Polyamines (the most common of which are putrescine , spermidine , and spermine ), a group of positively charged small molecules present in virtually all living organisms, have been implicated in many biological processes, including binding to nucleic acids, stabilizing membranes, and stimulating several enzymes. Although polyamines are clearly necessary for optimal cell growth, a surplus of polyamines can cause inhibition of growth and protein synthesis, and thus a balance is desired between the production and breakdown of polyamines. In putrescine degradation II, 4-(Glutamylamino) butanoate is a substrate for gamma-glutamyl-gamma-aminobutyrate hydrolase (puuD) and can be generated from the hydrolysis of gamma-glutamyl-gamma-aminobutyraldehyde. [HMDB] 4-(Glutamylamino)butanoate 4-(Glutamylamino)butanoic acid 4-(L-gamma-glutamylamino)butanoate 4-(L-gamma-glutamylamino)butanoic acid 4-(L-glutam-5-ylamino)butanoate 4-(L-glutam-5-ylamino)butanoic acid g Glutamyl gaba g-Glutamyl-gaba g-L-Glu-g-abu g-L-Glutamyl-g-aminobutyrate g-L-Glutamyl-g-aminobutyric acid Gamma glutamyl gaba Gamma-glu-gaba Gamma-glutamyl-gaba Gamma-glutamyl-gamma aminobutyric acid Gamma-glutamyl-gamma-aminobutyrate Gamma-l-glu-gamma-abu gamma-L-Glutamyl-gamma-aminobutyrate Gamma-l-glutamyl-gamma-aminobutyric acid Glugaba Glutamylgaba N(5)-(3-carboxypropyl)-L-glutamine γ glutamyl gaba γ-glutamyl-gaba γ-L-glu-γ-abu γ-L-glutamyl-γ-aminobutyrate γ-L-glutamyl-γ-aminobutyric acid C9H16N2O5 232.2337 232.105921632 (2S)-2-amino-4-[(3-carboxypropyl)carbamoyl]butanoic acid glugaba 5105-96-4 N[C@@H](CCC(=O)NCCCC(O)=O)C(O)=O InChI=1S/C9H16N2O5/c10-6(9(15)16)3-4-7(12)11-5-1-2-8(13)14/h6H,1-5,10H2,(H,11,12)(H,13,14)(H,15,16)/t6-/m0/s1 MKYPKZSGLSOGLL-LURJTMIESA-N belongs to the class of organic compounds known as glutamine and derivatives. Glutamine and derivatives are compounds containing glutamine or a derivative thereof resulting from reaction of glutamine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Glutamine and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Amino acids Carbonyl compounds Carboxylic acids Dicarboxylic acids and derivatives Fatty acids and conjugates Gamma amino acids and derivatives Hydrocarbon derivatives L-alpha-amino acids Monoalkylamines N-acyl amines Organic oxides Organopnictogen compounds Secondary carboxylic acid amides Aliphatic acyclic compound Alpha-amino acid Amine Amino acid Carbonyl group Carboxamide group Carboxylic acid Dicarboxylic acid or derivatives Fatty acid Fatty acyl Fatty amide Gamma amino acid or derivatives Glutamine or derivatives Hydrocarbon derivative L-alpha-amino acid N-acyl-amine Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Secondary carboxylic acid amide amino dicarboxylic acid Solid logp -3.37 ALOGPS logs -1.28 ALOGPS solubility 1.21e+01 g/l ALOGPS logp -3.9 ChemAxon pka_strongest_acidic 2.3 ChemAxon pka_strongest_basic 9.31 ChemAxon iupac (2S)-2-amino-4-[(3-carboxypropyl)carbamoyl]butanoic acid ChemAxon average_mass 232.2337 ChemAxon mono_mass 232.105921632 ChemAxon smiles N[C@@H](CCC(=O)NCCCC(O)=O)C(O)=O ChemAxon formula C9H16N2O5 ChemAxon inchi InChI=1S/C9H16N2O5/c10-6(9(15)16)3-4-7(12)11-5-1-2-8(13)14/h6H,1-5,10H2,(H,11,12)(H,13,14)(H,15,16)/t6-/m0/s1 ChemAxon inchikey MKYPKZSGLSOGLL-LURJTMIESA-N ChemAxon polar_surface_area 129.72 ChemAxon refractivity 53.55 ChemAxon polarizability 23.13 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 6 ChemAxon donor_count 4 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 27572 Specdb::MsMs 27573 Specdb::MsMs 27574 Specdb::MsMs 34130 Specdb::MsMs 34131 Specdb::MsMs 34132 Specdb::MsMs 2735708 Specdb::MsMs 2735709 Specdb::MsMs 2735710 Specdb::MsMs 2973396 Specdb::MsMs 2973397 Specdb::MsMs 2973398 Specdb::CMs 2849 Specdb::CMs 39841 Specdb::CMs 175409 Specdb::NmrOneD 95578 Specdb::NmrOneD 95579 Specdb::NmrOneD 95580 Specdb::NmrOneD 95581 Specdb::NmrOneD 95582 Specdb::NmrOneD 95583 Specdb::NmrOneD 95584 Specdb::NmrOneD 95585 Specdb::NmrOneD 95586 Specdb::NmrOneD 95587 Specdb::NmrOneD 95588 Specdb::NmrOneD 95589 Specdb::NmrOneD 95590 Specdb::NmrOneD 95591 Specdb::NmrOneD 95592 Specdb::NmrOneD 95593 Specdb::NmrOneD 95594 Specdb::NmrOneD 95595 Specdb::NmrOneD 95596 Specdb::NmrOneD 95597 HMDB12161 49260 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823