1.0 2011-09-21 01:46:59 UTC 2015-07-21 06:59:34 UTC FDB028898 Methylarsonite Methylarsonite is found in the arsenate detoxification I pathway. Two molecules of glutathione reacts with methylarsonate to produce glutathione disulfide and methylarsonite. Methylarsonate reductase catalyzes this reaction. Methylarsonite reacts with S-adenosyl-L-methionine to produce S-adenosyl-L-homocysteine and dimethylarsinate. Methylarsonite methyltransferase catalyzes this reaction. [HMDB] MeAs(OH)2 Methanearsonous acid methyl Arsonous acid Methylarsonous acid Mma(III) MmaIII Monomethylarsonous acid CH5AsO2 123.9708 123.950550821 methylarsonous acid methylarsonous acid 25400-23-1 C[As](O)O InChI=1S/CH5AsO2/c1-2(3)4/h3-4H,1H3 OXBIRPQQKCQWGV-UHFFFAOYSA-N belongs to the class of organic compounds known as trivalent organic arsenic compounds. These are organoarsenic compounds in which a carbon is linked to a trivalent arsenic atom. Trivalent organic arsenic compounds Organic compounds Organometallic compounds Organometalloid compounds Organoarsenic compounds Aliphatic acyclic compounds Hydrocarbon derivatives Organic metalloid salts Organic oxygen compounds Organoarsonous acids Organopnictogen compounds Oxygen-containing organoarsenic compounds Aliphatic acyclic compound Hydrocarbon derivative Organic metalloid salt Organic oxygen compound Organic salt Organoarsonous acid Organopnictogen compound Oxygen-containing organoarsenic compound Trivalent organic arsenic compound a small molecule arsonous acids one-carbon compound Solid logp -0.90 ALOGPS logs 0.76 ALOGPS solubility 7.08e+02 g/l ALOGPS logp -1 ChemAxon pka_strongest_acidic 8.65 ChemAxon pka_strongest_basic -5.4 ChemAxon iupac methylarsonous acid ChemAxon average_mass 123.9708 ChemAxon mono_mass 123.950550821 ChemAxon smiles C[As](O)O ChemAxon formula CH5AsO2 ChemAxon inchi InChI=1S/CH5AsO2/c1-2(3)4/h3-4H,1H3 ChemAxon inchikey OXBIRPQQKCQWGV-UHFFFAOYSA-N ChemAxon polar_surface_area 40.46 ChemAxon refractivity 11.07 ChemAxon polarizability 7.34 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 22174 Specdb::CMs 164964 Specdb::MsIr 2741 Specdb::MsIr 2742 Specdb::MsIr 2743 Specdb::NmrOneD 96758 Specdb::NmrOneD 96759 Specdb::NmrOneD 96760 Specdb::NmrOneD 96761 Specdb::NmrOneD 96762 Specdb::NmrOneD 96763 Specdb::NmrOneD 96764 Specdb::NmrOneD 96765 Specdb::NmrOneD 96766 Specdb::NmrOneD 96767 Specdb::NmrOneD 96768 Specdb::NmrOneD 96769 Specdb::NmrOneD 96770 Specdb::NmrOneD 96771 Specdb::NmrOneD 96772 Specdb::NmrOneD 96773 Specdb::NmrOneD 96774 Specdb::NmrOneD 96775 Specdb::NmrOneD 96776 Specdb::NmrOneD 96777 Specdb::MsMs 315223 Specdb::MsMs 315224 Specdb::MsMs 315225 Specdb::MsMs 361150 Specdb::MsMs 361151 Specdb::MsMs 361152 Specdb::MsMs 2302323 Specdb::MsMs 2302324 Specdb::MsMs 2302325 Specdb::MsMs 3066329 Specdb::MsMs 3066330 Specdb::MsMs 3066331 HMDB12259 14597 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Glutathione S-transferase omega-1 P78417 GSTO1 Glutathione S-transferase omega-2 Q9H4Y5 GSTO2